Item 1 of 1 (back to results) monobromobimane A pyrazolopyrazole that consists of 1H,7H-pyrazolo[1,2-a]pyrazole-1,7-dione bearing three methyl substituents at positions 2, 5 and 6 as well as a bromomethyl substituent at the 3-position.

Current search: 05. Industrial Uses: dye [CHEBI:37958] > fluorescent dye [CHEBI:51121] > fluorochrome [CHEBI:51217] > monobromobimane [CHEBI:62825] × Select any link to see items in a related category. more general categories    information about this item 05. Industrial Uses  05. Industrial Uses  dye [CHEBI:37958] (446)   fluorescent dye [CHEBI:51121] (410)   fluorochrome [CHEBI:51217] (404)   monobromobimane [CHEBI:62825] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   halogen molecular entity [CHEBI:24471] (1475)   bromine molecular entity [CHEBI:22928] (199)   organobromine compound [CHEBI:37141] (138)   monobromobimane [CHEBI:62825] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organobromine compound [CHEBI:37141] (138)   monobromobimane [CHEBI:62825] (1)  pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyrazolopyrazole [CHEBI:62826] (5)   monobromobimane [CHEBI:62825] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyrazolopyrazole [CHEBI:62826] (5)   monobromobimane [CHEBI:62825] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   pyrazolopyrazole [CHEBI:62826] (5)   monobromobimane [CHEBI:62825] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyrazolopyrazole [CHEBI:62826] (5)   monobromobimane [CHEBI:62825] (1)  organohalogen compound [CHEBI:36684] (976)   organobromine compound [CHEBI:37141] (138)   monobromobimane [CHEBI:62825] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyrazolopyrazole [CHEBI:62826] (5)   monobromobimane [CHEBI:62825] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   pyrazolopyrazole [CHEBI:62826] (5)   monobromobimane [CHEBI:62825] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   pyrazolopyrazole [CHEBI:62826] (5)   monobromobimane [CHEBI:62825] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   pyrazolopyrazole [CHEBI:62826] (5)   monobromobimane [CHEBI:62825] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyrazolopyrazole [CHEBI:62826] (5)   monobromobimane [CHEBI:62825] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   pyrazolopyrazole [CHEBI:62826] (5)   monobromobimane [CHEBI:62825] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyrazolopyrazole [CHEBI:62826] (5)   monobromobimane [CHEBI:62825] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   pyrazolopyrazole [CHEBI:62826] (5)   monobromobimane [CHEBI:62825] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   pyrazolopyrazole [CHEBI:62826] (5)   monobromobimane [CHEBI:62825] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   pyrazolopyrazole [CHEBI:62826] (5)   monobromobimane [CHEBI:62825] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyrazolopyrazole [CHEBI:62826] (5)   monobromobimane [CHEBI:62825] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   pyrazolopyrazole [CHEBI:62826] (5)   monobromobimane [CHEBI:62825] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organobromine compound [CHEBI:37141] (138)   monobromobimane [CHEBI:62825] (1) ChEBI Compound Accession Identifier:   [CHEBI:62825] ChEBI Compound Description:   A pyrazolopyrazole that consists of 1H,7H-pyrazolo[1,2-a]pyrazole-1,7-dione bearing three methyl substituents at positions 2, 5 and 6 as well as a bromomethyl substituent at the 3-position. ChEBI Compound Identification Number:   62825 ChEBI InChI Value:   InChI=1S/C10H11BrN2O2/c1-5-7(3)12-8(4-11)6(2)10(15)13(12)9(5)14/h4H2,1-3H3 ChEBI InChIKey Value:   AHEWZZJEDQVLOP-UHFFFAOYSA-N ChEBI Compound Name:   monobromobimane ChEBI SMILES Value:   Cc1c(C)c(=O)n2n1c(CBr)c(C)c2=O ChEBI Substance ID:   126522713 ChEBI URL:   ChEBI:62825 ChemSpider ID:   102775 Ontomatica Chemical Accession Key (OnChAKey):   AHEWZZJEDQVLOP_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   114810