New Search

Item 1 of 1 (back to results)

BODIPY TR methyl ester
null


Current search:

05. Industrial Uses: dye [CHEBI:37958] > fluorescent dye [CHEBI:51121] > fluorochrome [CHEBI:51217] > BODIPY TR methyl ester [CHEBI:51935]
×

Select any link to see items in a related category.

more general categories    information about this item
05. Industrial Uses 
05. Industrial Uses
 dye [CHEBI:37958] (446) 
 fluorescent dye [CHEBI:51121] (410) 
 fluorochrome [CHEBI:51217] (404) 
 BODIPY TR methyl ester [CHEBI:51935] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 polypyrrole [CHEBI:38077] (218) 
 dipyrrole [CHEBI:36316] (19) 
 dipyrrins [CHEBI:36749] (18) 
 4-bora-3a,4a-diaza-s-indacene [CHEBI:51109] (15) 
 BODIPY compound [CHEBI:51108] (15) 
 BODIPY dye [CHEBI:51123] (14) 
 BODIPY TR methyl ester [CHEBI:51935] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 polypyrrole [CHEBI:38077] (218) 
 dipyrrole [CHEBI:36316] (19) 
 dipyrrins [CHEBI:36749] (18) 
 4-bora-3a,4a-diaza-s-indacene [CHEBI:51109] (15) 
 BODIPY compound [CHEBI:51108] (15) 
 BODIPY dye [CHEBI:51123] (14) 
 BODIPY TR methyl ester [CHEBI:51935] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 4-bora-3a,4a-diaza-s-indacene [CHEBI:51109] (15) 
 BODIPY compound [CHEBI:51108] (15) 
 BODIPY dye [CHEBI:51123] (14) 
 BODIPY TR methyl ester [CHEBI:51935] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 polypyrrole [CHEBI:38077] (218) 
 dipyrrole [CHEBI:36316] (19) 
 dipyrrins [CHEBI:36749] (18) 
 4-bora-3a,4a-diaza-s-indacene [CHEBI:51109] (15) 
 BODIPY compound [CHEBI:51108] (15) 
 BODIPY dye [CHEBI:51123] (14) 
 BODIPY TR methyl ester [CHEBI:51935] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 polypyrrole [CHEBI:38077] (218) 
 dipyrrole [CHEBI:36316] (19) 
 dipyrrins [CHEBI:36749] (18) 
 4-bora-3a,4a-diaza-s-indacene [CHEBI:51109] (15) 
 BODIPY compound [CHEBI:51108] (15) 
 BODIPY dye [CHEBI:51123] (14) 
 BODIPY TR methyl ester [CHEBI:51935] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 4-bora-3a,4a-diaza-s-indacene [CHEBI:51109] (15) 
 BODIPY compound [CHEBI:51108] (15) 
 BODIPY dye [CHEBI:51123] (14) 
 BODIPY TR methyl ester [CHEBI:51935] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 4-bora-3a,4a-diaza-s-indacene [CHEBI:51109] (15) 
 BODIPY compound [CHEBI:51108] (15) 
 BODIPY dye [CHEBI:51123] (14) 
 BODIPY TR methyl ester [CHEBI:51935] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 heterotricyclic compound [CHEBI:36688] (541) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 4-bora-3a,4a-diaza-s-indacene [CHEBI:51109] (15) 
 BODIPY compound [CHEBI:51108] (15) 
 BODIPY dye [CHEBI:51123] (14) 
 BODIPY TR methyl ester [CHEBI:51935] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 4-bora-3a,4a-diaza-s-indacene [CHEBI:51109] (15) 
 BODIPY compound [CHEBI:51108] (15) 
 BODIPY dye [CHEBI:51123] (14) 
 BODIPY TR methyl ester [CHEBI:51935] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 4-bora-3a,4a-diaza-s-indacene [CHEBI:51109] (15) 
 BODIPY compound [CHEBI:51108] (15) 
 BODIPY dye [CHEBI:51123] (14) 
