Item 1 of 1 (back to results) sulforhodamine G anion An anionic fluorescent dye derived from sulforhodamine.

Current search: 05. Industrial Uses: dye [CHEBI:37958] > fluorescent dye [CHEBI:51121] > fluorochrome [CHEBI:51217] > sulforhodamine G anion [CHEBI:52921] × Select any link to see items in a related category. more general categories    information about this item 05. Industrial Uses  05. Industrial Uses  dye [CHEBI:37958] (446)   fluorescent dye [CHEBI:51121] (410)   fluorochrome [CHEBI:51217] (404)   sulforhodamine G anion [CHEBI:52921] (1) 08. Chemical Category  08. Chemical Category  ion [CHEBI:24870] (4391)   anion [CHEBI:22563] (3454)   organic anion [CHEBI:25696] (3155)   organosulfonate oxoanion [CHEBI:33554] (117)   sulforhodamine G anion [CHEBI:52921] (1)  organic ion [CHEBI:25699] (3577)   organic anion [CHEBI:25696] (3155)   organosulfonate oxoanion [CHEBI:33554] (117)   sulforhodamine G anion [CHEBI:52921] (1)  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   oxacycle [CHEBI:38104] (2002)   dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   sulforhodamine G anion [CHEBI:52921] (1)  sulfur molecular entity [CHEBI:26835] (1541)   sulfur oxoacid derivative [CHEBI:33424] (628)   sulfonic acid derivative [CHEBI:33552] (393)   organosulfonate oxoanion [CHEBI:33554] (117)   sulforhodamine G anion [CHEBI:52921] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   oxacycle [CHEBI:38104] (2002)   dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   sulforhodamine G anion [CHEBI:52921] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   organic ion [CHEBI:25699] (3577)   organic anion [CHEBI:25696] (3155)   organosulfonate oxoanion [CHEBI:33554] (117)   sulforhodamine G anion [CHEBI:52921] (1)  heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   sulforhodamine G anion [CHEBI:52921] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   sulforhodamine G anion [CHEBI:52921] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   sulforhodamine G anion [CHEBI:52921] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   oxacycle [CHEBI:38104] (2002)   dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   sulforhodamine G anion [CHEBI:52921] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   sulforhodamine G anion [CHEBI:52921] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   sulforhodamine G anion [CHEBI:52921] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   sulforhodamine G anion [CHEBI:52921] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   sulforhodamine G anion [CHEBI:52921] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   sulforhodamine G anion [CHEBI:52921] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   heterotricyclic compound [CHEBI:36688] (541)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   sulforhodamine G anion [CHEBI:52921] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   sulforhodamine G anion [CHEBI:52921] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   sulforhodamine G anion [CHEBI:52921] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   sulforhodamine G anion [CHEBI:52921] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   sulforhodamine G anion [CHEBI:52921] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   sulforhodamine G anion [CHEBI:52921] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   sulforhodamine G anion [CHEBI:52921] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   sulforhodamine G anion [CHEBI:52921] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   sulforhodamine G anion [CHEBI:52921] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   sulforhodamine G anion [CHEBI:52921] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   sulforhodamine G anion [CHEBI:52921] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   sulforhodamine G anion [CHEBI:52921] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   sulforhodamine G anion [CHEBI:52921] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   sulforhodamine G anion [CHEBI:52921] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   heterotricyclic compound [CHEBI:36688] (541)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   sulforhodamine G anion [CHEBI:52921] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   sulforhodamine G anion [CHEBI:52921] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   sulforhodamine G anion [CHEBI:52921] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   sulforhodamine G anion [CHEBI:52921] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   sulforhodamine G anion [CHEBI:52921] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   sulforhodamine G anion [CHEBI:52921] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   sulforhodamine G anion [CHEBI:52921] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   sulforhodamine G anion [CHEBI:52921] (1)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   sulforhodamine G anion [CHEBI:52921] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   oxoacid derivative [CHEBI:33241] (3254)   sulfur oxoacid derivative [CHEBI:33424] (628)   sulfonic acid derivative [CHEBI:33552] (393)   organosulfonate oxoanion [CHEBI:33554] (117)   sulforhodamine G anion [CHEBI:52921] (1) ChEBI Compound Accession Identifier:   [CHEBI:52921] ChEBI Compound Description:   An anionic fluorescent dye derived from sulforhodamine. ChEBI Compound Identification Number:   52921 ChEBI InChI Value:   InChI=1S/C25H26N2O7S2/c1-5-26-20-12-22-18(9-14(20)3)25(19-10-15(4)21(27-6-2)13-23(19)34-22)17-8-7-16(35(28,29)30)11-24(17)36(31,32)33/h7-13,26-27H,5-6H2,1-4H3,(H-,28,29,30,31,32,33)/p-1 ChEBI InChIKey Value:   LPNXPMVQMFVPTF-UHFFFAOYSA-M ChEBI Compound Name:   sulforhodamine G anion ChEBI SMILES Value:   CCNc1cc2[o+]c3cc(NCC)c(C)cc3c(-c3ccc(cc3S([O-])(=O)=O)S([O-])(=O)=O)c2cc1C ChEBI Substance ID:   85164815 ChEBI URL:   ChEBI:52921 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   LPNXPMVQMFVPTF_UHFFFAOYSA_M_000_000000 PubChem Compound ID:   4442137