Item 1 of 1 (back to results) nitenpyram A C-nitro compound consisting of 2-nitroethene-1,1-diamine where one of the nitrogens bears ethyl and (6-chloro-3-pyridinyl)methyl while the other nitrogen carries a methyl group.

Current search: 05. Industrial Uses: pesticide [CHEBI:25944] > insecticide [CHEBI:24852] > nitenpyram [CHEBI:39171] × Select any link to see items in a related category. more general categories    information about this item 05. Industrial Uses  05. Industrial Uses  pesticide [CHEBI:25944] (211)   insecticide [CHEBI:24852] (37)   nitenpyram [CHEBI:39171] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   halogen molecular entity [CHEBI:24471] (1475)   chlorine molecular entity [CHEBI:23117] (884)   organochlorine compound [CHEBI:36683] (543)   chloropyridine [CHEBI:39173] (4)   monochloropyridine [CHEBI:39172] (3)   nitenpyram [CHEBI:39171] (2)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   chloropyridine [CHEBI:39173] (4)   monochloropyridine [CHEBI:39172] (3)   nitenpyram [CHEBI:39171] (2)  pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   chloropyridine [CHEBI:39173] (4)   monochloropyridine [CHEBI:39172] (3)   nitenpyram [CHEBI:39171] (2)  organic amino compound [CHEBI:50047] (2472)   neonicotinoid insectide [CHEBI:25540] (16)   nitenpyram [CHEBI:39171] (2)  nitro compound [CHEBI:35715] (192)   C-nitro compound [CHEBI:35716] (171)   nitenpyram [CHEBI:39171] (2)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   chloropyridine [CHEBI:39173] (4)   monochloropyridine [CHEBI:39172] (3)   nitenpyram [CHEBI:39171] (2)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   chloropyridine [CHEBI:39173] (4)   monochloropyridine [CHEBI:39172] (3)   nitenpyram [CHEBI:39171] (2)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   chloropyridine [CHEBI:39173] (4)   monochloropyridine [CHEBI:39172] (3)   nitenpyram [CHEBI:39171] (2)  organic amino compound [CHEBI:50047] (2472)   neonicotinoid insectide [CHEBI:25540] (16)   nitenpyram [CHEBI:39171] (2)  organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   chloropyridine [CHEBI:39173] (4)   monochloropyridine [CHEBI:39172] (3)   nitenpyram [CHEBI:39171] (2)  organic amino compound [CHEBI:50047] (2472)   neonicotinoid insectide [CHEBI:25540] (16)   nitenpyram [CHEBI:39171] (2)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   chloropyridine [CHEBI:39173] (4)   monochloropyridine [CHEBI:39172] (3)   nitenpyram [CHEBI:39171] (2)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   chloropyridine [CHEBI:39173] (4)   monochloropyridine [CHEBI:39172] (3)   nitenpyram [CHEBI:39171] (2)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   monocyclic compound [CHEBI:33661] (2007)   heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   chloropyridine [CHEBI:39173] (4)   monochloropyridine [CHEBI:39172] (3)   nitenpyram [CHEBI:39171] (2)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   chloropyridine [CHEBI:39173] (4)   monochloropyridine [CHEBI:39172] (3)   nitenpyram [CHEBI:39171] (2)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   chloropyridine [CHEBI:39173] (4)   monochloropyridine [CHEBI:39172] (3)   nitenpyram [CHEBI:39171] (2)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   chloropyridine [CHEBI:39173] (4)   monochloropyridine [CHEBI:39172] (3)   nitenpyram [CHEBI:39171] (2)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   chloropyridine [CHEBI:39173] (4)   monochloropyridine [CHEBI:39172] (3)   nitenpyram [CHEBI:39171] (2)  heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   chloropyridine [CHEBI:39173] (4)   monochloropyridine [CHEBI:39172] (3)   nitenpyram [CHEBI:39171] (2)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   chloropyridine [CHEBI:39173] (4)   monochloropyridine [CHEBI:39172] (3)   nitenpyram [CHEBI:39171] (2)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   chloropyridine [CHEBI:39173] (4)   monochloropyridine [CHEBI:39172] (3)   nitenpyram [CHEBI:39171] (2)  heteroatomic molecular entity [CHEBI:37577] (13672)   halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   chloropyridine [CHEBI:39173] (4)   monochloropyridine [CHEBI:39172] (3)   nitenpyram [CHEBI:39171] (2) ChEBI Compound Accession Identifier:   [CHEBI:39171] ChEBI Compound Description:   A C-nitro compound consisting of 2-nitroethene-1,1-diamine where one of the nitrogens bears ethyl and (6-chloro-3-pyridinyl)methyl while the other nitrogen carries a methyl group. ChEBI Compound Identification Number:   39171 ChEBI InChI Value:   InChI=1S/C11H15ClN4O2/c1-3-15(11(13-2)8-16(17)18)7-9-4-5-10(12)14-6-9/h4-6,8,13H,3,7H2,1-2H3 ChEBI InChIKey Value:   CFRPSFYHXJZSBI-UHFFFAOYSA-N ChEBI Compound Name:   nitenpyram ChEBI SMILES Value:   [H]C(=C(NC)N(CC)Cc1ccc(Cl)nc1)[N+]([O-])=O ChEBI Substance ID:   26675889 ChEBI URL:   ChEBI:39171 ChemSpider ID:   2298774 Ontomatica Chemical Accession Key (OnChAKey):   CFRPSFYHXJZSBI_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   3034287