New Search

Item 1 of 1 (back to results)

cascade blue
null


Current search:

05. Industrial Uses: dye [CHEBI:37958] > fluorescent dye [CHEBI:51121] > fluorochrome [CHEBI:51217] > cascade blue [CHEBI:51932]
×

Select any link to see items in a related category.

more general categories    information about this item
05. Industrial Uses 
05. Industrial Uses
 dye [CHEBI:37958] (446) 
 fluorescent dye [CHEBI:51121] (410) 
 fluorochrome [CHEBI:51217] (404) 
 cascade blue [CHEBI:51932] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 naphthalenes [CHEBI:25477] (89) 
 aminonaphthalene [CHEBI:38034] (13) 
 cascade blue [CHEBI:51932] (1)
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbobicyclic compound [CHEBI:36785] (199) 
 naphthalenes [CHEBI:25477] (89) 
 aminonaphthalene [CHEBI:38034] (13) 
 cascade blue [CHEBI:51932] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 naphthalenes [CHEBI:25477] (89) 
 aminonaphthalene [CHEBI:38034] (13) 
 cascade blue [CHEBI:51932] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 homocyclic compound [CHEBI:33597] (1134) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 naphthalenes [CHEBI:25477] (89) 
 aminonaphthalene [CHEBI:38034] (13) 
 cascade blue [CHEBI:51932] (1)
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbobicyclic compound [CHEBI:36785] (199) 
 naphthalenes [CHEBI:25477] (89) 
 aminonaphthalene [CHEBI:38034] (13) 
 cascade blue [CHEBI:51932] (1)
 homopolycyclic compound [CHEBI:35295] (493) 
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbobicyclic compound [CHEBI:36785] (199) 
 naphthalenes [CHEBI:25477] (89) 
 aminonaphthalene [CHEBI:38034] (13) 
 cascade blue [CHEBI:51932] (1)
 polycyclic compound [CHEBI:33635] (4078) 
 homopolycyclic compound [CHEBI:35295] (493) 
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbobicyclic compound [CHEBI:36785] (199) 
 naphthalenes [CHEBI:25477] (89) 
 aminonaphthalene [CHEBI:38034] (13) 
 cascade blue [CHEBI:51932] (1)
 bicyclic compound [CHEBI:33636] (1511) 
 carbobicyclic compound [CHEBI:36785] (199) 
 naphthalenes [CHEBI:25477] (89) 
 aminonaphthalene [CHEBI:38034] (13) 
 cascade blue [CHEBI:51932] (1)
 aromatic compound [CHEBI:33655] (3799) 
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 naphthalenes [CHEBI:25477] (89) 
 aminonaphthalene [CHEBI:38034] (13) 
 cascade blue [CHEBI:51932] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 naphthalenes [CHEBI:25477] (89) 
 aminonaphthalene [CHEBI:38034] (13) 
 cascade blue [CHEBI:51932] (1)
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbobicyclic compound [CHEBI:36785] (199) 
 naphthalenes [CHEBI:25477] (89) 
 aminonaphthalene [CHEBI:38034] (13) 
 cascade blue [CHEBI:51932] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 naphthalenes [CHEBI:25477] (89) 
 aminonaphthalene [CHEBI:38034] (13) 
 cascade blue [CHEBI:51932] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 naphthalenes [CHEBI:25477] (89) 
 aminonaphthalene [CHEBI:38034] (13) 
 cascade blue [CHEBI:51932] (1)
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbobicyclic compound [CHEBI:36785] (199) 
 naphthalenes [CHEBI:25477] (89) 
 aminonaphthalene [CHEBI:38034] (13) 
 cascade blue [CHEBI:51932] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 naphthalenes [CHEBI:25477] (89) 
 aminonaphthalene [CHEBI:38034] (13) 
 cascade blue [CHEBI:51932] (1)
ChEBI Compound Accession Identifier  [CHEBI:51932]
ChEBI Compound Description  null
ChEBI Compound Identification Number  51932
ChEBI InChI Value  InChI=1S/C33H40N3/c1-6-34-32-24-28(23-27-13-11-12-14-31(27)32)33(25-15-19-29(20-16-25)35(7-2)8-3)26-17-21-30(22-18-26)36(9-4)10-5/h11-24,34H,6-10H2,1-5H3/q+1
ChEBI InChIKey Value  CZPLANDPABRVHX-UHFFFAOYSA-N
ChEBI Compound Name  cascade blue
ChEBI SMILES Value  CCNc1cc(cc2ccccc12)C(c1ccc(cc1)N(CC)CC)=C1C=CC(C=C1)=[N+](CC)CC
ChEBI Substance ID  57269662
ChEBI URL  ChEBI:51932
ChemSpider ID  NS
Ontomatica Chemical Accession Key (OnChAKey)  CZPLANDPABRVHX_UHFFFAOYSA_N_000_000000
PubChem Compound ID  14886