| more general categories |
information about this item |
|
| 03. Biological Effects of Specific Chemicals |
 |
 |
|
03. Biological Effects of Specific Chemicals |
|
|
|
|
|
|
|
|
|
|
|
samaderine C [CHEBI:66160] (1) |
|
 |
| 05. Industrial Uses |
 |
 |
|
05. Industrial Uses |
|
|
|
|
|
|
|
|
|
|
|
samaderine C [CHEBI:66160] (1) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
samaderine C [CHEBI:66160] (1) |
|
|
|
|
|
|
|
samaderine C [CHEBI:66160] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
samaderine C [CHEBI:66160] (1) |
|
|
|
|
|
|
|
samaderine C [CHEBI:66160] (1) |
|
|
|
|
|
|
|
|
|
|
|
samaderine C [CHEBI:66160] (1) |
|
|
|
|
|
|
|
|
|
|
|
samaderine C [CHEBI:66160] (1) |
|
|
|
|
|
|
|
samaderine C [CHEBI:66160] (1) |
|
|
|
|
|
|
|
samaderine C [CHEBI:66160] (1) |
|
|
|
samaderine C [CHEBI:66160] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
samaderine C [CHEBI:66160] (1) |
|
|
|
|
|
|
|
|
|
|
|
samaderine C [CHEBI:66160] (1) |
|
|
|
|
|
|
|
samaderine C [CHEBI:66160] (1) |
|
|
|
|
|
|
|
samaderine C [CHEBI:66160] (1) |
|
|
|
samaderine C [CHEBI:66160] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
samaderine C [CHEBI:66160] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
samaderine C [CHEBI:66160] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
samaderine C [CHEBI:66160] (1) |
|
|
|
samaderine C [CHEBI:66160] (1) |
|
|
|
|
|
|
|
samaderine C [CHEBI:66160] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
samaderine C [CHEBI:66160] (1) |
|
|
|
|
|
|
|
|
|
|
|
samaderine C [CHEBI:66160] (1) |
|
|
|
|
|
|
|
samaderine C [CHEBI:66160] (1) |
|
|
|
|
|
|
|
samaderine C [CHEBI:66160] (1) |
|
|
|
samaderine C [CHEBI:66160] (1) |
|
|
|
|
|
|
|
|
|
|
|
samaderine C [CHEBI:66160] (1) |
|
|
|
|
|
|
|
samaderine C [CHEBI:66160] (1) |
|
|
|
|
|
|
|
samaderine C [CHEBI:66160] (1) |
|
|
|
|
|
|
|
samaderine C [CHEBI:66160] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
samaderine C [CHEBI:66160] (1) |
|
|
|
samaderine C [CHEBI:66160] (1) |
|
|
|
|
|
|
|
samaderine C [CHEBI:66160] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
samaderine C [CHEBI:66160] (1) |
|
|
|
|
|
|
|
samaderine C [CHEBI:66160] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
samaderine C [CHEBI:66160] (1) |
|
|
|
samaderine C [CHEBI:66160] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
samaderine C [CHEBI:66160] (1) |
|
|
|
samaderine C [CHEBI:66160] (1) |
|
|
|
|
|
|
|
samaderine C [CHEBI:66160] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
samaderine C [CHEBI:66160] (1) |
|
|
|
samaderine C [CHEBI:66160] (1) |
|
|
|
|
|
|
|
samaderine C [CHEBI:66160] (1) |
|
|
|
|
|
|
|
|
|
|
|
samaderine C [CHEBI:66160] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
samaderine C [CHEBI:66160] (1) |
|
|
|
samaderine C [CHEBI:66160] (1) |
|
|
|
|
|
|
|
samaderine C [CHEBI:66160] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
samaderine C [CHEBI:66160] (1) |
|
|
|
|
|
|
|
samaderine C [CHEBI:66160] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
samaderine C [CHEBI:66160] (1) |
|
|
|
|
|
|
|
samaderine C [CHEBI:66160] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:66160] |
| ChEBI Compound Description: |
A quassinoid isolated from Quassia indica and has been shown to exhibit antineoplastic activity. |
| ChEBI Compound Identification Number: |
66160 |
| ChEBI InChI Value: |
InChI=1S/C19H24O7/c1-7-4-9(20)14(23)17(2)8(7)5-10(21)19-6-25-18(3)13(19)16(24)26-15(18)11(22)12(17)19/h4,8-9,11-15,20,22-23H,5-6H2,1-3H3/t8-,9-,11+,12+,13-,14+,15-,17-,18-,19+/m0/s1 |
| ChEBI InChIKey Value: |
PDGZDUYWUXJXRO-ANPVQLFHSA-N |
| ChEBI Compound Name: |
samaderine C |
| ChEBI SMILES Value: |
[H][C@@]12OC(=O)[C@@]3([H])[C@]1(C)OC[C@]31C(=O)C[C@@]3([H])C(C)=C[C@H](O)[C@@H](O)[C@]3(C)[C@@]1([H])[C@H]2O |
| ChEBI Substance ID: |
160709690 |
| ChEBI URL: |
ChEBI:66160 |
| ChemSpider ID: |
21181540 |
| Ontomatica Chemical Accession Key (OnChAKey): |
PDGZDUYWUXJXRO_ANPVQLFHSA_N_000_000000 |
| PubChem Compound ID: |
70697767 |