Item 1 of 1 (back to results) lucialdehyde B A tetracyclic triterpenoid that is lanosta-8,24-dien-26-al substituted by oxo groups at positions 3 and 7. Isolated from Ganoderma lucidum and Ganoderma pfeifferi, it exhibits antiviral and cytotoxic activities.

Current search: 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > antineoplastic agent [CHEBI:35610] > lucialdehyde B [CHEBI:66593] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   lucialdehyde B [CHEBI:66593] (1)  antimicrobial agent [CHEBI:33281] (927)   antiviral agent [CHEBI:22587] (216)   anti-HSV agent [CHEBI:64952] (15)   lucialdehyde B [CHEBI:66593] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   antineoplastic agent [CHEBI:35610] (760)   lucialdehyde B [CHEBI:66593] (1) 06. Name of Biological Source of Chemical  06. Name of Biological Source of Chemical  Fungi, Yeasts, Molds and Mildews (348)   Dikarya (97)   Basidiomycota (16)   Agaricomycotina (16)   Agaricomycetes (16)   Phallomycetidae (11)   Ganodermataceae (8)   Ganoderma (8)   Ganoderma lucidum (5) 07. Part of Biological Source of Chemical  07. Part of Biological Source of Chemical  unspecified structure [PO:0000004] (703) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   terpene ketone [CHEBI:26872] (39)   cyclic terpene ketone [CHEBI:36130] (33)   lucialdehyde B [CHEBI:66593] (1)  cyclic ketone [CHEBI:3992] (644)   alicyclic ketone [CHEBI:36132] (68)   cyclic terpene ketone [CHEBI:36130] (33)   lucialdehyde B [CHEBI:66593] (1)  aldehyde [CHEBI:17478] (258)   lucialdehyde B [CHEBI:66593] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   terpene ketone [CHEBI:26872] (39)   cyclic terpene ketone [CHEBI:36130] (33)   lucialdehyde B [CHEBI:66593] (1)  cyclic ketone [CHEBI:3992] (644)   alicyclic ketone [CHEBI:36132] (68)   cyclic terpene ketone [CHEBI:36130] (33)   lucialdehyde B [CHEBI:66593] (1)  aldehyde [CHEBI:17478] (258)   lucialdehyde B [CHEBI:66593] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   lipid [CHEBI:18059] (3532)   isoprenoid [CHEBI:24913] (1402)   terpenoid [CHEBI:26873] (1099)   terpene ketone [CHEBI:26872] (39)   cyclic terpene ketone [CHEBI:36130] (33)   lucialdehyde B [CHEBI:66593] (1)  triterpenoid [CHEBI:36615] (228)   tetracyclic triterpenoid [CHEBI:26893] (37)   lucialdehyde B [CHEBI:66593] (1)  isoprenoid [CHEBI:24913] (1402)   terpenoid [CHEBI:26873] (1099)   terpene ketone [CHEBI:26872] (39)   cyclic terpene ketone [CHEBI:36130] (33)   lucialdehyde B [CHEBI:66593] (1)  triterpenoid [CHEBI:36615] (228)   tetracyclic triterpenoid [CHEBI:26893] (37)   lucialdehyde B [CHEBI:66593] (1)  heteroorganic entity [CHEBI:33285] (15197)   organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   terpene ketone [CHEBI:26872] (39)   cyclic terpene ketone [CHEBI:36130] (33)   lucialdehyde B [CHEBI:66593] (1)  cyclic ketone [CHEBI:3992] (644)   alicyclic ketone [CHEBI:36132] (68)   cyclic terpene ketone [CHEBI:36130] (33)   lucialdehyde B [CHEBI:66593] (1)  aldehyde [CHEBI:17478] (258)   lucialdehyde B [CHEBI:66593] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic polycyclic compound [CHEBI:51958] (1654)   tetracyclic triterpenoid [CHEBI:26893] (37)   lucialdehyde B [CHEBI:66593] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   terpene ketone [CHEBI:26872] (39)   cyclic terpene ketone [CHEBI:36130] (33)   lucialdehyde B [CHEBI:66593] (1)  cyclic ketone [CHEBI:3992] (644)   alicyclic ketone [CHEBI:36132] (68)   cyclic terpene ketone [CHEBI:36130] (33)   lucialdehyde B [CHEBI:66593] (1)  aldehyde [CHEBI:17478] (258)   lucialdehyde B [CHEBI:66593] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   organic polycyclic compound [CHEBI:51958] (1654)   tetracyclic triterpenoid [CHEBI:26893] (37)   lucialdehyde B [CHEBI:66593] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic polycyclic compound [CHEBI:51958] (1654)   tetracyclic triterpenoid [CHEBI:26893] (37)   lucialdehyde B [CHEBI:66593] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic polycyclic compound [CHEBI:51958] (1654)   tetracyclic triterpenoid [CHEBI:26893] (37)   lucialdehyde B [CHEBI:66593] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   terpene ketone [CHEBI:26872] (39)   cyclic terpene ketone [CHEBI:36130] (33)   lucialdehyde B [CHEBI:66593] (1)  cyclic ketone [CHEBI:3992] (644)   alicyclic ketone [CHEBI:36132] (68)   cyclic terpene ketone [CHEBI:36130] (33)   lucialdehyde B [CHEBI:66593] (1)  aldehyde [CHEBI:17478] (258)   lucialdehyde B [CHEBI:66593] (1) ChEBI Compound Accession Identifier:   [CHEBI:66593] ChEBI Compound Description:   A tetracyclic triterpenoid that is lanosta-8,24-dien-26-al substituted by oxo groups at positions 3 and 7. Isolated from Ganoderma lucidum and Ganoderma pfeifferi, it exhibits antiviral and cytotoxic activities. ChEBI Compound Identification Number:   66593 ChEBI InChI Value:   InChI=1S/C30H44O3/c1-19(18-31)9-8-10-20(2)21-11-16-30(7)26-22(12-15-29(21,30)6)28(5)14-13-25(33)27(3,4)24(28)17-23(26)32/h9,18,20-21,24H,8,10-17H2,1-7H3/b19-9+/t20-,21-,24+,28-,29-,30+/m1/s1 ChEBI InChIKey Value:   KZOBOICRKKYGAQ-GOUGDUPLSA-N ChEBI Compound Name:   lucialdehyde B ChEBI SMILES Value:   [H][C@@]1(CC[C@@]2(C)C3=C(CC[C@]12C)[C@@]1(C)CCC(=O)C(C)(C)[C@]1([H])CC3=O)[C@H](C)CC\C=C(/C)C=O ChEBI Substance ID:   160710131 ChEBI URL:   ChEBI:66593 ChemSpider ID:   8519327 Ontomatica Chemical Accession Key (OnChAKey):   KZOBOICRKKYGAQ_GOUGDUPLSA_N_000_000000 PubChem Compound ID:   10343868