New Search

Item 2 of 51 (back to results)
Previous previous next Next

acetophenazine dimaleate
null


Current search:

Select any link to see items in a related category.

more general categories    information about this item
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 central nervous system drug [CHEBI:35470] (217) 
 psychotropic drug [CHEBI:35471] (130) 
 tranquilizing drug [CHEBI:35473] (83) 
 antipsychotic agent [CHEBI:35476] (51) 
 first generation antipsychotic [CHEBI:65190] (30) 
 phenothiazine antipsychotic drug [CHEBI:37930] (18) 
 acetophenazine dimaleate [CHEBI:2402] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 acetophenazine dimaleate [CHEBI:2402] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 acetophenazine dimaleate [CHEBI:2402] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 acetophenazine dimaleate [CHEBI:2402] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 heterotricyclic compound [CHEBI:36688] (541) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 acetophenazine dimaleate [CHEBI:2402] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 acetophenazine dimaleate [CHEBI:2402] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 acetophenazine dimaleate [CHEBI:2402] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 acetophenazine dimaleate [CHEBI:2402] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 acetophenazine dimaleate [CHEBI:2402] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 acetophenazine dimaleate [CHEBI:2402] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 heterotricyclic compound [CHEBI:36688] (541) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 acetophenazine dimaleate [CHEBI:2402] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 acetophenazine dimaleate [CHEBI:2402] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 acetophenazine dimaleate [CHEBI:2402] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 acetophenazine dimaleate [CHEBI:2402] (1)
ChEBI Compound Accession Identifier  [CHEBI:2402]
ChEBI Compound Description  null
ChEBI Compound Identification Number  2402
ChEBI InChI Value  "InChI=1S/C23H29N3O2S.2C4H4O4/c1-18(28)19-7-8-23-21(17-19)26(20-5-2-3-6-22(20)29-23)10-4-9-24-11-13-25(14-12-24)15-16-27;2*5-3(6)1-2-4(7)8/h2-3,5-8,17,27H,4,9-16H2,1H3;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1-"
ChEBI InChIKey Value  NUKVZKPNSKJGBK-SPIKMXEPSA-N
ChEBI Compound Name  acetophenazine dimaleate
ChEBI SMILES Value  [H+].[H+].[H+].[H+].[O-]C(=O)\\C=C/C([O-])=O.[O-]C(=O)\\C=C/C([O-])=O.CC(=O)c1ccc2Sc3ccccc3N(CCCN3CCN(CCO)CC3)c2c1
ChEBI Substance ID  10318931
ChEBI URL  ChEBI:2402
ChemSpider ID  4444538
Ontomatica Chemical Accession Key (OnChAKey)  NUKVZKPNSKJGBK_SPIKMXEPSA_N_000_000000
PubChem Compound ID  46878364