Select any link to see items in a related category.

more general categories	information about this item
03. Biological Effects of Specific Chemicals	03. Biological Effects of Specific Chemicals
pharmacological uses [CHEBI:52210] (736)
antagonist [CHEBI:48706] (126)
hormone antagonist [CHEBI:49020] (52)
endothelin receptor antagonist [CHEBI:51451] (3)	bosentan [CHEBI:51450] (1)
05. Industrial Uses	05. Industrial Uses
pharmaceutical [CHEBI:52217] (1978)
drug [CHEBI:23888] (1930)
antihypertensive agent [CHEBI:35674] (104)	bosentan [CHEBI:51450] (1)
08. Chemical Category	08. Chemical Category
main group molecular entity [CHEBI:33579] (25650)
s-block molecular entity [CHEBI:33674] (7287)
hydrogen molecular entity [CHEBI:33608] (6932)
hydroxides [CHEBI:24651] (5641)
organic hydroxy compound [CHEBI:33822] (3050)
alcohol [CHEBI:30879] (1371)
primary alcohol [CHEBI:15734] (167)	bosentan [CHEBI:51450] (1)
p-block molecular entity [CHEBI:33675] (25343)
pnictogen molecular entity [CHEBI:33302] (10027)
nitrogen molecular entity [CHEBI:51143] (7930)
amide [CHEBI:32988] (1863)
primary amide [CHEBI:33256] (1586)
sulfonamide [CHEBI:35358] (106)	bosentan [CHEBI:51450] (1)
organonitrogen compound [CHEBI:35352] (6705)
organonitrogen heterocyclic compound [CHEBI:38101] (3202)
diazines [CHEBI:38313] (288)
pyrimidines [CHEBI:39447] (260)	bosentan [CHEBI:51450] (1)
chalcogen molecular entity [CHEBI:33304] (15225)
oxygen molecular entity [CHEBI:25806] (14414)
hydroxides [CHEBI:24651] (5641)
organic hydroxy compound [CHEBI:33822] (3050)
alcohol [CHEBI:30879] (1371)
primary alcohol [CHEBI:15734] (167)	bosentan [CHEBI:51450] (1)
sulfur molecular entity [CHEBI:26835] (1541)
sulfur oxoacid derivative [CHEBI:33424] (628)
sulfonic acid derivative [CHEBI:33552] (393)
sulfonamide [CHEBI:35358] (106)	bosentan [CHEBI:51450] (1)
carbon group molecular entity [CHEBI:33582] (23847)
organic molecular entity [CHEBI:50860] (23769)
heteroorganic entity [CHEBI:33285] (15197)
organic heterocyclic compound [CHEBI:24532] (5243)
organic heteromonocyclic compound [CHEBI:25693] (2004)
diazines [CHEBI:38313] (288)
pyrimidines [CHEBI:39447] (260)	bosentan [CHEBI:51450] (1)
organonitrogen heterocyclic compound [CHEBI:38101] (3202)
diazines [CHEBI:38313] (288)
pyrimidines [CHEBI:39447] (260)	bosentan [CHEBI:51450] (1)
organonitrogen compound [CHEBI:35352] (6705)
organonitrogen heterocyclic compound [CHEBI:38101] (3202)
diazines [CHEBI:38313] (288)
pyrimidines [CHEBI:39447] (260)	bosentan [CHEBI:51450] (1)
organic hydroxy compound [CHEBI:33822] (3050)
alcohol [CHEBI:30879] (1371)
primary alcohol [CHEBI:15734] (167)	bosentan [CHEBI:51450] (1)
organic molecule [CHEBI:72695] (11399)
organic cyclic compound [CHEBI:33832] (7633)
organic heterocyclic compound [CHEBI:24532] (5243)
organic heteromonocyclic compound [CHEBI:25693] (2004)
diazines [CHEBI:38313] (288)
pyrimidines [CHEBI:39447] (260)	bosentan [CHEBI:51450] (1)
organonitrogen heterocyclic compound [CHEBI:38101] (3202)
