Item 1 of 1 (back to results) aliskiren A monomethoxybenzene compound having a 3-methoxypropoxy group at the 2-position and a multi-substituted branched alkyl substituent at the 4-position.

Current search: 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > antihypertensive agent [CHEBI:35674] > aliskiren [CHEBI:601027] × Select any link to see items in a related category. more general categories    information about this item 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   antihypertensive agent [CHEBI:35674] (104)   aliskiren [CHEBI:601027] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   amide [CHEBI:32988] (1863)   primary amide [CHEBI:33256] (1586)   carboxamide [CHEBI:37622] (1381)   aliskiren [CHEBI:601027] (1)  organonitrogen compound [CHEBI:35352] (6705)   carboxamide [CHEBI:37622] (1381)   aliskiren [CHEBI:601027] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   monomethoxybenzene [CHEBI:25235] (32)   aliskiren [CHEBI:601027] (1)  carboxamide [CHEBI:37622] (1381)   aliskiren [CHEBI:601027] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   monomethoxybenzene [CHEBI:25235] (32)   aliskiren [CHEBI:601027] (1)  carboxamide [CHEBI:37622] (1381)   aliskiren [CHEBI:601027] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organonitrogen compound [CHEBI:35352] (6705)   carboxamide [CHEBI:37622] (1381)   aliskiren [CHEBI:601027] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   monomethoxybenzene [CHEBI:25235] (32)   aliskiren [CHEBI:601027] (1)  carboxamide [CHEBI:37622] (1381)   aliskiren [CHEBI:601027] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   monomethoxybenzene [CHEBI:25235] (32)   aliskiren [CHEBI:601027] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   monomethoxybenzene [CHEBI:25235] (32)   aliskiren [CHEBI:601027] (1)  aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   monomethoxybenzene [CHEBI:25235] (32)   aliskiren [CHEBI:601027] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   homocyclic compound [CHEBI:33597] (1134)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   monomethoxybenzene [CHEBI:25235] (32)   aliskiren [CHEBI:601027] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   monomethoxybenzene [CHEBI:25235] (32)   aliskiren [CHEBI:601027] (1)  aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   monomethoxybenzene [CHEBI:25235] (32)   aliskiren [CHEBI:601027] (1)  organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   monomethoxybenzene [CHEBI:25235] (32)   aliskiren [CHEBI:601027] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   monomethoxybenzene [CHEBI:25235] (32)   aliskiren [CHEBI:601027] (1)  aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   monomethoxybenzene [CHEBI:25235] (32)   aliskiren [CHEBI:601027] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   monomethoxybenzene [CHEBI:25235] (32)   aliskiren [CHEBI:601027] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   monomethoxybenzene [CHEBI:25235] (32)   aliskiren [CHEBI:601027] (1)  aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   monomethoxybenzene [CHEBI:25235] (32)   aliskiren [CHEBI:601027] (1) ChEBI Compound Accession Identifier:   [CHEBI:601027] ChEBI Compound Description:   A monomethoxybenzene compound having a 3-methoxypropoxy group at the 2-position and a multi-substituted branched alkyl substituent at the 4-position. ChEBI Compound Identification Number:   601027 ChEBI InChI Value:   InChI=1S/C30H53N3O6/c1-19(2)22(14-21-10-11-26(38-8)27(15-21)39-13-9-12-37-7)16-24(31)25(34)17-23(20(3)4)28(35)33-18-30(5,6)29(32)36/h10-11,15,19-20,22-25,34H,9,12-14,16-18,31H2,1-8H3,(H2,32,36)(H,33,35)/t22-,23-,24-,25-/m0/s1 ChEBI InChIKey Value:   UXOWGYHJODZGMF-QORCZRPOSA-N ChEBI Compound Name:   aliskiren ChEBI SMILES Value:   COCCCOc1cc(C[C@@H](C[C@H](N)[C@@H](O)C[C@@H](C(C)C)C(=O)NCC(C)(C)C(N)=O)C(C)C)ccc1OC ChEBI Substance ID:   87324641 ChEBI URL:   ChEBI:601027 ChemSpider ID:   4591452 Ontomatica Chemical Accession Key (OnChAKey):   UXOWGYHJODZGMF_QORCZRPOSA_N_000_000000 PubChem Compound ID:   5493444