Item 1 of 1 (back to results) echinocandin B A cyclic hexapeptide echinocandin antibiotic isolated from Aspergillus nidulans var. echinulatus with specific anti-yeast activity.

Current search: 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > antiinfective agent [CHEBI:35441] > echinocandin B [CHEBI:315018] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  antimicrobial agent [CHEBI:33281] (927)   antifungal agent [CHEBI:35718] (130)   echinocandin B [CHEBI:315018] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   antiinfective agent [CHEBI:35441] (82)   echinocandin B [CHEBI:315018] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   amide [CHEBI:32988] (1863)   primary amide [CHEBI:33256] (1586)   carboxamide [CHEBI:37622] (1381)   peptide [CHEBI:16670] (730)   lipopeptide [CHEBI:46895] (60)   echinocandin [CHEBI:57248] (4)   echinocandin B [CHEBI:315018] (1)  organonitrogen compound [CHEBI:35352] (6705)   carboxamide [CHEBI:37622] (1381)   peptide [CHEBI:16670] (730)   lipopeptide [CHEBI:46895] (60)   echinocandin [CHEBI:57248] (4)   echinocandin B [CHEBI:315018] (1)  organic amino compound [CHEBI:50047] (2472)   peptide [CHEBI:16670] (730)   lipopeptide [CHEBI:46895] (60)   echinocandin [CHEBI:57248] (4)   echinocandin B [CHEBI:315018] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   carboxamide [CHEBI:37622] (1381)   peptide [CHEBI:16670] (730)   lipopeptide [CHEBI:46895] (60)   echinocandin [CHEBI:57248] (4)   echinocandin B [CHEBI:315018] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carboxamide [CHEBI:37622] (1381)   peptide [CHEBI:16670] (730)   lipopeptide [CHEBI:46895] (60)   echinocandin [CHEBI:57248] (4)   echinocandin B [CHEBI:315018] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   lipid [CHEBI:18059] (3532)   lipopeptide [CHEBI:46895] (60)   echinocandin [CHEBI:57248] (4)   echinocandin B [CHEBI:315018] (1)  heteroorganic entity [CHEBI:33285] (15197)   organonitrogen compound [CHEBI:35352] (6705)   carboxamide [CHEBI:37622] (1381)   peptide [CHEBI:16670] (730)   lipopeptide [CHEBI:46895] (60)   echinocandin [CHEBI:57248] (4)   echinocandin B [CHEBI:315018] (1)  organic amino compound [CHEBI:50047] (2472)   peptide [CHEBI:16670] (730)   lipopeptide [CHEBI:46895] (60)   echinocandin [CHEBI:57248] (4)   echinocandin B [CHEBI:315018] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carboxamide [CHEBI:37622] (1381)   peptide [CHEBI:16670] (730)   lipopeptide [CHEBI:46895] (60)   echinocandin [CHEBI:57248] (4)   echinocandin B [CHEBI:315018] (1)  organic amino compound [CHEBI:50047] (2472)   peptide [CHEBI:16670] (730)   lipopeptide [CHEBI:46895] (60)   echinocandin [CHEBI:57248] (4)   echinocandin B [CHEBI:315018] (1) ChEBI Compound Accession Identifier:   [CHEBI:315018] ChEBI Compound Description:   A cyclic hexapeptide echinocandin antibiotic isolated from Aspergillus nidulans var. echinulatus with specific anti-yeast activity. ChEBI Compound Identification Number:   315018 ChEBI InChI Value:   InChI=1S/C52H81N7O16/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-38(65)53-35-26-37(64)48(71)57-50(73)42-43(66)29(2)27-59(42)52(75)40(31(4)61)55-49(72)41(45(68)44(67)32-21-23-33(62)24-22-32)56-47(70)36-25-34(63)28-58(36)51(74)39(30(3)60)54-46(35)69/h9-10,12-13,21-24,29-31,34-37,39-45,48,60-64,66-68,71H,5-8,11,14-20,25-28H2,1-4H3,(H,53,65)(H,54,69)(H,55,72)(H,56,70)(H,57,73)/b10-9-,13-12-/t29-,30+,31+,34+,35-,36-,37+,39-,40-,41-,42-,43-,44-,45-,48+/m0/s1 ChEBI InChIKey Value:   FAUOJMHVEYMQQG-HVYQDZECSA-N ChEBI Compound Name:   echinocandin B ChEBI SMILES Value:   CCCCC\C=C/C\C=C/CCCCCCCC(=O)N[C@H]1C[C@@H](O)[C@@H](O)NC(=O)[C@@H]2[C@@H](O)[C@@H](C)CN2C(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H]2C[C@@H](O)CN2C(=O)[C@@H](NC1=O)[C@@H](C)O)[C@H](O)[C@@H](O)c1ccc(O)cc1)[C@@H](C)O ChEBI Substance ID:   85507135 ChEBI URL:   ChEBI:315018 ChemSpider ID:   8073802 Ontomatica Chemical Accession Key (OnChAKey):   FAUOJMHVEYMQQG_HVYQDZECSA_N_000_000000 PubChem Compound ID:   9898144