New Search

Item 1 of 1 (back to results)

luzonial B
An iridoid monoterpenoid that is hexahydro-1H-cyclopenta[c]furan substituted by hydroxy groups at positions 1 and 3a, a 3-oxopropen-2yl group at position 6 and a cis-4-coumaroyloxy moiety at position 4 (the 1S,3aS,4S,6S,6aS stereoisomer). Isolated from the leaves of Viburnum luzonicum, it exhibits antineoplastic activity.


Current search:

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 biochemical uses [CHEBI:52206] (3306) 
 metabolite [CHEBI:25212] (2692) 
 secondary metabolite [CHEBI:26619] (2225) 
 luzonial B [CHEBI:66599] (1)
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 antineoplastic agent [CHEBI:35610] (760) 
 luzonial B [CHEBI:66599] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 tertiary alcohol [CHEBI:26878] (183) 
 luzonial B [CHEBI:66599] (1)
 secondary alcohol [CHEBI:35681] (342) 
 luzonial B [CHEBI:66599] (1)
 phenols [CHEBI:33853] (868) 
 luzonial B [CHEBI:66599] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 tertiary alcohol [CHEBI:26878] (183) 
 luzonial B [CHEBI:66599] (1)
 secondary alcohol [CHEBI:35681] (342) 
 luzonial B [CHEBI:66599] (1)
 phenols [CHEBI:33853] (868) 
 luzonial B [CHEBI:66599] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 cyclic ether [CHEBI:37407] (314) 
 luzonial B [CHEBI:66599] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 aldehyde [CHEBI:17478] (258) 
 luzonial B [CHEBI:66599] (1)
 carboxylic ester [CHEBI:33308] (1495) 
 alpha,beta-unsaturated carboxylic ester [CHEBI:51737] (68) 
 enoate ester [CHEBI:51702] (65) 
 cinnamate ester [CHEBI:36087] (36) 
 luzonial B [CHEBI:66599] (1)
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 luzonial B [CHEBI:66599] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 cyclic ether [CHEBI:37407] (314) 
 luzonial B [CHEBI:66599] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 aldehyde [CHEBI:17478] (258) 
 luzonial B [CHEBI:66599] (1)
 carboxylic ester [CHEBI:33308] (1495) 
 alpha,beta-unsaturated carboxylic ester [CHEBI:51737] (68) 
 enoate ester [CHEBI:51702] (65) 
 cinnamate ester [CHEBI:36087] (36) 
 luzonial B [CHEBI:66599] (1)
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 luzonial B [CHEBI:66599] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 lipid [CHEBI:18059] (3532) 
 isoprenoid [CHEBI:24913] (1402) 
 terpenoid [CHEBI:26873] (1099) 
 monoterpenoid [CHEBI:25409] (157) 
 iridoid monoterpenoid [CHEBI:50563] (6) 
 luzonial B [CHEBI:66599] (1)
 isoprenoid [CHEBI:24913] (1402) 
 terpenoid [CHEBI:26873] (1099) 
 monoterpenoid [CHEBI:25409] (157) 
 iridoid monoterpenoid [CHEBI:50563] (6) 
 luzonial B [CHEBI:66599] (1)
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 luzonial B [CHEBI:66599] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 luzonial B [CHEBI:66599] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 cyclic ether [CHEBI:37407] (314) 
 luzonial B [CHEBI:66599] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 aldehyde [CHEBI:17478] (258) 
 luzonial B [CHEBI:66599] (1)
 carboxylic ester [CHEBI:33308] (1495) 
 alpha,beta-unsaturated carboxylic ester [CHEBI:51737] (68) 
 enoate ester [CHEBI:51702] (65) 
 cinnamate ester [CHEBI:36087] (36) 
 luzonial B [CHEBI:66599] (1)
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 luzonial B [CHEBI:66599] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 tertiary alcohol [CHEBI:26878] (183) 
 luzonial B [CHEBI:66599] (1)
 secondary alcohol [CHEBI:35681] (342) 
 luzonial B [CHEBI:66599] (1)
 phenols [CHEBI:33853] (868) 
 luzonial B [CHEBI:66599] (1)
 ester [CHEBI:35701] (3370) 
 carboxylic ester [CHEBI:33308] (1495) 
 alpha,beta-unsaturated carboxylic ester [CHEBI:51737] (68) 
 enoate ester [CHEBI:51702] (65) 
 cinnamate ester [CHEBI:36087] (36) 
