Item 1 of 1 (back to results) fluorescein A highly fluorescent dye, detectable even when present in minute quantities. Used forensically to detect traces of blood, in analytical chemistry as an indicator in silver nitrate titrations and in microscopy.

Current search: 05. Industrial Uses: dye [CHEBI:37958] > fluorescent dye [CHEBI:51121] > fluorescein [CHEBI:31624] × Select any link to see items in a related category. more general categories    information about this item 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   diagnostic agent [CHEBI:33295] (53)   diagnostic imaging agent [CHEBI:37334] (32)   radioopaque medium [CHEBI:37338] (17)   fluorescein [CHEBI:31624] (1)  dye [CHEBI:37958] (446)   fluorescent dye [CHEBI:51121] (410)   fluorescein [CHEBI:31624] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   oxacycle [CHEBI:38104] (2002)   dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   fluorescein [CHEBI:31624] (3)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   oxacycle [CHEBI:38104] (2002)   dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   fluorescein [CHEBI:31624] (3)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   fluorescein [CHEBI:31624] (3)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   fluorescein [CHEBI:31624] (3)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   fluorescein [CHEBI:31624] (3)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   oxacycle [CHEBI:38104] (2002)   dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   fluorescein [CHEBI:31624] (3)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   fluorescein [CHEBI:31624] (3)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   fluorescein [CHEBI:31624] (3)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   fluorescein [CHEBI:31624] (3)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   fluorescein [CHEBI:31624] (3)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   fluorescein [CHEBI:31624] (3)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   heterotricyclic compound [CHEBI:36688] (541)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   fluorescein [CHEBI:31624] (3)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   fluorescein [CHEBI:31624] (3)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   fluorescein [CHEBI:31624] (3)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   fluorescein [CHEBI:31624] (3)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   fluorescein [CHEBI:31624] (3)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   fluorescein [CHEBI:31624] (3)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   fluorescein [CHEBI:31624] (3)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   fluorescein [CHEBI:31624] (3)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   fluorescein [CHEBI:31624] (3)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   fluorescein [CHEBI:31624] (3)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   fluorescein [CHEBI:31624] (3)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   fluorescein [CHEBI:31624] (3)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   fluorescein [CHEBI:31624] (3)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   fluorescein [CHEBI:31624] (3)  heteropolycyclic compound [CHEBI:33671] (2613)   heterotricyclic compound [CHEBI:36688] (541)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   fluorescein [CHEBI:31624] (3)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   fluorescein [CHEBI:31624] (3)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   fluorescein [CHEBI:31624] (3)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   fluorescein [CHEBI:31624] (3)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   fluorescein [CHEBI:31624] (3)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   fluorescein [CHEBI:31624] (3)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   fluorescein [CHEBI:31624] (3)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   fluorescein [CHEBI:31624] (3)  dibenzopyran [CHEBI:39203] (118)   xanthenes [CHEBI:38835] (118)   xanthene dye [CHEBI:37929] (65)   fluorescein [CHEBI:31624] (3) ChEBI Compound Accession Identifier:   [CHEBI:31624] ChEBI Compound Description:   A highly fluorescent dye, detectable even when present in minute quantities. Used forensically to detect traces of blood, in analytical chemistry as an indicator in silver nitrate titrations and in microscopy. ChEBI Compound Identification Number:   31624 ChEBI InChI Value:   InChI=1S/C20H12O5/c21-11-5-7-15-17(9-11)24-18-10-12(22)6-8-16(18)20(15)14-4-2-1-3-13(14)19(23)25-20/h1-10,21-22H ChEBI InChIKey Value:   GNBHRKFJIUUOQI-UHFFFAOYSA-N ChEBI Compound Name:   fluorescein ChEBI SMILES Value:   Oc1ccc2c(Oc3cc(O)ccc3C22OC(=O)c3ccccc23)c1 ChEBI Substance ID:   24398110 ChEBI URL:   ChEBI:31624 ChemSpider ID:   15968 Ontomatica Chemical Accession Key (OnChAKey):   GNBHRKFJIUUOQI_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   16850