Item 1 of 1 (back to results) amphotericin B methyl ester The methyl ester of amphotericin B.

Current search: 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > antiinfective agent [CHEBI:35441] > amphotericin B methyl ester [CHEBI:277842] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  antimicrobial agent [CHEBI:33281] (927)   antifungal agent [CHEBI:35718] (130)   amphotericin B methyl ester [CHEBI:277842] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   antiinfective agent [CHEBI:35441] (82)   amphotericin B methyl ester [CHEBI:277842] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   amphotericin B methyl ester [CHEBI:277842] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   amphotericin B methyl ester [CHEBI:277842] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   amphotericin B methyl ester [CHEBI:277842] (1)  ester [CHEBI:35701] (3370)   carboxylic ester [CHEBI:33308] (1495)   amphotericin B methyl ester [CHEBI:277842] (1)  organic molecule [CHEBI:72695] (11399)   organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   amphotericin B methyl ester [CHEBI:277842] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   organic molecule [CHEBI:72695] (11399)   organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   amphotericin B methyl ester [CHEBI:277842] (1) ChEBI Compound Accession Identifier:   [CHEBI:277842] ChEBI Compound Description:   The methyl ester of amphotericin B. ChEBI Compound Identification Number:   277842 ChEBI InChI Value:   InChI=1S/C48H75NO17/c1-28-18-16-14-12-10-8-6-7-9-11-13-15-17-19-35(65-47-45(59)42(49)44(58)31(4)64-47)25-39-41(46(60)62-5)38(55)27-48(61,66-39)26-34(52)23-37(54)36(53)21-20-32(50)22-33(51)24-40(56)63-30(3)29(2)43(28)57/h6-19,28-39,41-45,47,50-55,57-59,61H,20-27,49H2,1-5H3/b7-6+,10-8+,11-9+,14-12+,15-13+,18-16+,19-17+/t28-,29-,30-,31+,32+,33+,34-,35-,36+,37+,38-,39-,41+,42-,43+,44+,45-,47-,48+/m0/s1 ChEBI InChIKey Value:   UAZIZEMIKKIBCA-TYVGYKFWSA-N ChEBI Compound Name:   amphotericin B methyl ester ChEBI SMILES Value:   [H][C@]12C[C@@H](O[C@@H]3O[C@H](C)[C@@H](O)[C@H](N)[C@@H]3O)\C=C\C=C\C=C\C=C\C=C\C=C\C=C\[C@H](C)[C@@H](O)[C@@H](C)[C@H](C)OC(=O)C[C@H](O)C[C@H](O)CC[C@@H](O)[C@H](O)C[C@H](O)C[C@](O)(C[C@H](O)[C@H]1C(=O)OC)O2 ChEBI Substance ID:   85470612 ChEBI URL:   ChEBI:277842 ChemSpider ID:   21374348 Ontomatica Chemical Accession Key (OnChAKey):   UAZIZEMIKKIBCA_TYVGYKFWSA_N_000_000000 PubChem Compound ID:   11968030