| more general categories |
information about this item |
|
| 05. Industrial Uses |
 |
 |
|
05. Industrial Uses |
|
|
|
|
|
|
|
|
|
|
|
(-)-beta-elemene [CHEBI:62855] (1) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
(-)-beta-elemene [CHEBI:62855] (1) |
|
|
|
|
|
|
|
|
|
|
|
(-)-beta-elemene [CHEBI:62855] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
(-)-beta-elemene [CHEBI:62855] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
(-)-beta-elemene [CHEBI:62855] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
(-)-beta-elemene [CHEBI:62855] (1) |
|
|
|
|
|
|
|
|
|
|
|
(-)-beta-elemene [CHEBI:62855] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
(-)-beta-elemene [CHEBI:62855] (1) |
|
|
|
|
|
|
|
|
|
|
|
(-)-beta-elemene [CHEBI:62855] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:62855] |
| ChEBI Compound Description: |
The (-)-enantiomer of beta-elemene that has (1S,2S,4R)-configuration. |
| ChEBI Compound Identification Number: |
62855 |
| ChEBI InChI Value: |
InChI=1S/C15H24/c1-7-15(6)9-8-13(11(2)3)10-14(15)12(4)5/h7,13-14H,1-2,4,8-10H2,3,5-6H3/t13-,14+,15-/m1/s1 |
| ChEBI InChIKey Value: |
OPFTUNCRGUEPRZ-QLFBSQMISA-N |
| ChEBI Compound Name: |
(-)-beta-elemene |
| ChEBI SMILES Value: |
CC(=C)[C@@H]1CC[C@@](C)(C=C)[C@@H](C1)C(C)=C |
| ChEBI Substance ID: |
126522861 |
| ChEBI URL: |
ChEBI:62855 |
| ChemSpider ID: |
5293588 |
| Ontomatica Chemical Accession Key (OnChAKey): |
OPFTUNCRGUEPRZ_QLFBSQMISA_N_000_000000 |
| PubChem Compound ID: |
6918391 |