Select any link to see items in a related category.
more general categories information about this item 05. Industrial Uses 05. Industrial Uses dye [CHEBI:37958] (446) methyl red [CHEBI:49770] (1) 08. Chemical Category 08. Chemical Category main group molecular entity [CHEBI:33579] (25650) s-block molecular entity [CHEBI:33674] (7287) hydrogen molecular entity [CHEBI:33608] (6932) hydroxides [CHEBI:24651] (5641) oxoacid [CHEBI:24833] (3119) carbon oxoacid [CHEBI:35605] (3012) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) methyl red [CHEBI:49770] (1) p-block molecular entity [CHEBI:33675] (25343) pnictogen molecular entity [CHEBI:33302] (10027) nitrogen molecular entity [CHEBI:51143] (7930) organonitrogen compound [CHEBI:35352] (6705) organic amino compound [CHEBI:50047] (2472) tertiary amino compound [CHEBI:50996] (199) methyl red [CHEBI:49770] (1) azo compound [CHEBI:37533] (51) azobenzenes [CHEBI:22682] (21) methyl red [CHEBI:49770] (1) chalcogen molecular entity [CHEBI:33304] (15225) oxygen molecular entity [CHEBI:25806] (14414) hydroxides [CHEBI:24651] (5641) oxoacid [CHEBI:24833] (3119) carbon oxoacid [CHEBI:35605] (3012) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) methyl red [CHEBI:49770] (1) organooxygen compound [CHEBI:36963] (11352) carbon oxoacid [CHEBI:35605] (3012) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) methyl red [CHEBI:49770] (1) carbonyl compound [CHEBI:36586] (5928) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) methyl red [CHEBI:49770] (1) organochalcogen compound [CHEBI:36962] (11874) organooxygen compound [CHEBI:36963] (11352) carbon oxoacid [CHEBI:35605] (3012) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) methyl red [CHEBI:49770] (1) carbonyl compound [CHEBI:36586] (5928) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) methyl red [CHEBI:49770] (1) carbon group molecular entity [CHEBI:33582] (23847) organic molecular entity [CHEBI:50860] (23769) heteroorganic entity [CHEBI:33285] (15197) organonitrogen compound [CHEBI:35352] (6705) organic amino compound [CHEBI:50047] (2472) tertiary amino compound [CHEBI:50996] (199) methyl red [CHEBI:49770] (1) organochalcogen compound [CHEBI:36962] (11874) organooxygen compound [CHEBI:36963] (11352) carbon oxoacid [CHEBI:35605] (3012) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) methyl red [CHEBI:49770] (1) carbonyl compound [CHEBI:36586] (5928) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) methyl red [CHEBI:49770] (1) organic amino compound [CHEBI:50047] (2472) tertiary amino compound [CHEBI:50996] (199) methyl red [CHEBI:49770] (1) organic acid [CHEBI:64709] (3008) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) methyl red [CHEBI:49770] (1) organic molecule [CHEBI:72695] (11399) organic cyclic compound [CHEBI:33832] (7633) carbocyclic compound [CHEBI:33598] (1130) benzenoid aromatic compound [CHEBI:33836] (730) benzenes [CHEBI:22712] (386) azobenzenes [CHEBI:22682] (21) methyl red [CHEBI:49770] (1) organic aromatic compound [CHEBI:33659] (3593) benzenoid aromatic compound [CHEBI:33836] (730) benzenes [CHEBI:22712] (386) azobenzenes [CHEBI:22682] (21) methyl red [CHEBI:49770] (1) organic oxo compound [CHEBI:36587] (5932) carbonyl compound [CHEBI:36586] (5928) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) methyl red [CHEBI:49770] (1) polyatomic entity [CHEBI:36357] (18777) molecule [CHEBI:25367] (11520) cyclic compound [CHEBI:33595] (7817) homocyclic compound [CHEBI:33597] (1134) carbocyclic compound [CHEBI:33598] (1130) benzenoid aromatic compound [CHEBI:33836] (730) benzenes [CHEBI:22712] (386) azobenzenes [CHEBI:22682] (21) methyl red [CHEBI:49770] (1) aromatic compound [CHEBI:33655] (3799) organic aromatic compound [CHEBI:33659] (3593) benzenoid aromatic compound [CHEBI:33836] (730) benzenes [CHEBI:22712] (386) azobenzenes [CHEBI:22682] (21) methyl red [CHEBI:49770] (1) organic cyclic compound [CHEBI:33832] (7633) carbocyclic compound [CHEBI:33598] (1130) benzenoid aromatic compound [CHEBI:33836] (730) benzenes [CHEBI:22712] (386) azobenzenes [CHEBI:22682] (21) methyl red [CHEBI:49770] (1) organic aromatic compound [CHEBI:33659] (3593) benzenoid aromatic compound [CHEBI:33836] (730) benzenes [CHEBI:22712] (386) azobenzenes [CHEBI:22682] (21) methyl red [CHEBI:49770] (1) organic molecule [CHEBI:72695] (11399) organic cyclic compound [CHEBI:33832] (7633) carbocyclic compound [CHEBI:33598] (1130) benzenoid aromatic compound [CHEBI:33836] (730) benzenes [CHEBI:22712] (386) azobenzenes [CHEBI:22682] (21) methyl red [CHEBI:49770] (1) organic aromatic compound [CHEBI:33659] (3593) benzenoid aromatic compound [CHEBI:33836] (730) benzenes [CHEBI:22712] (386) azobenzenes [CHEBI:22682] (21) methyl red [CHEBI:49770] (1) organic oxo compound [CHEBI:36587] (5932) carbonyl compound [CHEBI:36586] (5928) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) methyl red [CHEBI:49770] (1) heteroatomic molecular entity [CHEBI:37577] (13672) hydroxides [CHEBI:24651] (5641) oxoacid [CHEBI:24833] (3119) carbon oxoacid [CHEBI:35605] (3012) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) methyl red [CHEBI:49770] (1) ChEBI Compound Accession Identifier: [CHEBI:49770] ChEBI Compound Description: An azo dye consisting of benzoic acid substituted at position 2 by a 4-[(dimethylamino)phenyl]diazenyl group. ChEBI Compound Identification Number: 49770 ChEBI InChI Value: InChI=1S/C15H15N3O2/c1-18(2)12-9-7-11(8-10-12)16-17-14-6-4-3-5-13(14)15(19)20/h3-10H,1-2H3,(H,19,20)/b17-16+ ChEBI InChIKey Value: CEQFOVLGLXCDCX-WUKNDPDISA-N ChEBI Compound Name: methyl red ChEBI SMILES Value: CN(C)c1ccc(cc1)\N=N\c1ccccc1C(O)=O ChEBI Substance ID: 160962780 ChEBI URL: ChEBI:49770 ChemSpider ID: 9881 Ontomatica Chemical Accession Key (OnChAKey): CEQFOVLGLXCDCX_WUKNDPDISA_N_000_000000 PubChem Compound ID: 10303
