Item 1 of 1 (back to results) moromycin B An angucycline that consists of tetrangomycin linked to a deoxy sugar moiety at position 9 via a C-glycosidic bond. It is isolated from Streptomyces sp.KY002 and exhibits cytotoxicity against human lung cancer and MCF-7 human breast cancer cells.

Current search: 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > antineoplastic agent [CHEBI:35610] > moromycin B [CHEBI:66404] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  antimicrobial agent [CHEBI:33281] (927)   antibiotic [CHEBI:22582] (193)   moromycin B [CHEBI:66404] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   antineoplastic agent [CHEBI:35610] (760)   moromycin B [CHEBI:66404] (1) 06. Name of Biological Source of Chemical  06. Name of Biological Source of Chemical  Archaea, Cyanobacteria and Bacteria (302)   Eubacteria (239)   Firmicutes (214)   Actinobacteria (204)   Actinobacteridae (204)   Actinomycetales (204)   Streptomycetaceae (160)   Streptomyces (157) 07. Part of Biological Source of Chemical  07. Part of Biological Source of Chemical  unspecified structure [PO:0000004] (703) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   polyketide [CHEBI:26188] (172)   angucycline [CHEBI:48130] (13)   angucycline antibiotic [CHEBI:70737] (5)   moromycin B [CHEBI:66404] (1)  glycosyl compound [CHEBI:63161] (1006)   C-glycosyl compound [CHEBI:20857] (52)   moromycin B [CHEBI:66404] (1)  carbohydrate derivative [CHEBI:63299] (2582)   C-glycosyl compound [CHEBI:20857] (52)   moromycin B [CHEBI:66404] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   polyketide [CHEBI:26188] (172)   angucycline [CHEBI:48130] (13)   angucycline antibiotic [CHEBI:70737] (5)   moromycin B [CHEBI:66404] (1)  glycosyl compound [CHEBI:63161] (1006)   C-glycosyl compound [CHEBI:20857] (52)   moromycin B [CHEBI:66404] (1)  carbohydrate derivative [CHEBI:63299] (2582)   C-glycosyl compound [CHEBI:20857] (52)   moromycin B [CHEBI:66404] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   polyketide [CHEBI:26188] (172)   angucycline [CHEBI:48130] (13)   angucycline antibiotic [CHEBI:70737] (5)   moromycin B [CHEBI:66404] (1)  glycosyl compound [CHEBI:63161] (1006)   C-glycosyl compound [CHEBI:20857] (52)   moromycin B [CHEBI:66404] (1)  carbohydrate derivative [CHEBI:63299] (2582)   C-glycosyl compound [CHEBI:20857] (52)   moromycin B [CHEBI:66404] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   tetraphenes [CHEBI:51067] (19)   angucycline [CHEBI:48130] (13)   angucycline antibiotic [CHEBI:70737] (5)   moromycin B [CHEBI:66404] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   tetraphenes [CHEBI:51067] (19)   angucycline [CHEBI:48130] (13)   angucycline antibiotic [CHEBI:70737] (5)   moromycin B [CHEBI:66404] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   homocyclic compound [CHEBI:33597] (1134)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   tetraphenes [CHEBI:51067] (19)   angucycline [CHEBI:48130] (13)   angucycline antibiotic [CHEBI:70737] (5)   moromycin B [CHEBI:66404] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   tetraphenes [CHEBI:51067] (19)   angucycline [CHEBI:48130] (13)   angucycline antibiotic [CHEBI:70737] (5)   moromycin B [CHEBI:66404] (1)  organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   tetraphenes [CHEBI:51067] (19)   angucycline [CHEBI:48130] (13)   angucycline antibiotic [CHEBI:70737] (5)   moromycin B [CHEBI:66404] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   tetraphenes [CHEBI:51067] (19)   angucycline [CHEBI:48130] (13)   angucycline antibiotic [CHEBI:70737] (5)   moromycin B [CHEBI:66404] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   tetraphenes [CHEBI:51067] (19)   angucycline [CHEBI:48130] (13)   angucycline antibiotic [CHEBI:70737] (5)   moromycin B [CHEBI:66404] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   tetraphenes [CHEBI:51067] (19)   angucycline [CHEBI:48130] (13)   angucycline antibiotic [CHEBI:70737] (5)   moromycin B [CHEBI:66404] (1) ChEBI Compound Accession Identifier:   [CHEBI:66404] ChEBI Compound Description:   An angucycline that consists of tetrangomycin linked to a deoxy sugar moiety at position 9 via a C-glycosidic bond. It is isolated from Streptomyces sp.KY002 and exhibits cytotoxicity against human lung cancer and MCF-7 human breast cancer cells. ChEBI Compound Identification Number:   66404 ChEBI InChI Value:   InChI=1S/C31H30O10/c1-12-18(32)8-22-30(39-12)41-29-13(2)38-20(9-21(29)40-22)15-6-7-17-25(26(15)34)28(36)16-5-4-14-10-31(3,37)11-19(33)23(14)24(16)27(17)35/h4-7,12-13,20-22,29-30,34,37H,8-11H2,1-3H3/t12-,13+,20+,21+,22-,29+,30-,31+/m0/s1 ChEBI InChIKey Value:   IVVLBSCKLIYBCU-GEMPFEMJSA-N ChEBI Compound Name:   moromycin B ChEBI SMILES Value:   [H][C@@]12C[C@@H](O[C@H](C)[C@@]1([H])O[C@]1([H])O[C@@H](C)C(=O)C[C@]1([H])O2)c1ccc2C(=O)c3c(ccc4C[C@@](C)(O)CC(=O)c34)C(=O)c2c1O ChEBI Substance ID:   160645235 ChEBI URL:   ChEBI:66404 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   IVVLBSCKLIYBCU_GEMPFEMJSA_N_000_000000 PubChem Compound ID:   25112054