Item 1 of 1 (back to results) samaderine Z A quassinoid isolated from Quassia indica and has been shown to exhibit antimalarial and antineoplastic activity.

Current search: 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > antineoplastic agent [CHEBI:35610] > samaderine Z [CHEBI:66164] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   samaderine Z [CHEBI:66164] (1)  antimicrobial agent [CHEBI:33281] (927)   antimicrobial drug [CHEBI:36043] (169)   antiprotozoal drug [CHEBI:35820] (168)   antimalarial [CHEBI:38068] (89)   samaderine Z [CHEBI:66164] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   antineoplastic agent [CHEBI:35610] (760)   samaderine Z [CHEBI:66164] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   polyol [CHEBI:26191] (437)   tetrol [CHEBI:33573] (22)   samaderine Z [CHEBI:66164] (1)  alcohol [CHEBI:30879] (1371)   secondary alcohol [CHEBI:35681] (342)   samaderine Z [CHEBI:66164] (1)  p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   polyol [CHEBI:26191] (437)   tetrol [CHEBI:33573] (22)   samaderine Z [CHEBI:66164] (1)  alcohol [CHEBI:30879] (1371)   secondary alcohol [CHEBI:35681] (342)   samaderine Z [CHEBI:66164] (1)  organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   cyclic ether [CHEBI:37407] (314)   samaderine Z [CHEBI:66164] (1)  carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   alpha,beta-unsaturated ketone [CHEBI:51721] (238)   enone [CHEBI:51689] (233)   samaderine Z [CHEBI:66164] (1)  carboxylic ester [CHEBI:33308] (1495)   lactone [CHEBI:25000] (516)   delta-lactone [CHEBI:18946] (48)   samaderine Z [CHEBI:66164] (1)  oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   delta-lactone [CHEBI:18946] (48)   samaderine Z [CHEBI:66164] (1)  cyclic ether [CHEBI:37407] (314)   samaderine Z [CHEBI:66164] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   cyclic ether [CHEBI:37407] (314)   samaderine Z [CHEBI:66164] (1)  carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   alpha,beta-unsaturated ketone [CHEBI:51721] (238)   enone [CHEBI:51689] (233)   samaderine Z [CHEBI:66164] (1)  carboxylic ester [CHEBI:33308] (1495)   lactone [CHEBI:25000] (516)   delta-lactone [CHEBI:18946] (48)   samaderine Z [CHEBI:66164] (1)  oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   delta-lactone [CHEBI:18946] (48)   samaderine Z [CHEBI:66164] (1)  cyclic ether [CHEBI:37407] (314)   samaderine Z [CHEBI:66164] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   lipid [CHEBI:18059] (3532)   isoprenoid [CHEBI:24913] (1402)   terpenoid [CHEBI:26873] (1099)   triterpenoid [CHEBI:36615] (228)   quassinoid [CHEBI:72485] (8)   samaderine Z [CHEBI:66164] (1)  isoprenoid [CHEBI:24913] (1402)   terpenoid [CHEBI:26873] (1099)   triterpenoid [CHEBI:36615] (228)   quassinoid [CHEBI:72485] (8)   samaderine Z [CHEBI:66164] (1)  heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   delta-lactone [CHEBI:18946] (48)   samaderine Z [CHEBI:66164] (1)  cyclic ether [CHEBI:37407] (314)   samaderine Z [CHEBI:66164] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   samaderine Z [CHEBI:66164] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   cyclic ether [CHEBI:37407] (314)   samaderine Z [CHEBI:66164] (1)  carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   alpha,beta-unsaturated ketone [CHEBI:51721] (238)   enone [CHEBI:51689] (233)   samaderine Z [CHEBI:66164] (1)  carboxylic ester [CHEBI:33308] (1495)   lactone [CHEBI:25000] (516)   delta-lactone [CHEBI:18946] (48)   samaderine Z [CHEBI:66164] (1)  oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   