Item 1 of 1 (back to results) marineosin B A macrocycle isolated from a marine sediment-derived actinomycete, Streptomyces sp. A stereoisomer of marineosin A, it exhibits cytotoxicity against colon tumour cell lines.

Current search: 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > antineoplastic agent [CHEBI:35610] > marineosin B [CHEBI:66677] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   marineosin B [CHEBI:66677] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   antineoplastic agent [CHEBI:35610] (760)   marineosin B [CHEBI:66677] (1) 06. Name of Biological Source of Chemical  06. Name of Biological Source of Chemical  Archaea, Cyanobacteria and Bacteria (302)   Eubacteria (239)   Firmicutes (214)   Actinobacteria (204)   Actinobacteridae (204)   Actinomycetales (204)   Streptomycetaceae (160)   Streptomyces (157) 07. Part of Biological Source of Chemical  07. Part of Biological Source of Chemical  unspecified structure [PO:0000004] (703) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydrides [CHEBI:33692] (1374)   organic hydride [CHEBI:37175] (1178)   organic fundamental parent [CHEBI:33245] (1178)   heterocyclic organic fundamental parent [CHEBI:35552] (537)   mancude organic heterocyclic parent [CHEBI:35571] (481)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   marineosin B [CHEBI:66677] (1)  organic mancude parent [CHEBI:35573] (488)   mancude organic heterocyclic parent [CHEBI:35571] (481)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   marineosin B [CHEBI:66677] (1)  p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azaspiro compound [CHEBI:35624] (22)   marineosin B [CHEBI:66677] (1)  azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   marineosin B [CHEBI:66677] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   marineosin B [CHEBI:66677] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   marineosin B [CHEBI:66677] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   organic fundamental parent [CHEBI:33245] (1178)   heterocyclic organic fundamental parent [CHEBI:35552] (537)   mancude organic heterocyclic parent [CHEBI:35571] (481)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   marineosin B [CHEBI:66677] (1)  organic mancude parent [CHEBI:35573] (488)   mancude organic heterocyclic parent [CHEBI:35571] (481)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   marineosin B [CHEBI:66677] (1)  heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   marineosin B [CHEBI:66677] (1)  heteroarene [CHEBI:33833] (1648)   monocyclic heteroarene [CHEBI:38179] (375)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   marineosin B [CHEBI:66677] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azaspiro compound [CHEBI:35624] (22)   marineosin B [CHEBI:66677] (1)  azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   marineosin B [CHEBI:66677] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azaspiro compound [CHEBI:35624] (22)   marineosin B [CHEBI:66677] (1)  azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   marineosin B [CHEBI:66677] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   marineosin B [CHEBI:66677] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   marineosin B [CHEBI:66677] (1)  heteroarene [CHEBI:33833] (1648)   monocyclic heteroarene [CHEBI:38179] (375)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   marineosin B [CHEBI:66677] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azaspiro compound [CHEBI:35624] (22)   marineosin B [CHEBI:66677] (1)  azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   marineosin B [CHEBI:66677] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   monocyclic heteroarene [CHEBI:38179] (375)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   marineosin B [CHEBI:66677] (1)  mancude ring [CHEBI:35568] (488)   organic mancude parent [CHEBI:35573] (488)   mancude organic heterocyclic parent [CHEBI:35571] (481)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   marineosin B [CHEBI:66677] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   spiro compound [CHEBI:33599] (78)   azaspiro compound [CHEBI:35624] (22)   marineosin B [CHEBI:66677] (1)  oxaspiro compound [CHEBI:37948] (63)   marineosin B [CHEBI:66677] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   monocyclic heteroarene [CHEBI:38179] (375)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   marineosin B [CHEBI:66677] (1)  monocyclic compound [CHEBI:33661] (2007)   heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   marineosin B [CHEBI:66677] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   marineosin B [CHEBI:66677] (1)  heteroarene [CHEBI:33833] (1648)   monocyclic heteroarene [CHEBI:38179] (375)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   marineosin B [CHEBI:66677] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azaspiro compound [CHEBI:35624] (22)   marineosin B [CHEBI:66677] (1)  azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   marineosin B [CHEBI:66677] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   monocyclic heteroarene [CHEBI:38179] (375)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   marineosin B [CHEBI:66677] (1)  macrocycle [CHEBI:51026] (234)   marineosin B [CHEBI:66677] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   marineosin B [CHEBI:66677] (1)  heteroarene [CHEBI:33833] (1648)   monocyclic heteroarene [CHEBI:38179] (375)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   marineosin B [CHEBI:66677] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azaspiro compound [CHEBI:35624] (22)   marineosin B [CHEBI:66677] (1)  azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   marineosin B [CHEBI:66677] (1)  heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   marineosin B [CHEBI:66677] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   marineosin B [CHEBI:66677] (1)  heteroarene [CHEBI:33833] (1648)   monocyclic heteroarene [CHEBI:38179] (375)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   marineosin B [CHEBI:66677] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azaspiro compound [CHEBI:35624] (22)   marineosin B [CHEBI:66677] (1)  azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   marineosin B [CHEBI:66677] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   monocyclic heteroarene [CHEBI:38179] (375)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   marineosin B [CHEBI:66677] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydrides [CHEBI:33692] (1374)   organic hydride [CHEBI:37175] (1178)   organic fundamental parent [CHEBI:33245] (1178)   heterocyclic organic fundamental parent [CHEBI:35552] (537)   mancude organic heterocyclic parent [CHEBI:35571] (481)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   marineosin B [CHEBI:66677] (1)  organic mancude parent [CHEBI:35573] (488)   mancude organic heterocyclic parent [CHEBI:35571] (481)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   marineosin B [CHEBI:66677] (1) ChEBI Compound Accession Identifier:   [CHEBI:66677] ChEBI Compound Description:   A macrocycle isolated from a marine sediment-derived actinomycete, Streptomyces sp. A stereoisomer of marineosin A, it exhibits cytotoxicity against colon tumour cell lines. ChEBI Compound Identification Number:   66677 ChEBI InChI Value:   InChI=1S/C25H35N3O2/c1-17-15-18-9-6-4-3-5-7-10-19-12-13-21(27-19)24(18)25(30-17)23(29-2)16-22(28-25)20-11-8-14-26-20/h8,11-14,17-18,23-24,26-27H,3-7,9-10,15-16H2,1-2H3/t17-,18-,23-,24-,25+/m0/s1 ChEBI InChIKey Value:   JPTGQNMDWMSVSF-XOLQFJJLSA-N ChEBI Compound Name:   marineosin B ChEBI SMILES Value:   [H][C@@]12CCCCCCCc3ccc([nH]3)[C@@]1([H])[C@@]1(O[C@@H](C)C2)N=C(C[C@@H]1OC)c1ccc[nH]1 ChEBI Substance ID:   160645651 ChEBI URL:   ChEBI:66677 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   JPTGQNMDWMSVSF_XOLQFJJLSA_N_000_000000 PubChem Compound ID:   25170361