Item 1 of 1 (back to results) sulfamethoxypyridazine A pyridazine compound having a methoxy substituent at the 6-position and a 4-aminobenzenesulfonamido group at the 3-position.

Current search: 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > antiinfective agent [CHEBI:35441] > sulfamethoxypyridazine [CHEBI:102516] × Select any link to see items in a related category. more general categories    information about this item 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   antiinfective agent [CHEBI:35441] (82)   sulfamethoxypyridazine [CHEBI:102516] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   diazines [CHEBI:38313] (288)   pyridazines [CHEBI:37921] (13)   sulfamethoxypyridazine [CHEBI:102516] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   diazines [CHEBI:38313] (288)   pyridazines [CHEBI:37921] (13)   sulfamethoxypyridazine [CHEBI:102516] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   diazines [CHEBI:38313] (288)   pyridazines [CHEBI:37921] (13)   sulfamethoxypyridazine [CHEBI:102516] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   diazines [CHEBI:38313] (288)   pyridazines [CHEBI:37921] (13)   sulfamethoxypyridazine [CHEBI:102516] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   diazines [CHEBI:38313] (288)   pyridazines [CHEBI:37921] (13)   sulfamethoxypyridazine [CHEBI:102516] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   diazines [CHEBI:38313] (288)   pyridazines [CHEBI:37921] (13)   sulfamethoxypyridazine [CHEBI:102516] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   monocyclic compound [CHEBI:33661] (2007)   heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   diazines [CHEBI:38313] (288)   pyridazines [CHEBI:37921] (13)   sulfamethoxypyridazine [CHEBI:102516] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   diazines [CHEBI:38313] (288)   pyridazines [CHEBI:37921] (13)   sulfamethoxypyridazine [CHEBI:102516] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   diazines [CHEBI:38313] (288)   pyridazines [CHEBI:37921] (13)   sulfamethoxypyridazine [CHEBI:102516] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   diazines [CHEBI:38313] (288)   pyridazines [CHEBI:37921] (13)   sulfamethoxypyridazine [CHEBI:102516] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   diazines [CHEBI:38313] (288)   pyridazines [CHEBI:37921] (13)   sulfamethoxypyridazine [CHEBI:102516] (1)  heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   diazines [CHEBI:38313] (288)   pyridazines [CHEBI:37921] (13)   sulfamethoxypyridazine [CHEBI:102516] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   diazines [CHEBI:38313] (288)   pyridazines [CHEBI:37921] (13)   sulfamethoxypyridazine [CHEBI:102516] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   diazines [CHEBI:38313] (288)   pyridazines [CHEBI:37921] (13)   sulfamethoxypyridazine [CHEBI:102516] (1) ChEBI Compound Accession Identifier:   [CHEBI:102516] ChEBI Compound Description:   A pyridazine compound having a methoxy substituent at the 6-position and a 4-aminobenzenesulfonamido group at the 3-position. ChEBI Compound Identification Number:   102516 ChEBI InChI Value:   InChI=1S/C11H12N4O3S/c1-18-11-7-6-10(13-14-11)15-19(16,17)9-4-2-8(12)3-5-9/h2-7H,12H2,1H3,(H,13,15) ChEBI InChIKey Value:   VLYWMPOKSSWJAL-UHFFFAOYSA-N ChEBI Compound Name:   sulfamethoxypyridazine ChEBI SMILES Value:   COc1ccc(NS(=O)(=O)c2ccc(N)cc2)nn1 ChEBI Substance ID:   85308104 ChEBI URL:   ChEBI:102516 ChemSpider ID:   5139 Ontomatica Chemical Accession Key (OnChAKey):   VLYWMPOKSSWJAL_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   5330