Select any link to see items in a related category.
more general categories information about this item 05. Industrial Uses 05. Industrial Uses dye [CHEBI:37958] (446) 4-(phenylazo)aniline [CHEBI:233869] (1) 08. Chemical Category 08. Chemical Category main group molecular entity [CHEBI:33579] (25650) p-block molecular entity [CHEBI:33675] (25343) pnictogen molecular entity [CHEBI:33302] (10027) nitrogen molecular entity [CHEBI:51143] (7930) organonitrogen compound [CHEBI:35352] (6705) organic amino compound [CHEBI:50047] (2472) amine [CHEBI:32952] (179) primary amine [CHEBI:32877] (40) primary arylamine [CHEBI:50471] (18) 4-(phenylazo)aniline [CHEBI:233869] (1) primary amino compound [CHEBI:50994] (104) primary amine [CHEBI:32877] (40) primary arylamine [CHEBI:50471] (18) 4-(phenylazo)aniline [CHEBI:233869] (1) azo compound [CHEBI:37533] (51) azobenzenes [CHEBI:22682] (21) 4-(phenylazo)aniline [CHEBI:233869] (1) carbon group molecular entity [CHEBI:33582] (23847) organic molecular entity [CHEBI:50860] (23769) heteroorganic entity [CHEBI:33285] (15197) organonitrogen compound [CHEBI:35352] (6705) organic amino compound [CHEBI:50047] (2472) amine [CHEBI:32952] (179) primary amine [CHEBI:32877] (40) primary arylamine [CHEBI:50471] (18) 4-(phenylazo)aniline [CHEBI:233869] (1) primary amino compound [CHEBI:50994] (104) primary amine [CHEBI:32877] (40) primary arylamine [CHEBI:50471] (18) 4-(phenylazo)aniline [CHEBI:233869] (1) organic amino compound [CHEBI:50047] (2472) amine [CHEBI:32952] (179) primary amine [CHEBI:32877] (40) primary arylamine [CHEBI:50471] (18) 4-(phenylazo)aniline [CHEBI:233869] (1) primary amino compound [CHEBI:50994] (104) primary amine [CHEBI:32877] (40) primary arylamine [CHEBI:50471] (18) 4-(phenylazo)aniline [CHEBI:233869] (1) organic molecule [CHEBI:72695] (11399) organic cyclic compound [CHEBI:33832] (7633) carbocyclic compound [CHEBI:33598] (1130) benzenoid aromatic compound [CHEBI:33836] (730) benzenes [CHEBI:22712] (386) azobenzenes [CHEBI:22682] (21) 4-(phenylazo)aniline [CHEBI:233869] (1) organic aromatic compound [CHEBI:33659] (3593) benzenoid aromatic compound [CHEBI:33836] (730) benzenes [CHEBI:22712] (386) azobenzenes [CHEBI:22682] (21) 4-(phenylazo)aniline [CHEBI:233869] (1) polyatomic entity [CHEBI:36357] (18777) molecule [CHEBI:25367] (11520) cyclic compound [CHEBI:33595] (7817) homocyclic compound [CHEBI:33597] (1134) carbocyclic compound [CHEBI:33598] (1130) benzenoid aromatic compound [CHEBI:33836] (730) benzenes [CHEBI:22712] (386) azobenzenes [CHEBI:22682] (21) 4-(phenylazo)aniline [CHEBI:233869] (1) aromatic compound [CHEBI:33655] (3799) organic aromatic compound [CHEBI:33659] (3593) benzenoid aromatic compound [CHEBI:33836] (730) benzenes [CHEBI:22712] (386) azobenzenes [CHEBI:22682] (21) 4-(phenylazo)aniline [CHEBI:233869] (1) organic cyclic compound [CHEBI:33832] (7633) carbocyclic compound [CHEBI:33598] (1130) benzenoid aromatic compound [CHEBI:33836] (730) benzenes [CHEBI:22712] (386) azobenzenes [CHEBI:22682] (21) 4-(phenylazo)aniline [CHEBI:233869] (1) organic aromatic compound [CHEBI:33659] (3593) benzenoid aromatic compound [CHEBI:33836] (730) benzenes [CHEBI:22712] (386) azobenzenes [CHEBI:22682] (21) 4-(phenylazo)aniline [CHEBI:233869] (1) organic molecule [CHEBI:72695] (11399) organic cyclic compound [CHEBI:33832] (7633) carbocyclic compound [CHEBI:33598] (1130) benzenoid aromatic compound [CHEBI:33836] (730) benzenes [CHEBI:22712] (386) azobenzenes [CHEBI:22682] (21) 4-(phenylazo)aniline [CHEBI:233869] (1) organic aromatic compound [CHEBI:33659] (3593) benzenoid aromatic compound [CHEBI:33836] (730) benzenes [CHEBI:22712] (386) azobenzenes [CHEBI:22682] (21) 4-(phenylazo)aniline [CHEBI:233869] (1) ChEBI Compound Accession Identifier: [CHEBI:233869] ChEBI Compound Description: Azobenzene substituted at one of the 4-positions by an amino group. ChEBI Compound Identification Number: 233869 ChEBI InChI Value: InChI=1S/C12H11N3/c13-10-6-8-12(9-7-10)15-14-11-4-2-1-3-5-11/h1-9H,13H2/b15-14+ ChEBI InChIKey Value: QPQKUYVSJWQSDY-CCEZHUSRSA-N ChEBI Compound Name: 4-(phenylazo)aniline ChEBI SMILES Value: Nc1ccc(cc1)\N=N\c1ccccc1 ChEBI Substance ID: 85427132 ChEBI URL: ChEBI:233869 ChemSpider ID: 5828 Ontomatica Chemical Accession Key (OnChAKey): QPQKUYVSJWQSDY_CCEZHUSRSA_N_000_000000 PubChem Compound ID: 6051
