Item 1 of 1 (back to results) PK-11195 A carboxamide obtained by formal condensation of the carboxy group of 1-(2-chlorophenyl)isoquinoline-3-carboxylic acid with the amino group of sec-butylmethylamine

Current search: 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > antineoplastic agent [CHEBI:35610] > PK-11195 [CHEBI:73290] × Select any link to see items in a related category. more general categories    information about this item 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   antineoplastic agent [CHEBI:35610] (760)   PK-11195 [CHEBI:73290] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   halogen molecular entity [CHEBI:24471] (1475)   chlorine molecular entity [CHEBI:23117] (884)   organochlorine compound [CHEBI:36683] (543)   PK-11195 [CHEBI:73290] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   PK-11195 [CHEBI:73290] (1)  pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   amide [CHEBI:32988] (1863)   primary amide [CHEBI:33256] (1586)   carboxamide [CHEBI:37622] (1381)   PK-11195 [CHEBI:73290] (1)  organonitrogen compound [CHEBI:35352] (6705)   carboxamide [CHEBI:37622] (1381)   PK-11195 [CHEBI:73290] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   isoquinolines [CHEBI:24922] (86)   PK-11195 [CHEBI:73290] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   carboxamide [CHEBI:37622] (1381)   PK-11195 [CHEBI:73290] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carboxamide [CHEBI:37622] (1381)   PK-11195 [CHEBI:73290] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   isoquinolines [CHEBI:24922] (86)   PK-11195 [CHEBI:73290] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   isoquinolines [CHEBI:24922] (86)   PK-11195 [CHEBI:73290] (1)  organonitrogen compound [CHEBI:35352] (6705)   carboxamide [CHEBI:37622] (1381)   PK-11195 [CHEBI:73290] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   isoquinolines [CHEBI:24922] (86)   PK-11195 [CHEBI:73290] (1)  organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   PK-11195 [CHEBI:73290] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carboxamide [CHEBI:37622] (1381)   PK-11195 [CHEBI:73290] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   isoquinolines [CHEBI:24922] (86)   PK-11195 [CHEBI:73290] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   isoquinolines [CHEBI:24922] (86)   PK-11195 [CHEBI:73290] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   isoquinolines [CHEBI:24922] (86)   PK-11195 [CHEBI:73290] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   isoquinolines [CHEBI:24922] (86)   PK-11195 [CHEBI:73290] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   isoquinolines [CHEBI:24922] (86)   PK-11195 [CHEBI:73290] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   isoquinolines [CHEBI:24922] (86)   PK-11195 [CHEBI:73290] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   isoquinolines [CHEBI:24922] (86)   PK-11195 [CHEBI:73290] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   isoquinolines [CHEBI:24922] (86)   PK-11195 [CHEBI:73290] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   isoquinolines [CHEBI:24922] (86)   PK-11195 [CHEBI:73290] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   isoquinolines [CHEBI:24922] (86)   PK-11195 [CHEBI:73290] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   PK-11195 [CHEBI:73290] (1) ChEBI Compound Accession Identifier:   [CHEBI:73290] ChEBI Compound Description:   A carboxamide obtained by formal condensation of the carboxy group of 1-(2-chlorophenyl)isoquinoline-3-carboxylic acid with the amino group of sec-butylmethylamine ChEBI Compound Identification Number:   73290 ChEBI InChI Value:   InChI=1S/C21H21ClN2O/c1-4-14(2)24(3)21(25)19-13-15-9-5-6-10-16(15)20(23-19)17-11-7-8-12-18(17)22/h5-14H,4H2,1-3H3 ChEBI InChIKey Value:   RAVIZVQZGXBOQO-UHFFFAOYSA-N ChEBI Compound Name:   PK-11195 ChEBI SMILES Value:   CCC(C)N(C)C(=O)c1cc2ccccc2c(n1)-c1ccccc1Cl ChEBI Substance ID:   162169314 ChEBI URL:   ChEBI:73290 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   RAVIZVQZGXBOQO_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   1345