New Search

Item 1 of 1 (back to results)

9,10-bis(phenylethynyl)anthracene
null


Current search:

05. Industrial Uses: dye [CHEBI:37958] > fluorescent dye [CHEBI:51121] > fluorochrome [CHEBI:51217] > 9,10-bis(phenylethynyl)anthracene [CHEBI:51675]
×

Select any link to see items in a related category.

more general categories    information about this item
05. Industrial Uses 
05. Industrial Uses
 dye [CHEBI:37958] (446) 
 fluorescent dye [CHEBI:51121] (410) 
 fluorochrome [CHEBI:51217] (404) 
 9,10-bis(phenylethynyl)anthracene [CHEBI:51675] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydrides [CHEBI:33692] (1374) 
 organic hydride [CHEBI:37175] (1178) 
 organic fundamental parent [CHEBI:33245] (1178) 
 hydrocarbon [CHEBI:24632] (505) 
 acetylenes [CHEBI:33644] (17) 
 arylacetylene [CHEBI:51929] (2) 
 9,10-bis(phenylethynyl)anthracene [CHEBI:51675] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 organic fundamental parent [CHEBI:33245] (1178) 
 hydrocarbon [CHEBI:24632] (505) 
 acetylenes [CHEBI:33644] (17) 
 arylacetylene [CHEBI:51929] (2) 
 9,10-bis(phenylethynyl)anthracene [CHEBI:51675] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 acenes [CHEBI:51269] (110) 
 anthracenes [CHEBI:46955] (90) 
 9,10-bis(phenylethynyl)anthracene [CHEBI:51675] (1)
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbotricyclic compound [CHEBI:38032] (198) 
 anthracenes [CHEBI:46955] (90) 
 9,10-bis(phenylethynyl)anthracene [CHEBI:51675] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 acenes [CHEBI:51269] (110) 
 anthracenes [CHEBI:46955] (90) 
 9,10-bis(phenylethynyl)anthracene [CHEBI:51675] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 carbotricyclic compound [CHEBI:38032] (198) 
 anthracenes [CHEBI:46955] (90) 
 9,10-bis(phenylethynyl)anthracene [CHEBI:51675] (1)
 acetylenic compound [CHEBI:73474] (106) 
 acetylenes [CHEBI:33644] (17) 
 arylacetylene [CHEBI:51929] (2) 
 9,10-bis(phenylethynyl)anthracene [CHEBI:51675] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 homocyclic compound [CHEBI:33597] (1134) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 acenes [CHEBI:51269] (110) 
 anthracenes [CHEBI:46955] (90) 
 9,10-bis(phenylethynyl)anthracene [CHEBI:51675] (1)
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbotricyclic compound [CHEBI:38032] (198) 
 anthracenes [CHEBI:46955] (90) 
 9,10-bis(phenylethynyl)anthracene [CHEBI:51675] (1)
 homopolycyclic compound [CHEBI:35295] (493) 
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbotricyclic compound [CHEBI:38032] (198) 
 anthracenes [CHEBI:46955] (90) 
 9,10-bis(phenylethynyl)anthracene [CHEBI:51675] (1)
 polycyclic compound [CHEBI:33635] (4078) 
 homopolycyclic compound [CHEBI:35295] (493) 
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbotricyclic compound [CHEBI:38032] (198) 
 anthracenes [CHEBI:46955] (90) 
 9,10-bis(phenylethynyl)anthracene [CHEBI:51675] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 carbotricyclic compound [CHEBI:38032] (198) 
 anthracenes [CHEBI:46955] (90) 
 9,10-bis(phenylethynyl)anthracene [CHEBI:51675] (1)
 aromatic compound [CHEBI:33655] (3799) 
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 acenes [CHEBI:51269] (110) 
 anthracenes [CHEBI:46955] (90) 
 9,10-bis(phenylethynyl)anthracene [CHEBI:51675] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 acenes [CHEBI:51269] (110) 
 anthracenes [CHEBI:46955] (90) 
 9,10-bis(phenylethynyl)anthracene [CHEBI:51675] (1)
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbotricyclic compound [CHEBI:38032] (198) 
 anthracenes [CHEBI:46955] (90) 
 9,10-bis(phenylethynyl)anthracene [CHEBI:51675] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 acenes [CHEBI:51269] (110) 
 anthracenes [CHEBI:46955] (90) 
 9,10-bis(phenylethynyl)anthracene [CHEBI:51675] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 carbotricyclic compound [CHEBI:38032] (198) 
 anthracenes [CHEBI:46955] (90) 
 9,10-bis(phenylethynyl)anthracene [CHEBI:51675] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 acenes [CHEBI:51269] (110) 
 anthracenes [CHEBI:46955] (90) 
 9,10-bis(phenylethynyl)anthracene [CHEBI:51675] (1)
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbotricyclic compound [CHEBI:38032] (198) 
 anthracenes [CHEBI:46955] (90) 
 9,10-bis(phenylethynyl)anthracene [CHEBI:51675] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 acenes [CHEBI:51269] (110) 
 anthracenes [CHEBI:46955] (90) 
 9,10-bis(phenylethynyl)anthracene [CHEBI:51675] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 carbotricyclic compound [CHEBI:38032] (198) 
 anthracenes [CHEBI:46955] (90) 
 9,10-bis(phenylethynyl)anthracene [CHEBI:51675] (1)
 acetylenic compound [CHEBI:73474] (106) 
 acetylenes [CHEBI:33644] (17) 
 arylacetylene [CHEBI:51929] (2) 
 9,10-bis(phenylethynyl)anthracene [CHEBI:51675] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydrides [CHEBI:33692] (1374) 
 organic hydride [CHEBI:37175] (1178) 
 organic fundamental parent [CHEBI:33245] (1178) 
 hydrocarbon [CHEBI:24632] (505) 
 acetylenes [CHEBI:33644] (17) 
 arylacetylene [CHEBI:51929] (2) 
 9,10-bis(phenylethynyl)anthracene [CHEBI:51675] (1)
ChEBI Compound Accession Identifier  [CHEBI:51675]
ChEBI Compound Description  null
ChEBI Compound Identification Number  51675
ChEBI InChI Value  InChI=1S/C30H18/c1-3-11-23(12-4-1)19-21-29-25-15-7-9-17-27(25)30(28-18-10-8-16-26(28)29)22-20-24-13-5-2-6-14-24/h1-18H
ChEBI InChIKey Value  ZHBOFZNNPZNWGB-UHFFFAOYSA-N
ChEBI Compound Name  9,10-bis(phenylethynyl)anthracene
ChEBI SMILES Value  c1ccc(cc1)C#Cc1c2ccccc2c(C#Cc2ccccc2)c2ccccc12
ChEBI Substance ID  57269833
ChEBI URL  ChEBI:51675
ChemSpider ID  74309
Ontomatica Chemical Accession Key (OnChAKey)  ZHBOFZNNPZNWGB_UHFFFAOYSA_N_000_000000
PubChem Compound ID  82338