New Search

Item 1 of 1 (back to results)

FM 4-64(2+)
A pyridinium cation with a 3-(triethylammonio)propyl substituent at the 1-position and a 6-[4-(dibutylamino)phenyl]hexa-1,3,5-trien-1-yl substituent at the 4-position.


Current search:

05. Industrial Uses: dye [CHEBI:37958] > fluorescent dye [CHEBI:51121] > fluorochrome [CHEBI:51217] > FM 4-64(2+) [CHEBI:52856]
×

Select any link to see items in a related category.

more general categories    information about this item
05. Industrial Uses 
05. Industrial Uses
 dye [CHEBI:37958] (446) 
 fluorescent dye [CHEBI:51121] (410) 
 fluorochrome [CHEBI:51217] (404) 
 FM 4-64(2+) [CHEBI:52856] (1)
08. Chemical Category 
08. Chemical Category
 ion [CHEBI:24870] (4391) 
 organic ion [CHEBI:25699] (3577) 
 organic cation [CHEBI:25697] (428) 
 pyridinium ion [CHEBI:50334] (26) 
 FM 4-64(2+) [CHEBI:52856] (1)
 polyatomic ion [CHEBI:36358] (2633) 
 polyatomic cation [CHEBI:33702] (611) 
 ammonium ion [CHEBI:35274] (507) 
 quaternary ammonium ion [CHEBI:35267] (174) 
 FM 4-64(2+) [CHEBI:52856] (1)
 cation [CHEBI:36916] (947) 
 organic cation [CHEBI:25697] (428) 
 pyridinium ion [CHEBI:50334] (26) 
 FM 4-64(2+) [CHEBI:52856] (1)
 polyatomic cation [CHEBI:33702] (611) 
 ammonium ion [CHEBI:35274] (507) 
 quaternary ammonium ion [CHEBI:35267] (174) 
 FM 4-64(2+) [CHEBI:52856] (1)
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 ammonium ion [CHEBI:35274] (507) 
 quaternary ammonium ion [CHEBI:35267] (174) 
 FM 4-64(2+) [CHEBI:52856] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyridines [CHEBI:26421] (254) 
 pyridinium ion [CHEBI:50334] (26) 
 FM 4-64(2+) [CHEBI:52856] (1)
 organic amino compound [CHEBI:50047] (2472) 
 amine [CHEBI:32952] (179) 
 tertiary amine [CHEBI:32876] (84) 
 FM 4-64(2+) [CHEBI:52856] (1)
 tertiary amino compound [CHEBI:50996] (199) 
 tertiary amine [CHEBI:32876] (84) 
 FM 4-64(2+) [CHEBI:52856] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 organic ion [CHEBI:25699] (3577) 
 organic cation [CHEBI:25697] (428) 
 pyridinium ion [CHEBI:50334] (26) 
 FM 4-64(2+) [CHEBI:52856] (1)
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 pyridinium ion [CHEBI:50334] (26) 
 FM 4-64(2+) [CHEBI:52856] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyridines [CHEBI:26421] (254) 
 pyridinium ion [CHEBI:50334] (26) 
 FM 4-64(2+) [CHEBI:52856] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyridines [CHEBI:26421] (254) 
 pyridinium ion [CHEBI:50334] (26) 
 FM 4-64(2+) [CHEBI:52856] (1)
 organic amino compound [CHEBI:50047] (2472) 
 amine [CHEBI:32952] (179) 
 tertiary amine [CHEBI:32876] (84) 
 FM 4-64(2+) [CHEBI:52856] (1)
 tertiary amino compound [CHEBI:50996] (199) 
 tertiary amine [CHEBI:32876] (84) 
 FM 4-64(2+) [CHEBI:52856] (1)
 organic amino compound [CHEBI:50047] (2472) 
 amine [CHEBI:32952] (179) 
 tertiary amine [CHEBI:32876] (84) 
 FM 4-64(2+) [CHEBI:52856] (1)
 tertiary amino compound [CHEBI:50996] (199) 
 tertiary amine [CHEBI:32876] (84) 
 FM 4-64(2+) [CHEBI:52856] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 pyridinium ion [CHEBI:50334] (26) 
 FM 4-64(2+) [CHEBI:52856] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyridines [CHEBI:26421] (254) 
 pyridinium ion [CHEBI:50334] (26) 
 FM 4-64(2+) [CHEBI:52856] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 monocyclic compound [CHEBI:33661] (2007) 
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 pyridinium ion [CHEBI:50334] (26) 
 FM 4-64(2+) [CHEBI:52856] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 pyridinium ion [CHEBI:50334] (26) 
 FM 4-64(2+) [CHEBI:52856] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyridines [CHEBI:26421] (254) 
 pyridinium ion [CHEBI:50334] (26) 
 FM 4-64(2+) [CHEBI:52856] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 pyridinium ion [CHEBI:50334] (26) 
 FM 4-64(2+) [CHEBI:52856] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyridines [CHEBI:26421] (254) 
 pyridinium ion [CHEBI:50334] (26) 
 FM 4-64(2+) [CHEBI:52856] (1)
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 pyridinium ion [CHEBI:50334] (26) 
 FM 4-64(2+) [CHEBI:52856] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 pyridinium ion [CHEBI:50334] (26) 
 FM 4-64(2+) [CHEBI:52856] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyridines [CHEBI:26421] (254) 
 pyridinium ion [CHEBI:50334] (26) 
 FM 4-64(2+) [CHEBI:52856] (1)
 polyatomic ion [CHEBI:36358] (2633) 
 polyatomic cation [CHEBI:33702] (611) 
 ammonium ion [CHEBI:35274] (507) 
 quaternary ammonium ion [CHEBI:35267] (174) 
 FM 4-64(2+) [CHEBI:52856] (1)
ChEBI Compound Accession Identifier  [CHEBI:52856]
ChEBI Compound Description  A pyridinium cation with a 3-(triethylammonio)propyl substituent at the 1-position and a 6-[4-(dibutylamino)phenyl]hexa-1,3,5-trien-1-yl substituent at the 4-position.
ChEBI Compound Identification Number  52856
ChEBI InChI Value  InChI=1S/C34H53N3/c1-6-11-27-36(28-12-7-2)34-22-20-32(21-23-34)18-15-13-14-16-19-33-24-29-35(30-25-33)26-17-31-37(8-3,9-4)10-5/h13-16,18-25,29-30H,6-12,17,26-28,31H2,1-5H3/q+2
ChEBI InChIKey Value  JGVVSBSPWPPLRS-UHFFFAOYSA-N
ChEBI Compound Name  FM 4-64(2+)
ChEBI SMILES Value  [H]C(=CC([H])=Cc1cc[n+](CCC[N+](CC)(CC)CC)cc1)C=C([H])c1ccc(cc1)N(CCCC)CCCC
ChEBI Substance ID  85164825
ChEBI URL  ChEBI:52856
ChemSpider ID  NS
Ontomatica Chemical Accession Key (OnChAKey)  JGVVSBSPWPPLRS_UHFFFAOYSA_N_000_000000
PubChem Compound ID  25195392