New Search

Item 1 of 1 (back to results)

neocarzinostatin chromophore
A naphthoate ester obtained by formal condensation of the carboxy group of 2-hydroxy-7-methoxy-5-methyl-1-naphthoic acid with the 5-hydroxy group of (1aS,5R,6R,6aE,9aR)-5-hydroxy-1a-[(4R)-2-oxo-1,3-dioxolan-4-yl]-2,3,8,9-tetradehydro-1a,5,6,9a-tetrahydrocyclopenta[5,6]cyclonona[1,2-b]oxiren-6-yl 2,6-dideoxy-2-(methylamino)-alpha-D-galactopyranoside. The chromophoric part of neocarzinostatin, it is tightly and non-covelently bound to a 113-membered apoprotein, which serves to protect it and release it to the target DNA.


Current search:

05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > antineoplastic agent [CHEBI:35610] > neocarzinostatin chromophore [CHEBI:29655]
×

Select any link to see items in a related category.

more general categories    information about this item
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 antineoplastic agent [CHEBI:35610] (760) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 naphthoate ester [CHEBI:46831] (1) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 oxacycle [CHEBI:38104] (2002) 
 dioxolane [CHEBI:39430] (10) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 cyclopentacyclononaoxirene [CHEBI:46830] (1) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 glycosyl compound [CHEBI:63161] (1006) 
 glycoside [CHEBI:24400] (633) 
 hexosaminide [CHEBI:24587] (15) 
 D-galactosaminide [CHEBI:20954] (5) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 carbohydrate derivative [CHEBI:63299] (2582) 
 amino sugar [CHEBI:28963] (177) 
 amino monosaccharide [CHEBI:60926] (69) 
 hexosamine [CHEBI:24586] (59) 
 hexosaminide [CHEBI:24587] (15) 
 D-galactosaminide [CHEBI:20954] (5) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 monosaccharide derivative [CHEBI:63367] (720) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 naphthoate ester [CHEBI:46831] (1) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 oxacycle [CHEBI:38104] (2002) 
 dioxolane [CHEBI:39430] (10) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 cyclopentacyclononaoxirene [CHEBI:46830] (1) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 glycosyl compound [CHEBI:63161] (1006) 
 glycoside [CHEBI:24400] (633) 
 hexosaminide [CHEBI:24587] (15) 
 D-galactosaminide [CHEBI:20954] (5) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 carbohydrate derivative [CHEBI:63299] (2582) 
 amino sugar [CHEBI:28963] (177) 
 amino monosaccharide [CHEBI:60926] (69) 
 hexosamine [CHEBI:24586] (59) 
 hexosaminide [CHEBI:24587] (15) 
 D-galactosaminide [CHEBI:20954] (5) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 monosaccharide derivative [CHEBI:63367] (720) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 dioxolane [CHEBI:39430] (10) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 oxacycle [CHEBI:38104] (2002) 
 dioxolane [CHEBI:39430] (10) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 cyclopentacyclononaoxirene [CHEBI:46830] (1) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 cyclopentacyclononaoxirene [CHEBI:46830] (1) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 naphthoate ester [CHEBI:46831] (1) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 oxacycle [CHEBI:38104] (2002) 
 dioxolane [CHEBI:39430] (10) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 cyclopentacyclononaoxirene [CHEBI:46830] (1) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 glycosyl compound [CHEBI:63161] (1006) 
 glycoside [CHEBI:24400] (633) 
 hexosaminide [CHEBI:24587] (15) 
 D-galactosaminide [CHEBI:20954] (5) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 carbohydrate derivative [CHEBI:63299] (2582) 
 amino sugar [CHEBI:28963] (177) 
 amino monosaccharide [CHEBI:60926] (69) 
 hexosamine [CHEBI:24586] (59) 
 hexosaminide [CHEBI:24587] (15) 
 D-galactosaminide [CHEBI:20954] (5) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 monosaccharide derivative [CHEBI:63367] (720) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 ester [CHEBI:35701] (3370) 
 carboxylic ester [CHEBI:33308] (1495) 
 naphthoate ester [CHEBI:46831] (1) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 dioxolane [CHEBI:39430] (10) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 oxacycle [CHEBI:38104] (2002) 