diazines [CHEBI:38313] (288)
pyrimidines [CHEBI:39447] (260)	bosentan [CHEBI:51450] (1)
polyatomic entity [CHEBI:36357] (18777)
molecule [CHEBI:25367] (11520)
cyclic compound [CHEBI:33595] (7817)
monocyclic compound [CHEBI:33661] (2007)
heteromonocyclic compound [CHEBI:33670] (2004)
organic heteromonocyclic compound [CHEBI:25693] (2004)
diazines [CHEBI:38313] (288)
pyrimidines [CHEBI:39447] (260)	bosentan [CHEBI:51450] (1)
organic cyclic compound [CHEBI:33832] (7633)
organic heterocyclic compound [CHEBI:24532] (5243)
organic heteromonocyclic compound [CHEBI:25693] (2004)
diazines [CHEBI:38313] (288)
pyrimidines [CHEBI:39447] (260)	bosentan [CHEBI:51450] (1)
organonitrogen heterocyclic compound [CHEBI:38101] (3202)
diazines [CHEBI:38313] (288)
pyrimidines [CHEBI:39447] (260)	bosentan [CHEBI:51450] (1)
heterocyclic compound [CHEBI:5686] (5275)
organic heterocyclic compound [CHEBI:24532] (5243)
organic heteromonocyclic compound [CHEBI:25693] (2004)
diazines [CHEBI:38313] (288)
pyrimidines [CHEBI:39447] (260)	bosentan [CHEBI:51450] (1)
organonitrogen heterocyclic compound [CHEBI:38101] (3202)
diazines [CHEBI:38313] (288)
pyrimidines [CHEBI:39447] (260)	bosentan [CHEBI:51450] (1)
heteromonocyclic compound [CHEBI:33670] (2004)
organic heteromonocyclic compound [CHEBI:25693] (2004)
diazines [CHEBI:38313] (288)
pyrimidines [CHEBI:39447] (260)	bosentan [CHEBI:51450] (1)
organic molecule [CHEBI:72695] (11399)
organic cyclic compound [CHEBI:33832] (7633)
organic heterocyclic compound [CHEBI:24532] (5243)
organic heteromonocyclic compound [CHEBI:25693] (2004)
diazines [CHEBI:38313] (288)
pyrimidines [CHEBI:39447] (260)	bosentan [CHEBI:51450] (1)
organonitrogen heterocyclic compound [CHEBI:38101] (3202)
diazines [CHEBI:38313] (288)
pyrimidines [CHEBI:39447] (260)	bosentan [CHEBI:51450] (1)
heteroatomic molecular entity [CHEBI:37577] (13672)
hydroxides [CHEBI:24651] (5641)
organic hydroxy compound [CHEBI:33822] (3050)
alcohol [CHEBI:30879] (1371)
primary alcohol [CHEBI:15734] (167)	bosentan [CHEBI:51450] (1)
oxoacid derivative [CHEBI:33241] (3254)
sulfur oxoacid derivative [CHEBI:33424] (628)
sulfonic acid derivative [CHEBI:33552] (393)
sulfonamide [CHEBI:35358] (106)	bosentan [CHEBI:51450] (1)
ChEBI Compound Accession Identifier:	[CHEBI:51450]
ChEBI Compound Description:	null
ChEBI Compound Identification Number:	51450
ChEBI InChI Value:	InChI=1S/C27H29N5O6S/c1-27(2,3)18-10-12-19(13-11-18)39(34,35)32-23-22(38-21-9-6-5-8-20(21)36-4)26(37-17-16-33)31-25(30-23)24-28-14-7-15-29-24/h5-15,33H,16-17H2,1-4H3,(H,30,31,32)
ChEBI InChIKey Value:	GJPICJJJRGTNOD-UHFFFAOYSA-N
ChEBI Compound Name:	bosentan
ChEBI SMILES Value:	COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(cc2)C(C)(C)C)nc(nc1OCCO)-c1ncccn1
ChEBI Substance ID:	56464382
ChEBI URL:	ChEBI:51450
ChemSpider ID:	94651
Ontomatica Chemical Accession Key (OnChAKey):	GJPICJJJRGTNOD_UHFFFAOYSA_N_000_000000
PubChem Compound ID:	104865