New Search

Item 1 of 1 (back to results)

Reactive Blue 5
Anthraquinone carrying amino, sulfo and [3-({4-chloro-6-[(3-sulfophenyl)amino]-1,3,5-triazin-2-yl}amino)-4-sulfophenyl]amino substituents at positions 1, 2 and 4 respectively.

Current search:

05. Industrial Uses: dye [CHEBI:37958] > Reactive Blue 5 [CHEBI:61311]
×

Select any link to see items in a related category.

more general categories    information about this item
05. Industrial Uses 
05. Industrial Uses
 dye [CHEBI:37958] (446) 
 Reactive Blue 5 [CHEBI:61311] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 cyclic ketone [CHEBI:3992] (644) 
 quinone [CHEBI:36141] (209) 
 acenoquinone [CHEBI:51285] (62) 
 anthraquinone [CHEBI:22580] (53) 
 Reactive Blue 5 [CHEBI:61311] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 cyclic ketone [CHEBI:3992] (644) 
 quinone [CHEBI:36141] (209) 
 acenoquinone [CHEBI:51285] (62) 
 anthraquinone [CHEBI:22580] (53) 
 Reactive Blue 5 [CHEBI:61311] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 cyclic ketone [CHEBI:3992] (644) 
 quinone [CHEBI:36141] (209) 
 acenoquinone [CHEBI:51285] (62) 
 anthraquinone [CHEBI:22580] (53) 
 Reactive Blue 5 [CHEBI:61311] (1)
 quinone [CHEBI:36141] (209) 
 acenoquinone [CHEBI:51285] (62) 
 anthraquinone [CHEBI:22580] (53) 
 Reactive Blue 5 [CHEBI:61311] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 acenes [CHEBI:51269] (110) 
 anthracenes [CHEBI:46955] (90) 
 anthraquinone [CHEBI:22580] (53) 
 Reactive Blue 5 [CHEBI:61311] (1)
 acenoquinone [CHEBI:51285] (62) 
 anthraquinone [CHEBI:22580] (53) 
 Reactive Blue 5 [CHEBI:61311] (1)
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbotricyclic compound [CHEBI:38032] (198) 
 anthracenes [CHEBI:46955] (90) 
 anthraquinone [CHEBI:22580] (53) 
 Reactive Blue 5 [CHEBI:61311] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 acenes [CHEBI:51269] (110) 
 anthracenes [CHEBI:46955] (90) 
 anthraquinone [CHEBI:22580] (53) 
 Reactive Blue 5 [CHEBI:61311] (1)
 acenoquinone [CHEBI:51285] (62) 
 anthraquinone [CHEBI:22580] (53) 
 Reactive Blue 5 [CHEBI:61311] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 carbotricyclic compound [CHEBI:38032] (198) 
 anthracenes [CHEBI:46955] (90) 
 anthraquinone [CHEBI:22580] (53) 
 Reactive Blue 5 [CHEBI:61311] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 cyclic ketone [CHEBI:3992] (644) 
 quinone [CHEBI:36141] (209) 
 acenoquinone [CHEBI:51285] (62) 
 anthraquinone [CHEBI:22580] (53) 
 Reactive Blue 5 [CHEBI:61311] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 homocyclic compound [CHEBI:33597] (1134) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 acenes [CHEBI:51269] (110) 
 anthracenes [CHEBI:46955] (90) 
 anthraquinone [CHEBI:22580] (53) 
 Reactive Blue 5 [CHEBI:61311] (1)
 acenoquinone [CHEBI:51285] (62) 
 anthraquinone [CHEBI:22580] (53) 
 Reactive Blue 5 [CHEBI:61311] (1)
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbotricyclic compound [CHEBI:38032] (198) 
 anthracenes [CHEBI:46955] (90) 
 anthraquinone [CHEBI:22580] (53) 
 Reactive Blue 5 [CHEBI:61311] (1)
 homopolycyclic compound [CHEBI:35295] (493) 
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbotricyclic compound [CHEBI:38032] (198) 
 anthracenes [CHEBI:46955] (90) 
 anthraquinone [CHEBI:22580] (53) 
 Reactive Blue 5 [CHEBI:61311] (1)
 polycyclic compound [CHEBI:33635] (4078) 
 homopolycyclic compound [CHEBI:35295] (493) 
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbotricyclic compound [CHEBI:38032] (198) 
 anthracenes [CHEBI:46955] (90) 
 anthraquinone [CHEBI:22580] (53) 