 dioxolane [CHEBI:39430] (10) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 cyclopentacyclononaoxirene [CHEBI:46830] (1) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 cyclopentacyclononaoxirene [CHEBI:46830] (1) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 cyclopentacyclononaoxirene [CHEBI:46830] (1) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 naphthoate ester [CHEBI:46831] (1) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 heterotricyclic compound [CHEBI:36688] (541) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 cyclopentacyclononaoxirene [CHEBI:46830] (1) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 cyclopentacyclononaoxirene [CHEBI:46830] (1) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 cyclopentacyclononaoxirene [CHEBI:46830] (1) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 monocyclic compound [CHEBI:33661] (2007) 
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 dioxolane [CHEBI:39430] (10) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 dioxolane [CHEBI:39430] (10) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 oxacycle [CHEBI:38104] (2002) 
 dioxolane [CHEBI:39430] (10) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 cyclopentacyclononaoxirene [CHEBI:46830] (1) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 cyclopentacyclononaoxirene [CHEBI:46830] (1) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 cyclopentacyclononaoxirene [CHEBI:46830] (1) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 dioxolane [CHEBI:39430] (10) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 oxacycle [CHEBI:38104] (2002) 
 dioxolane [CHEBI:39430] (10) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 cyclopentacyclononaoxirene [CHEBI:46830] (1) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 cyclopentacyclononaoxirene [CHEBI:46830] (1) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 dioxolane [CHEBI:39430] (10) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 heterotricyclic compound [CHEBI:36688] (541) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 cyclopentacyclononaoxirene [CHEBI:46830] (1) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 cyclopentacyclononaoxirene [CHEBI:46830] (1) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 dioxolane [CHEBI:39430] (10) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 oxacycle [CHEBI:38104] (2002) 
 dioxolane [CHEBI:39430] (10) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 cyclopentacyclononaoxirene [CHEBI:46830] (1) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 cyclopentacyclononaoxirene [CHEBI:46830] (1) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 cyclopentacyclononaoxirene [CHEBI:46830] (1) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 naphthoate ester [CHEBI:46831] (1) 
 neocarzinostatin chromophore [CHEBI:29655] (1)
ChEBI Compound Accession Identifier  [CHEBI:29655]
ChEBI Compound Description  A naphthoate ester obtained by formal condensation of the carboxy group of 2-hydroxy-7-methoxy-5-methyl-1-naphthoic acid with the 5-hydroxy group of (1aS,5R,6R,6aE,9aR)-5-hydroxy-1a-[(4R)-2-oxo-1,3-dioxolan-4-yl]-2,3,8,9-tetradehydro-1a,5,6,9a-tetrahydrocyclopenta[5,6]cyclonona[1,2-b]oxiren-6-yl 2,6-dideoxy-2-(methylamino)-alpha-D-galactopyranoside. The chromophoric part of neocarzinostatin, it is tightly and non-covelently bound to a 113-membered apoprotein, which serves to protect it and release it to the target DNA.
ChEBI Compound Identification Number  29655
ChEBI InChI Value  InChI=1S/C35H33NO12/c1-16-12-19(42-4)14-22-20(16)8-9-23(37)27(22)32(40)45-24-13-18-10-11-35(26-15-43-34(41)46-26)25(48-35)7-5-6-21(18)31(24)47-33-28(36-3)30(39)29(38)17(2)44-33/h6,8-9,12-14,17,24-26,28-31,33,36-39H,15H2,1-4H3/b21-6+/t17-,24-,25-,26-,28-,29+,30-,31-,33-,35+/m1/s1
ChEBI InChIKey Value  QZGIWPZCWHMVQL-UIYAJPBUSA-N
ChEBI Compound Name  neocarzinostatin chromophore
ChEBI SMILES Value  CN[C@@H]1[C@@H](O)[C@@H](O)[C@@H](C)O[C@@H]1O[C@H]1[C@H](OC(=O)c2c(O)ccc3c(C)cc(OC)cc23)C=C2C#C[C@@]3(O[C@@H]3C#C/C=C1\2)[C@H]1COC(=O)O1
ChEBI Substance ID  135610100
ChEBI URL  ChEBI:29655
ChemSpider ID  394601
Ontomatica Chemical Accession Key (OnChAKey)  QZGIWPZCWHMVQL_UIYAJPBUSA_N_000_000000
PubChem Compound ID  447545