delta-lactone [CHEBI:18946] (48)   samaderine Z [CHEBI:66164] (1)  cyclic ether [CHEBI:37407] (314)   samaderine Z [CHEBI:66164] (1)  organic hydroxy compound [CHEBI:33822] (3050)   polyol [CHEBI:26191] (437)   tetrol [CHEBI:33573] (22)   samaderine Z [CHEBI:66164] (1)  alcohol [CHEBI:30879] (1371)   secondary alcohol [CHEBI:35681] (342)   samaderine Z [CHEBI:66164] (1)  ester [CHEBI:35701] (3370)   lactone [CHEBI:25000] (516)   delta-lactone [CHEBI:18946] (48)   samaderine Z [CHEBI:66164] (1)  carboxylic ester [CHEBI:33308] (1495)   lactone [CHEBI:25000] (516)   delta-lactone [CHEBI:18946] (48)   samaderine Z [CHEBI:66164] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   delta-lactone [CHEBI:18946] (48)   samaderine Z [CHEBI:66164] (1)  cyclic ether [CHEBI:37407] (314)   samaderine Z [CHEBI:66164] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   samaderine Z [CHEBI:66164] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   alpha,beta-unsaturated ketone [CHEBI:51721] (238)   enone [CHEBI:51689] (233)   samaderine Z [CHEBI:66164] (1)  carboxylic ester [CHEBI:33308] (1495)   lactone [CHEBI:25000] (516)   delta-lactone [CHEBI:18946] (48)   samaderine Z [CHEBI:66164] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   samaderine Z [CHEBI:66164] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   delta-lactone [CHEBI:18946] (48)   samaderine Z [CHEBI:66164] (1)  cyclic ether [CHEBI:37407] (314)   samaderine Z [CHEBI:66164] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   samaderine Z [CHEBI:66164] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   delta-lactone [CHEBI:18946] (48)   samaderine Z [CHEBI:66164] (1)  cyclic ether [CHEBI:37407] (314)   samaderine Z [CHEBI:66164] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   samaderine Z [CHEBI:66164] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   samaderine Z [CHEBI:66164] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   delta-lactone [CHEBI:18946] (48)   samaderine Z [CHEBI:66164] (1)  cyclic ether [CHEBI:37407] (314)   samaderine Z [CHEBI:66164] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   samaderine Z [CHEBI:66164] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   alpha,beta-unsaturated ketone [CHEBI:51721] (238)   enone [CHEBI:51689] (233)   samaderine Z [CHEBI:66164] (1)  carboxylic ester [CHEBI:33308] (1495)   lactone [CHEBI:25000] (516)   delta-lactone [CHEBI:18946] (48)   samaderine Z [CHEBI:66164] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   polyol [CHEBI:26191] (437)   tetrol [CHEBI:33573] (22)   samaderine Z [CHEBI:66164] (1)  alcohol [CHEBI:30879] (1371)   secondary alcohol [CHEBI:35681] (342)   samaderine Z [CHEBI:66164] (1) ChEBI Compound Accession Identifier:   [CHEBI:66164] ChEBI Compound Description:   A quassinoid isolated from Quassia indica and has been shown to exhibit antimalarial and antineoplastic activity. ChEBI Compound Identification Number:   66164 ChEBI InChI Value:   InChI=1S/C20H26O8/c1-7-4-9(21)15(24)18(2)8(7)5-10-20-6-27-19(3,16(25)11(22)13(18)20)14(20)12(23)17(26)28-10/h4,8,10-16,22-25H,5-6H2,1-3H3/t8-,10+,11+,12+,13+,14-,15+,16-,18-,19-,20+/m0/s1 ChEBI InChIKey Value:   KDVYRSSTPWSAJC-GGUABDNCSA-N ChEBI Compound Name:   samaderine Z ChEBI SMILES Value:   [H][C@@]12C[C@@]3([H])C(C)=CC(=O)[C@@H](O)[C@]3(C)[C@@]3([H])[C@@H](O)[C@H](O)[C@@]4(C)OC[C@@]13[C@@]4([H])[C@@H](O)C(=O)O2 ChEBI Substance ID:   160709934 ChEBI URL:   ChEBI:66164 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   KDVYRSSTPWSAJC_GGUABDNCSA_N_000_000000 PubChem Compound ID:   44593590