Item 1 of 1 (back to results) topotecan A pyranoindolizinoquinoline used as an antineoplastic agent. It is a derivative of camptothecin and works by binding to the topoisomerase I-DNA complex and preventing religation of these 328 single strand breaks.

Current search: 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > antineoplastic agent [CHEBI:35610] > topotecan [CHEBI:63632] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   enzyme inhibitor [CHEBI:23924] (825)   topoisomerase inhibitor [CHEBI:70727] (29)   topoisomerase I inhibitor [CHEBI:50276] (11)   topotecan [CHEBI:63632] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   antineoplastic agent [CHEBI:35610] (760)   topotecan [CHEBI:63632] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyranoindolizinoquinoline [CHEBI:48626] (2)   topotecan [CHEBI:63632] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   oxacycle [CHEBI:38104] (2002)   pyranoindolizinoquinoline [CHEBI:48626] (2)   topotecan [CHEBI:63632] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   oxacycle [CHEBI:38104] (2002)   pyranoindolizinoquinoline [CHEBI:48626] (2)   topotecan [CHEBI:63632] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyranoindolizinoquinoline [CHEBI:48626] (2)   topotecan [CHEBI:63632] (1)  oxacycle [CHEBI:38104] (2002)   pyranoindolizinoquinoline [CHEBI:48626] (2)   topotecan [CHEBI:63632] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   pyranoindolizinoquinoline [CHEBI:48626] (2)   topotecan [CHEBI:63632] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyranoindolizinoquinoline [CHEBI:48626] (2)   topotecan [CHEBI:63632] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   oxacycle [CHEBI:38104] (2002)   pyranoindolizinoquinoline [CHEBI:48626] (2)   topotecan [CHEBI:63632] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyranoindolizinoquinoline [CHEBI:48626] (2)   topotecan [CHEBI:63632] (1)  oxacycle [CHEBI:38104] (2002)   pyranoindolizinoquinoline [CHEBI:48626] (2)   topotecan [CHEBI:63632] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   pyranoindolizinoquinoline [CHEBI:48626] (2)   topotecan [CHEBI:63632] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   pyranoindolizinoquinoline [CHEBI:48626] (2)   topotecan [CHEBI:63632] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyranoindolizinoquinoline [CHEBI:48626] (2)   topotecan [CHEBI:63632] (1)  oxacycle [CHEBI:38104] (2002)   pyranoindolizinoquinoline [CHEBI:48626] (2)   topotecan [CHEBI:63632] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   pyranoindolizinoquinoline [CHEBI:48626] (2)   topotecan [CHEBI:63632] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyranoindolizinoquinoline [CHEBI:48626] (2)   topotecan [CHEBI:63632] (1)  oxacycle [CHEBI:38104] (2002)   pyranoindolizinoquinoline [CHEBI:48626] (2)   topotecan [CHEBI:63632] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   pyranoindolizinoquinoline [CHEBI:48626] (2)   topotecan [CHEBI:63632] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   pyranoindolizinoquinoline [CHEBI:48626] (2)   topotecan [CHEBI:63632] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyranoindolizinoquinoline [CHEBI:48626] (2)   topotecan [CHEBI:63632] (1)  oxacycle [CHEBI:38104] (2002)   pyranoindolizinoquinoline [CHEBI:48626] (2)   topotecan [CHEBI:63632] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   pyranoindolizinoquinoline [CHEBI:48626] (2)   topotecan [CHEBI:63632] (1) ChEBI Compound Accession Identifier:   [CHEBI:63632] ChEBI Compound Description:   A pyranoindolizinoquinoline used as an antineoplastic agent. It is a derivative of camptothecin and works by binding to the topoisomerase I-DNA complex and preventing religation of these 328 single strand breaks. ChEBI Compound Identification Number:   63632 ChEBI InChI Value:   InChI=1S/C23H23N3O5/c1-4-23(30)16-8-18-20-12(9-26(18)21(28)15(16)11-31-22(23)29)7-13-14(10-25(2)3)19(27)6-5-17(13)24-20/h5-8,27,30H,4,9-11H2,1-3H3/t23-/m0/s1 ChEBI InChIKey Value:   UCFGDBYHRUNTLO-QHCPKHFHSA-N ChEBI Compound Name:   topotecan ChEBI SMILES Value:   CC[C@@]1(O)C(=O)OCc2c1cc1-c3nc4ccc(O)c(CN(C)C)c4cc3Cn1c2=O ChEBI Substance ID:   135610141 ChEBI URL:   ChEBI:63632 ChemSpider ID:   54705 Ontomatica Chemical Accession Key (OnChAKey):   UCFGDBYHRUNTLO_QHCPKHFHSA_N_000_000000 PubChem Compound ID:   60700