 Reactive Blue 5 [CHEBI:61311] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 carbotricyclic compound [CHEBI:38032] (198) 
 anthracenes [CHEBI:46955] (90) 
 anthraquinone [CHEBI:22580] (53) 
 Reactive Blue 5 [CHEBI:61311] (1)
 aromatic compound [CHEBI:33655] (3799) 
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 acenes [CHEBI:51269] (110) 
 anthracenes [CHEBI:46955] (90) 
 anthraquinone [CHEBI:22580] (53) 
 Reactive Blue 5 [CHEBI:61311] (1)
 acenoquinone [CHEBI:51285] (62) 
 anthraquinone [CHEBI:22580] (53) 
 Reactive Blue 5 [CHEBI:61311] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 acenes [CHEBI:51269] (110) 
 anthracenes [CHEBI:46955] (90) 
 anthraquinone [CHEBI:22580] (53) 
 Reactive Blue 5 [CHEBI:61311] (1)
 acenoquinone [CHEBI:51285] (62) 
 anthraquinone [CHEBI:22580] (53) 
 Reactive Blue 5 [CHEBI:61311] (1)
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbotricyclic compound [CHEBI:38032] (198) 
 anthracenes [CHEBI:46955] (90) 
 anthraquinone [CHEBI:22580] (53) 
 Reactive Blue 5 [CHEBI:61311] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 acenes [CHEBI:51269] (110) 
 anthracenes [CHEBI:46955] (90) 
 anthraquinone [CHEBI:22580] (53) 
 Reactive Blue 5 [CHEBI:61311] (1)
 acenoquinone [CHEBI:51285] (62) 
 anthraquinone [CHEBI:22580] (53) 
 Reactive Blue 5 [CHEBI:61311] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 carbotricyclic compound [CHEBI:38032] (198) 
 anthracenes [CHEBI:46955] (90) 
 anthraquinone [CHEBI:22580] (53) 
 Reactive Blue 5 [CHEBI:61311] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 acenes [CHEBI:51269] (110) 
 anthracenes [CHEBI:46955] (90) 
 anthraquinone [CHEBI:22580] (53) 
 Reactive Blue 5 [CHEBI:61311] (1)
 acenoquinone [CHEBI:51285] (62) 
 anthraquinone [CHEBI:22580] (53) 
 Reactive Blue 5 [CHEBI:61311] (1)
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbotricyclic compound [CHEBI:38032] (198) 
 anthracenes [CHEBI:46955] (90) 
 anthraquinone [CHEBI:22580] (53) 
 Reactive Blue 5 [CHEBI:61311] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 acenes [CHEBI:51269] (110) 
 anthracenes [CHEBI:46955] (90) 
 anthraquinone [CHEBI:22580] (53) 
 Reactive Blue 5 [CHEBI:61311] (1)
 acenoquinone [CHEBI:51285] (62) 
 anthraquinone [CHEBI:22580] (53) 
 Reactive Blue 5 [CHEBI:61311] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 carbotricyclic compound [CHEBI:38032] (198) 
 anthracenes [CHEBI:46955] (90) 
 anthraquinone [CHEBI:22580] (53) 
 Reactive Blue 5 [CHEBI:61311] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 cyclic ketone [CHEBI:3992] (644) 
 quinone [CHEBI:36141] (209) 
 acenoquinone [CHEBI:51285] (62) 
 anthraquinone [CHEBI:22580] (53) 
 Reactive Blue 5 [CHEBI:61311] (1)
ChEBI Compound Accession Identifier:   [CHEBI:61311]
ChEBI Compound Description:   Anthraquinone carrying amino, sulfo and [3-({4-chloro-6-[(3-sulfophenyl)amino]-1,3,5-triazin-2-yl}amino)-4-sulfophenyl]amino substituents at positions 1, 2 and 4 respectively.
ChEBI Compound Identification Number:   61311
ChEBI InChI Value:   InChI=1S/C29H20ClN7O11S3/c30-27-35-28(33-13-4-3-5-15(10-13)49(40,41)42)37-29(36-27)34-18-11-14(8-9-20(18)50(43,44)45)32-19-12-21(51(46,47)48)24(31)23-22(19)25(38)16-6-1-2-7-17(16)26(23)39/h1-12,32H,31H2,(H,40,41,42)(H,43,44,45)(H,46,47,48)(H2,33,34,35,36,37)
ChEBI InChIKey Value:   NSDSIQGBHACTLY-UHFFFAOYSA-N
ChEBI Compound Name:   Reactive Blue 5
ChEBI SMILES Value:   Nc1c(cc(Nc2ccc(c(Nc3nc(Cl)nc(Nc4cccc(c4)S(O)(=O)=O)n3)c2)S(O)(=O)=O)c2C(=O)c3ccccc3C(=O)c12)S(O)(=O)=O
ChEBI Substance ID:   111978264
ChEBI URL:   ChEBI:61311
ChemSpider ID:   77201
Ontomatica Chemical Accession Key (OnChAKey):   NSDSIQGBHACTLY_UHFFFAOYSA_N_000_000000
PubChem Compound ID:   85599