New Search

Item 1 of 1 (back to results)

rostratin B
An organic disulfide isolated from the whole broth of the marine-derived fungus Exserohilum rostratum and has been shown to exhibit antineoplastic activity.


Current search:

05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > antineoplastic agent [CHEBI:35610] > rostratin B [CHEBI:66311]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 biochemical uses [CHEBI:52206] (3306) 
 metabolite [CHEBI:25212] (2692) 
 secondary metabolite [CHEBI:26619] (2225) 
 rostratin B [CHEBI:66311] (1)
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 antineoplastic agent [CHEBI:35610] (760) 
 rostratin B [CHEBI:66311] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 polyol [CHEBI:26191] (437) 
 diol [CHEBI:23824] (172) 
 rostratin B [CHEBI:66311] (1)
 alcohol [CHEBI:30879] (1371) 
 secondary alcohol [CHEBI:35681] (342) 
 rostratin B [CHEBI:66311] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 amide [CHEBI:32988] (1863) 
 cyclic amide [CHEBI:3990] (252) 
 lactam [CHEBI:24995] (252) 
 rostratin B [CHEBI:66311] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 lactam [CHEBI:24995] (252) 
 rostratin B [CHEBI:66311] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 polyol [CHEBI:26191] (437) 
 diol [CHEBI:23824] (172) 
 rostratin B [CHEBI:66311] (1)
 alcohol [CHEBI:30879] (1371) 
 secondary alcohol [CHEBI:35681] (342) 
 rostratin B [CHEBI:66311] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 cyclic ketone [CHEBI:3992] (644) 
 rostratin B [CHEBI:66311] (1)
 sulfur molecular entity [CHEBI:26835] (1541) 
 organosulfur compound [CHEBI:33261] (1005) 
 organic disulfide [CHEBI:35489] (36) 
 rostratin B [CHEBI:66311] (1)
 disulfide [CHEBI:48343] (41) 
 organic disulfide [CHEBI:35489] (36) 
 rostratin B [CHEBI:66311] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organosulfur compound [CHEBI:33261] (1005) 
 organic disulfide [CHEBI:35489] (36) 
 rostratin B [CHEBI:66311] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 cyclic ketone [CHEBI:3992] (644) 
 rostratin B [CHEBI:66311] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 lactam [CHEBI:24995] (252) 
 rostratin B [CHEBI:66311] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterohexacyclic compound [CHEBI:51914] (33) 
 rostratin B [CHEBI:66311] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 lactam [CHEBI:24995] (252) 
 rostratin B [CHEBI:66311] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organosulfur compound [CHEBI:33261] (1005) 
 organic disulfide [CHEBI:35489] (36) 
 rostratin B [CHEBI:66311] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 cyclic ketone [CHEBI:3992] (644) 
 rostratin B [CHEBI:66311] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 polyol [CHEBI:26191] (437) 
 diol [CHEBI:23824] (172) 
 rostratin B [CHEBI:66311] (1)
 alcohol [CHEBI:30879] (1371) 
 secondary alcohol [CHEBI:35681] (342) 
 rostratin B [CHEBI:66311] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 lactam [CHEBI:24995] (252) 
 rostratin B [CHEBI:66311] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterohexacyclic compound [CHEBI:51914] (33) 
 rostratin B [CHEBI:66311] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 cyclic ketone [CHEBI:3992] (644) 
 rostratin B [CHEBI:66311] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterohexacyclic compound [CHEBI:51914] (33) 
 rostratin B [CHEBI:66311] (1)
 bridged compound [CHEBI:35990] (118) 
 rostratin B [CHEBI:66311] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 lactam [CHEBI:24995] (252) 
 rostratin B [CHEBI:66311] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterohexacyclic compound [CHEBI:51914] (33) 
 rostratin B [CHEBI:66311] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 lactam [CHEBI:24995] (252) 
 rostratin B [CHEBI:66311] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterohexacyclic compound [CHEBI:51914] (33) 
 rostratin B [CHEBI:66311] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterohexacyclic compound [CHEBI:51914] (33) 
 rostratin B [CHEBI:66311] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 lactam [CHEBI:24995] (252) 
 rostratin B [CHEBI:66311] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterohexacyclic compound [CHEBI:51914] (33) 
 rostratin B [CHEBI:66311] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 cyclic ketone [CHEBI:3992] (644) 
 rostratin B [CHEBI:66311] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 polyol [CHEBI:26191] (437) 
 diol [CHEBI:23824] (172) 
 rostratin B [CHEBI:66311] (1)
 alcohol [CHEBI:30879] (1371) 
 secondary alcohol [CHEBI:35681] (342) 
 rostratin B [CHEBI:66311] (1)
ChEBI Compound Accession Identifier  [CHEBI:66311]
ChEBI Compound Description  An organic disulfide isolated from the whole broth of the marine-derived fungus Exserohilum rostratum and has been shown to exhibit antineoplastic activity.
ChEBI Compound Identification Number  66311
ChEBI InChI Value  InChI=1S/C18H20N2O6S2/c21-9-1-3-11(23)13-7(9)5-17-15(25)20-14-8(10(22)2-4-12(14)24)6-18(20,28-27-17)16(26)19(13)17/h7-8,11-14,23-24H,1-6H2/t7-,8-,11+,12+,13-,14-,17-,18-/m1/s1
ChEBI InChIKey Value  ICKHXBRXCAORGF-ZJNFRVSGSA-N
ChEBI Compound Name  rostratin B
ChEBI SMILES Value  [H][C@]12C[C@@]34SS[C@]5(C[C@]6([H])C(=O)CC[C@H](O)[C@]6([H])N5C3=O)C(=O)N4[C@@]1([H])[C@@H](O)CCC2=O
ChEBI Substance ID  160710067
ChEBI URL  ChEBI:66311
ChemSpider ID  9661896
Ontomatica Chemical Accession Key (OnChAKey)  ICKHXBRXCAORGF_ZJNFRVSGSA_N_000_000000
PubChem Compound ID  11487079