Item 1 of 1 (back to results) Alexa Fluor 610-X(2-) A cationic fluorescent dye derived from a heteropentacyclic ring system.

Current search: 05. Industrial Uses: dye [CHEBI:37958] > fluorescent dye [CHEBI:51121] > fluorochrome [CHEBI:51217] > Alexa Fluor 610-X(2-) [CHEBI:52955] × Select any link to see items in a related category. more general categories    information about this item 05. Industrial Uses  05. Industrial Uses  dye [CHEBI:37958] (446)   fluorescent dye [CHEBI:51121] (410)   fluorochrome [CHEBI:51217] (404)   Alexa Fluor 610-X(2-) [CHEBI:52955] (1) 08. Chemical Category  08. Chemical Category  ion [CHEBI:24870] (4391)   anion [CHEBI:22563] (3454)   organic anion [CHEBI:25696] (3155)   organosulfonate oxoanion [CHEBI:33554] (117)   Alexa Fluor 610-X(2-) [CHEBI:52955] (1)  organic ion [CHEBI:25699] (3577)   organic anion [CHEBI:25696] (3155)   organosulfonate oxoanion [CHEBI:33554] (117)   Alexa Fluor 610-X(2-) [CHEBI:52955] (1)  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   sulfur molecular entity [CHEBI:26835] (1541)   sulfur oxoacid derivative [CHEBI:33424] (628)   sulfonic acid derivative [CHEBI:33552] (393)   organosulfonate oxoanion [CHEBI:33554] (117)   Alexa Fluor 610-X(2-) [CHEBI:52955] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   organic ion [CHEBI:25699] (3577)   organic anion [CHEBI:25696] (3155)   organosulfonate oxoanion [CHEBI:33554] (117)   Alexa Fluor 610-X(2-) [CHEBI:52955] (1)  heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   Alexa Fluor 610-X(2-) [CHEBI:52955] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   Alexa Fluor 610-X(2-) [CHEBI:52955] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   Alexa Fluor 610-X(2-) [CHEBI:52955] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   Alexa Fluor 610-X(2-) [CHEBI:52955] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   Alexa Fluor 610-X(2-) [CHEBI:52955] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   Alexa Fluor 610-X(2-) [CHEBI:52955] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   Alexa Fluor 610-X(2-) [CHEBI:52955] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   oxoacid derivative [CHEBI:33241] (3254)   sulfur oxoacid derivative [CHEBI:33424] (628)   sulfonic acid derivative [CHEBI:33552] (393)   organosulfonate oxoanion [CHEBI:33554] (117)   Alexa Fluor 610-X(2-) [CHEBI:52955] (1) ChEBI Compound Accession Identifier:   [CHEBI:52955] ChEBI Compound Description:   A cationic fluorescent dye derived from a heteropentacyclic ring system. ChEBI Compound Identification Number:   52955 ChEBI InChI Value:   InChI=1S/C46H47Cl3N4O14S3/c1-45(2)18-23(21-69(60,61)62)25-14-27-31(16-29(25)51(45)5)66-32-17-30-26(24(22-70(63,64)65)19-46(3,4)52(30)6)15-28(32)37(27)38-39(44(58)59)40(47)42(49)43(41(38)48)68-20-33(54)50-13-9-7-8-10-36(57)67-53-34(55)11-12-35(53)56/h14-19H,7-13,20-22H2,1-6H3,(H3-,50,54,58,59,60,61,62,63,64,65)/p-2 ChEBI InChIKey Value:   GGUZJJWHMIUOBS-UHFFFAOYSA-L ChEBI Compound Name:   Alexa Fluor 610-X(2-) ChEBI SMILES Value:   CN1c2cc3Oc4cc5=[N+](C)C(C)(C)C=C(CS([O-])(=O)=O)c5cc4=C(c3cc2C(CS([O-])(=O)=O)=CC1(C)C)c1c(Cl)c(SCC(=O)NCCCCCC(=O)ON2C(=O)CCC2=O)c(Cl)c(Cl)c1C([O-])=O ChEBI Substance ID:   85164801 ChEBI URL:   ChEBI:52955 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   GGUZJJWHMIUOBS_UHFFFAOYSA_L_000_000000 PubChem Compound ID:   44176408