 luzonial B [CHEBI:66599] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 luzonial B [CHEBI:66599] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 luzonial B [CHEBI:66599] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 phenylpropanoid [CHEBI:26004] (374) 
 cinnamate ester [CHEBI:36087] (36) 
 luzonial B [CHEBI:66599] (1)
 phenols [CHEBI:33853] (868) 
 luzonial B [CHEBI:66599] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 aldehyde [CHEBI:17478] (258) 
 luzonial B [CHEBI:66599] (1)
 carboxylic ester [CHEBI:33308] (1495) 
 alpha,beta-unsaturated carboxylic ester [CHEBI:51737] (68) 
 enoate ester [CHEBI:51702] (65) 
 cinnamate ester [CHEBI:36087] (36) 
 luzonial B [CHEBI:66599] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 luzonial B [CHEBI:66599] (1)
 bicyclic compound [CHEBI:33636] (1511) 
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 luzonial B [CHEBI:66599] (1)
 aromatic compound [CHEBI:33655] (3799) 
 organic aromatic compound [CHEBI:33659] (3593) 
 phenylpropanoid [CHEBI:26004] (374) 
 cinnamate ester [CHEBI:36087] (36) 
 luzonial B [CHEBI:66599] (1)
 phenols [CHEBI:33853] (868) 
 luzonial B [CHEBI:66599] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 luzonial B [CHEBI:66599] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 luzonial B [CHEBI:66599] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 phenylpropanoid [CHEBI:26004] (374) 
 cinnamate ester [CHEBI:36087] (36) 
 luzonial B [CHEBI:66599] (1)
 phenols [CHEBI:33853] (868) 
 luzonial B [CHEBI:66599] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 luzonial B [CHEBI:66599] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 luzonial B [CHEBI:66599] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 luzonial B [CHEBI:66599] (1)
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 luzonial B [CHEBI:66599] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 luzonial B [CHEBI:66599] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 luzonial B [CHEBI:66599] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 phenylpropanoid [CHEBI:26004] (374) 
 cinnamate ester [CHEBI:36087] (36) 
 luzonial B [CHEBI:66599] (1)
 phenols [CHEBI:33853] (868) 
 luzonial B [CHEBI:66599] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 aldehyde [CHEBI:17478] (258) 
 luzonial B [CHEBI:66599] (1)
 carboxylic ester [CHEBI:33308] (1495) 
 alpha,beta-unsaturated carboxylic ester [CHEBI:51737] (68) 
 enoate ester [CHEBI:51702] (65) 
 cinnamate ester [CHEBI:36087] (36) 
 luzonial B [CHEBI:66599] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 tertiary alcohol [CHEBI:26878] (183) 
 luzonial B [CHEBI:66599] (1)
 secondary alcohol [CHEBI:35681] (342) 
 luzonial B [CHEBI:66599] (1)
 phenols [CHEBI:33853] (868) 
 luzonial B [CHEBI:66599] (1)
ChEBI Compound Accession Identifier  [CHEBI:66599]
ChEBI Compound Description  An iridoid monoterpenoid that is hexahydro-1H-cyclopenta[c]furan substituted by hydroxy groups at positions 1 and 3a, a 3-oxopropen-2yl group at position 6 and a cis-4-coumaroyloxy moiety at position 4 (the 1S,3aS,4S,6S,6aS stereoisomer). Isolated from the leaves of Viburnum luzonicum, it exhibits antineoplastic activity.
ChEBI Compound Identification Number  66599
ChEBI InChI Value  InChI=1S/C19H20O7/c1-11(9-20)14-8-15(19(24)10-25-18(23)17(14)19)26-16(22)7-4-12-2-5-13(21)6-3-12/h2-7,9,14-15,17-18,21,23-24H,1,8,10H2/b7-4-/t14-,15+,17-,18+,19+/m1/s1
ChEBI InChIKey Value  HJTBDPQCVMXWMZ-FESMDYCJSA-N
ChEBI Compound Name  luzonial B
ChEBI SMILES Value  [H][C@@]12[C@@H](O)OC[C@]1(O)[C@H](C[C@@H]2C(=C)C=O)OC(=O)\C=C/c1ccc(O)cc1
ChEBI Substance ID  160710335
ChEBI URL  ChEBI:66599
ChemSpider ID  NS
Ontomatica Chemical Accession Key (OnChAKey)  HJTBDPQCVMXWMZ_FESMDYCJSA_N_000_000000
PubChem Compound ID  9548910