New Search

Item 1 of 1 (back to results)

cypermethrin
A carboxylic ester resulting from the formal condensation between 3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylic acid and the alcoholic hydroxy group of hydroxy(3-phenoxyphenyl)acetonitrile.


Current search:

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 biophysical uses [CHEBI:52208] (136) 
 membrane transport modulator [CHEBI:38632] (122) 
 sodium channel modulator [CHEBI:39000] (43) 
 pyrethroid insecticide [CHEBI:26413] (32) 
 pyrethroid ester insecticide [CHEBI:39116] (29) 
 cypermethrin [CHEBI:4042] (1)
05. Industrial Uses 
05. Industrial Uses
 pesticide [CHEBI:25944] (211) 
 acaricide [CHEBI:22153] (76) 
 pyrethroid ester acaricide [CHEBI:39259] (12) 
 cypermethrin [CHEBI:4042] (1)
 molluscicide [CHEBI:33904] (8) 
 cypermethrin [CHEBI:4042] (1)
 agrochemical [CHEBI:33286] (142) 
 cypermethrin [CHEBI:4042] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 halogen molecular entity [CHEBI:24471] (1475) 
 chlorine molecular entity [CHEBI:23117] (884) 
 organochlorine compound [CHEBI:36683] (543) 
 cypermethrin [CHEBI:4042] (1)
 halide [CHEBI:37578] (1402) 
 organohalogen compound [CHEBI:36684] (976) 
 organochlorine compound [CHEBI:36683] (543) 
 cypermethrin [CHEBI:4042] (1)
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 organonitrogen compound [CHEBI:35352] (6705) 
 cyanides [CHEBI:23424] (120) 
 nitrile [CHEBI:18379] (117) 
 cypermethrin [CHEBI:4042] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 aromatic ether [CHEBI:35618] (353) 
 cypermethrin [CHEBI:4042] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 cypermethrin [CHEBI:4042] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 aromatic ether [CHEBI:35618] (353) 
 cypermethrin [CHEBI:4042] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 cypermethrin [CHEBI:4042] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organonitrogen compound [CHEBI:35352] (6705) 
 cyanides [CHEBI:23424] (120) 
 nitrile [CHEBI:18379] (117) 
 cypermethrin [CHEBI:4042] (1)
 organohalogen compound [CHEBI:36684] (976) 
 organochlorine compound [CHEBI:36683] (543) 
 cypermethrin [CHEBI:4042] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 aromatic ether [CHEBI:35618] (353) 
 cypermethrin [CHEBI:4042] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 cypermethrin [CHEBI:4042] (1)
 ester [CHEBI:35701] (3370) 
 carboxylic ester [CHEBI:33308] (1495) 
 cypermethrin [CHEBI:4042] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 carbocyclic compound [CHEBI:33598] (1130) 
 cyclopropanes [CHEBI:51454] (58) 
 cypermethrin [CHEBI:4042] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 aromatic ether [CHEBI:35618] (353) 
 cypermethrin [CHEBI:4042] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 cypermethrin [CHEBI:4042] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 homocyclic compound [CHEBI:33597] (1134) 
 carbocyclic compound [CHEBI:33598] (1130) 
 cyclopropanes [CHEBI:51454] (58) 
 cypermethrin [CHEBI:4042] (1)
 aromatic compound [CHEBI:33655] (3799) 
 organic aromatic compound [CHEBI:33659] (3593) 
 aromatic ether [CHEBI:35618] (353) 
 cypermethrin [CHEBI:4042] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 carbocyclic compound [CHEBI:33598] (1130) 
 cyclopropanes [CHEBI:51454] (58) 
 cypermethrin [CHEBI:4042] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 aromatic ether [CHEBI:35618] (353) 
 cypermethrin [CHEBI:4042] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 carbocyclic compound [CHEBI:33598] (1130) 
 cyclopropanes [CHEBI:51454] (58) 
 cypermethrin [CHEBI:4042] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 aromatic ether [CHEBI:35618] (353) 
 cypermethrin [CHEBI:4042] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 cypermethrin [CHEBI:4042] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 halide [CHEBI:37578] (1402) 
 organohalogen compound [CHEBI:36684] (976) 
 organochlorine compound [CHEBI:36683] (543) 
 cypermethrin [CHEBI:4042] (1)
ChEBI Compound Accession Identifier  [CHEBI:4042]
ChEBI Compound Description  A carboxylic ester resulting from the formal condensation between 3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylic acid and the alcoholic hydroxy group of hydroxy(3-phenoxyphenyl)acetonitrile.
ChEBI Compound Identification Number  4042
ChEBI InChI Value  InChI=1S/C22H19Cl2NO3/c1-22(2)17(12-19(23)24)20(22)21(26)28-18(13-25)14-7-6-10-16(11-14)27-15-8-4-3-5-9-15/h3-12,17-18,20H,1-2H3
ChEBI InChIKey Value  KAATUXNTWXVJKI-UHFFFAOYSA-N
ChEBI Compound Name  cypermethrin
ChEBI SMILES Value  CC1(C)C(C=C(Cl)Cl)C1C(=O)OC(C#N)c1cccc(Oc2ccccc2)c1
ChEBI Substance ID  26675646
ChEBI URL  ChEBI:4042
ChemSpider ID  NS
Ontomatica Chemical Accession Key (OnChAKey)  KAATUXNTWXVJKI_UHFFFAOYSA_N_000_000000
PubChem Compound ID  2912