 BODIPY TR methyl ester [CHEBI:51935] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 polypyrrole [CHEBI:38077] (218) 
 dipyrrole [CHEBI:36316] (19) 
 dipyrrins [CHEBI:36749] (18) 
 4-bora-3a,4a-diaza-s-indacene [CHEBI:51109] (15) 
 BODIPY compound [CHEBI:51108] (15) 
 BODIPY dye [CHEBI:51123] (14) 
 BODIPY TR methyl ester [CHEBI:51935] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 4-bora-3a,4a-diaza-s-indacene [CHEBI:51109] (15) 
 BODIPY compound [CHEBI:51108] (15) 
 BODIPY dye [CHEBI:51123] (14) 
 BODIPY TR methyl ester [CHEBI:51935] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 4-bora-3a,4a-diaza-s-indacene [CHEBI:51109] (15) 
 BODIPY compound [CHEBI:51108] (15) 
 BODIPY dye [CHEBI:51123] (14) 
 BODIPY TR methyl ester [CHEBI:51935] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 polypyrrole [CHEBI:38077] (218) 
 dipyrrole [CHEBI:36316] (19) 
 dipyrrins [CHEBI:36749] (18) 
 4-bora-3a,4a-diaza-s-indacene [CHEBI:51109] (15) 
 BODIPY compound [CHEBI:51108] (15) 
 BODIPY dye [CHEBI:51123] (14) 
 BODIPY TR methyl ester [CHEBI:51935] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 4-bora-3a,4a-diaza-s-indacene [CHEBI:51109] (15) 
 BODIPY compound [CHEBI:51108] (15) 
 BODIPY dye [CHEBI:51123] (14) 
 BODIPY TR methyl ester [CHEBI:51935] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 heterotricyclic compound [CHEBI:36688] (541) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 4-bora-3a,4a-diaza-s-indacene [CHEBI:51109] (15) 
 BODIPY compound [CHEBI:51108] (15) 
 BODIPY dye [CHEBI:51123] (14) 
 BODIPY TR methyl ester [CHEBI:51935] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 4-bora-3a,4a-diaza-s-indacene [CHEBI:51109] (15) 
 BODIPY compound [CHEBI:51108] (15) 
 BODIPY dye [CHEBI:51123] (14) 
 BODIPY TR methyl ester [CHEBI:51935] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 polypyrrole [CHEBI:38077] (218) 
 dipyrrole [CHEBI:36316] (19) 
 dipyrrins [CHEBI:36749] (18) 
 4-bora-3a,4a-diaza-s-indacene [CHEBI:51109] (15) 
 BODIPY compound [CHEBI:51108] (15) 
 BODIPY dye [CHEBI:51123] (14) 
 BODIPY TR methyl ester [CHEBI:51935] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 4-bora-3a,4a-diaza-s-indacene [CHEBI:51109] (15) 
 BODIPY compound [CHEBI:51108] (15) 
 BODIPY dye [CHEBI:51123] (14) 
 BODIPY TR methyl ester [CHEBI:51935] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 4-bora-3a,4a-diaza-s-indacene [CHEBI:51109] (15) 
 BODIPY compound [CHEBI:51108] (15) 
 BODIPY dye [CHEBI:51123] (14) 
 BODIPY TR methyl ester [CHEBI:51935] (1)
ChEBI Compound Accession Identifier  [CHEBI:51935]
ChEBI Compound Description  null
ChEBI Compound Identification Number  51935
ChEBI InChI Value  InChI=1S/C22H17BF2N2O3S/c1-29-22(28)14-30-18-8-4-15(5-9-18)19-10-6-16-13-17-7-11-20(21-3-2-12-31-21)27(17)23(24,25)26(16)19/h2-13H,14H2,1H3
ChEBI InChIKey Value  HQMDVGPFFTVIIE-UHFFFAOYSA-N
ChEBI Compound Name  BODIPY TR methyl ester
ChEBI SMILES Value  COC(=O)COc1ccc(cc1)C1=[N+]2C(C=C1)=Cc1ccc(-c3cccs3)n1[B-]2(F)F
ChEBI Substance ID  57269660
ChEBI URL  ChEBI:51935
ChemSpider ID  21865952
Ontomatica Chemical Accession Key (OnChAKey)  HQMDVGPFFTVIIE_UHFFFAOYSA_N_000_000000
PubChem Compound ID  25164039