Item 1 of 1 (back to results) afatinib A quinazoline compound having a 3-chloro-4-fluoroanilino group at the 4-position, a 4-dimethylamino-trans-but-2-enamido group at the 6-position, and an (S)-tetrahydrofuran-3-yloxy group at the 7-position.

Current search: 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > antineoplastic agent [CHEBI:35610] > afatinib [CHEBI:61390] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   enzyme inhibitor [CHEBI:23924] (825)   protein kinase inhibitor [CHEBI:37699] (69)   tyrosine kinase inhibitor [CHEBI:38637] (38)   afatinib [CHEBI:61390] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   antineoplastic agent [CHEBI:35610] (760)   afatinib [CHEBI:61390] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   halogen molecular entity [CHEBI:24471] (1475)   chlorine molecular entity [CHEBI:23117] (884)   organochlorine compound [CHEBI:36683] (543)   afatinib [CHEBI:61390] (1)  fluorine molecular entity [CHEBI:24062] (288)   organofluorine compound [CHEBI:37143] (275)   afatinib [CHEBI:61390] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   afatinib [CHEBI:61390] (1)  organofluorine compound [CHEBI:37143] (275)   afatinib [CHEBI:61390] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   oxacycle [CHEBI:38104] (2002)   furans [CHEBI:24129] (114)   afatinib [CHEBI:61390] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   oxacycle [CHEBI:38104] (2002)   furans [CHEBI:24129] (114)   afatinib [CHEBI:61390] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   furans [CHEBI:24129] (114)   afatinib [CHEBI:61390] (1)  oxacycle [CHEBI:38104] (2002)   furans [CHEBI:24129] (114)   afatinib [CHEBI:61390] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   quinazolines [CHEBI:38530] (18)   afatinib [CHEBI:61390] (1)  organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   afatinib [CHEBI:61390] (1)  organofluorine compound [CHEBI:37143] (275)   afatinib [CHEBI:61390] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   oxacycle [CHEBI:38104] (2002)   furans [CHEBI:24129] (114)   afatinib [CHEBI:61390] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   furans [CHEBI:24129] (114)   afatinib [CHEBI:61390] (1)  oxacycle [CHEBI:38104] (2002)   furans [CHEBI:24129] (114)   afatinib [CHEBI:61390] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   quinazolines [CHEBI:38530] (18)   afatinib [CHEBI:61390] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   quinazolines [CHEBI:38530] (18)   afatinib [CHEBI:61390] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   quinazolines [CHEBI:38530] (18)   afatinib [CHEBI:61390] (1)  monocyclic compound [CHEBI:33661] (2007)   heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   furans [CHEBI:24129] (114)   afatinib [CHEBI:61390] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   furans [CHEBI:24129] (114)   afatinib [CHEBI:61390] (1)  oxacycle [CHEBI:38104] (2002)   furans [CHEBI:24129] (114)   afatinib [CHEBI:61390] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   quinazolines [CHEBI:38530] (18)   afatinib [CHEBI:61390] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   furans [CHEBI:24129] (114)   afatinib [CHEBI:61390] (1)  oxacycle [CHEBI:38104] (2002)   furans [CHEBI:24129] (114)   afatinib [CHEBI:61390] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   quinazolines [CHEBI:38530] (18)   afatinib [CHEBI:61390] (1)  heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   furans [CHEBI:24129] (114)   afatinib [CHEBI:61390] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   quinazolines [CHEBI:38530] (18)   afatinib [CHEBI:61390] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   quinazolines [CHEBI:38530] (18)   afatinib [CHEBI:61390] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   furans [CHEBI:24129] (114)   afatinib [CHEBI:61390] (1)  oxacycle [CHEBI:38104] (2002)   furans [CHEBI:24129] (114)   afatinib [CHEBI:61390] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   quinazolines [CHEBI:38530] (18)   afatinib [CHEBI:61390] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   afatinib [CHEBI:61390] (1)  organofluorine compound [CHEBI:37143] (275)   afatinib [CHEBI:61390] (1) ChEBI Compound Accession Identifier:   [CHEBI:61390] ChEBI Compound Description:   A quinazoline compound having a 3-chloro-4-fluoroanilino group at the 4-position, a 4-dimethylamino-trans-but-2-enamido group at the 6-position, and an (S)-tetrahydrofuran-3-yloxy group at the 7-position. ChEBI Compound Identification Number:   61390 ChEBI InChI Value:   InChI=1S/C24H25ClFN5O3/c1-31(2)8-3-4-23(32)30-21-11-17-20(12-22(21)34-16-7-9-33-13-16)27-14-28-24(17)29-15-5-6-19(26)18(25)10-15/h3-6,10-12,14,16H,7-9,13H2,1-2H3,(H,30,32)(H,27,28,29)/b4-3+/t16-/m0/s1 ChEBI InChIKey Value:   ULXXDDBFHOBEHA-CWDCEQMOSA-N ChEBI Compound Name:   afatinib ChEBI SMILES Value:   CN(C)C\C=C\C(=O)Nc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1O[C@H]1CCOC1 ChEBI Substance ID:   111978343 ChEBI URL:   ChEBI:61390 ChemSpider ID:   8360155 Ontomatica Chemical Accession Key (OnChAKey):   ULXXDDBFHOBEHA_CWDCEQMOSA_N_000_000000 PubChem Compound ID:   10184653