Item 1 of 1 (back to results) (2R,3S,2'R)-nadolol An aromatic ether, being the (2R)-3-(tert-butylamino)-2-hydroxypropyl ether of the phenolic hydroxy group of (6R,7S)-5,6,7,8-tetrahydronaphthalene-1,6,7-triol.

Current search: 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > antihypertensive agent [CHEBI:35674] > (2R,3S,2'R)-nadolol [CHEBI:60917] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  pharmacological uses [CHEBI:52210] (736)   neurotransmitter agent [CHEBI:35942] (471)   adrenergic agent [CHEBI:37962] (143)   adrenergic antagonist [CHEBI:37887] (75)   beta-adrenergic antagonist [CHEBI:35530] (33)   (2R,3S,2'R)-nadolol [CHEBI:60917] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   antihypertensive agent [CHEBI:35674] (104)   (2R,3S,2'R)-nadolol [CHEBI:60917] (1)  cardiovascular drug [CHEBI:35554] (162)   anti-arrhythmia drug [CHEBI:38070] (56)   (2R,3S,2'R)-nadolol [CHEBI:60917] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   polyol [CHEBI:26191] (437)   triol [CHEBI:27136] (79)   (2R,3S,2'R)-nadolol [CHEBI:60917] (1)  p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organic amino compound [CHEBI:50047] (2472)   secondary amino compound [CHEBI:50995] (110)   (2R,3S,2'R)-nadolol [CHEBI:60917] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   polyol [CHEBI:26191] (437)   triol [CHEBI:27136] (79)   (2R,3S,2'R)-nadolol [CHEBI:60917] (1)  organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   (2R,3S,2'R)-nadolol [CHEBI:60917] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   (2R,3S,2'R)-nadolol [CHEBI:60917] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organonitrogen compound [CHEBI:35352] (6705)   organic amino compound [CHEBI:50047] (2472)   secondary amino compound [CHEBI:50995] (110)   (2R,3S,2'R)-nadolol [CHEBI:60917] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   (2R,3S,2'R)-nadolol [CHEBI:60917] (1)  organic hydroxy compound [CHEBI:33822] (3050)   polyol [CHEBI:26191] (437)   triol [CHEBI:27136] (79)   (2R,3S,2'R)-nadolol [CHEBI:60917] (1)  organic amino compound [CHEBI:50047] (2472)   secondary amino compound [CHEBI:50995] (110)   (2R,3S,2'R)-nadolol [CHEBI:60917] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic aromatic compound [CHEBI:33659] (3593)   aromatic ether [CHEBI:35618] (353)   (2R,3S,2'R)-nadolol [CHEBI:60917] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   aromatic ether [CHEBI:35618] (353)   (2R,3S,2'R)-nadolol [CHEBI:60917] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic aromatic compound [CHEBI:33659] (3593)   aromatic ether [CHEBI:35618] (353)   (2R,3S,2'R)-nadolol [CHEBI:60917] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic aromatic compound [CHEBI:33659] (3593)   aromatic ether [CHEBI:35618] (353)   (2R,3S,2'R)-nadolol [CHEBI:60917] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   polyol [CHEBI:26191] (437)   triol [CHEBI:27136] (79)   (2R,3S,2'R)-nadolol [CHEBI:60917] (1) ChEBI Compound Accession Identifier:   [CHEBI:60917] ChEBI Compound Description:   An aromatic ether, being the (2R)-3-(tert-butylamino)-2-hydroxypropyl ether of the phenolic hydroxy group of (6R,7S)-5,6,7,8-tetrahydronaphthalene-1,6,7-triol. ChEBI Compound Identification Number:   60917 ChEBI InChI Value:   InChI=1S/C17H27NO4/c1-17(2,3)18-9-12(19)10-22-16-6-4-5-11-7-14(20)15(21)8-13(11)16/h4-6,12,14-15,18-21H,7-10H2,1-3H3/t12-,14-,15+/m1/s1 ChEBI InChIKey Value:   VWPOSFSPZNDTMJ-YUELXQCFSA-N ChEBI Compound Name:   (2R,3S,2'R)-nadolol ChEBI SMILES Value:   CC(C)(C)NC[C@@H](O)COc1cccc2C[C@@H](O)[C@@H](O)Cc12 ChEBI Substance ID:   104222507 ChEBI URL:   ChEBI:60917 ChemSpider ID:   5408811 Ontomatica Chemical Accession Key (OnChAKey):   VWPOSFSPZNDTMJ_YUELXQCFSA_N_000_000000 PubChem Compound ID:   7048578