New Search

Item 1 of 1 (back to results)

vismodegib
A benzamide obtained by formal condensation between the carboxy group of 2-chloro-4-(methylsulfonyl)benzoic acid and the anilino group of 4-chloro-3-(pyridin-2-yl)aniline. Used for the treatment metastatic basal cell carcinoma.


Current search:

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 pharmacological uses [CHEBI:52210] (736) 
 antagonist [CHEBI:48706] (126) 
 SMO receptor antagonist [CHEBI:66908] (1) 
 vismodegib [CHEBI:66903] (1)
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 antineoplastic agent [CHEBI:35610] (760) 
 vismodegib [CHEBI:66903] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 halogen molecular entity [CHEBI:24471] (1475) 
 chlorine molecular entity [CHEBI:23117] (884) 
 organochlorine compound [CHEBI:36683] (543) 
 vismodegib [CHEBI:66903] (1)
 halide [CHEBI:37578] (1402) 
 organohalogen compound [CHEBI:36684] (976) 
 organochlorine compound [CHEBI:36683] (543) 
 vismodegib [CHEBI:66903] (1)
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 amide [CHEBI:32988] (1863) 
 primary amide [CHEBI:33256] (1586) 
 carboxamide [CHEBI:37622] (1381) 
 monocarboxylic acid amide [CHEBI:29347] (257) 
 arenecarboxamide [CHEBI:22645] (45) 
 benzamides [CHEBI:22702] (45) 
 vismodegib [CHEBI:66903] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 carboxamide [CHEBI:37622] (1381) 
 monocarboxylic acid amide [CHEBI:29347] (257) 
 arenecarboxamide [CHEBI:22645] (45) 
 benzamides [CHEBI:22702] (45) 
 vismodegib [CHEBI:66903] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyridines [CHEBI:26421] (254) 
 vismodegib [CHEBI:66903] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 organooxygen compound [CHEBI:36963] (11352) 
 carboxamide [CHEBI:37622] (1381) 
 monocarboxylic acid amide [CHEBI:29347] (257) 
 arenecarboxamide [CHEBI:22645] (45) 
 benzamides [CHEBI:22702] (45) 
 vismodegib [CHEBI:66903] (1)
 sulfur molecular entity [CHEBI:26835] (1541) 
 organosulfur compound [CHEBI:33261] (1005) 
 sulfone [CHEBI:35850] (29) 
 vismodegib [CHEBI:66903] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organosulfur compound [CHEBI:33261] (1005) 
 sulfone [CHEBI:35850] (29) 
 vismodegib [CHEBI:66903] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 carboxamide [CHEBI:37622] (1381) 
 monocarboxylic acid amide [CHEBI:29347] (257) 
 arenecarboxamide [CHEBI:22645] (45) 
 benzamides [CHEBI:22702] (45) 
 vismodegib [CHEBI:66903] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 vismodegib [CHEBI:66903] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyridines [CHEBI:26421] (254) 
 vismodegib [CHEBI:66903] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 carboxamide [CHEBI:37622] (1381) 
 monocarboxylic acid amide [CHEBI:29347] (257) 
 arenecarboxamide [CHEBI:22645] (45) 
 benzamides [CHEBI:22702] (45) 
 vismodegib [CHEBI:66903] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyridines [CHEBI:26421] (254) 
 vismodegib [CHEBI:66903] (1)
 organohalogen compound [CHEBI:36684] (976) 
 organochlorine compound [CHEBI:36683] (543) 
 vismodegib [CHEBI:66903] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organosulfur compound [CHEBI:33261] (1005) 
 sulfone [CHEBI:35850] (29) 
 vismodegib [CHEBI:66903] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 carboxamide [CHEBI:37622] (1381) 
 monocarboxylic acid amide [CHEBI:29347] (257) 
 arenecarboxamide [CHEBI:22645] (45) 
 benzamides [CHEBI:22702] (45) 
 vismodegib [CHEBI:66903] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 vismodegib [CHEBI:66903] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyridines [CHEBI:26421] (254) 
 vismodegib [CHEBI:66903] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 monocyclic compound [CHEBI:33661] (2007) 
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 vismodegib [CHEBI:66903] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 vismodegib [CHEBI:66903] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyridines [CHEBI:26421] (254) 
 vismodegib [CHEBI:66903] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 vismodegib [CHEBI:66903] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyridines [CHEBI:26421] (254) 
 vismodegib [CHEBI:66903] (1)
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 vismodegib [CHEBI:66903] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 vismodegib [CHEBI:66903] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyridines [CHEBI:26421] (254) 
 vismodegib [CHEBI:66903] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 halide [CHEBI:37578] (1402) 
 organohalogen compound [CHEBI:36684] (976) 
 organochlorine compound [CHEBI:36683] (543) 
 vismodegib [CHEBI:66903] (1)
ChEBI Compound Accession Identifier  [CHEBI:66903]
ChEBI Compound Description  A benzamide obtained by formal condensation between the carboxy group of 2-chloro-4-(methylsulfonyl)benzoic acid and the anilino group of 4-chloro-3-(pyridin-2-yl)aniline. Used for the treatment metastatic basal cell carcinoma.
ChEBI Compound Identification Number  66903
ChEBI InChI Value  InChI=1S/C19H14Cl2N2O3S/c1-27(25,26)13-6-7-14(17(21)11-13)19(24)23-12-5-8-16(20)15(10-12)18-4-2-3-9-22-18/h2-11H,1H3,(H,23,24)
ChEBI InChIKey Value  BPQMGSKTAYIVFO-UHFFFAOYSA-N
ChEBI Compound Name  vismodegib
ChEBI SMILES Value  CS(=O)(=O)c1ccc(C(=O)Nc2ccc(Cl)c(c2)-c2ccccn2)c(Cl)c1
ChEBI Substance ID  160645549
ChEBI URL  ChEBI:66903
ChemSpider ID  23337846
Ontomatica Chemical Accession Key (OnChAKey)  BPQMGSKTAYIVFO_UHFFFAOYSA_N_000_000000
PubChem Compound ID  24776445