Item 2 of 2 (back to results) previous anthralin An anthracene compound derived by the substitution of -OH groups for hydrogen at C-1 and C-8, and with an oxo group at C-9.

Current search: 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > dermatologic drug [CHEBI:50177] > antipsoriatic [CHEBI:50748] × Select any link to see items in a related category. more general categories    information about this item 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   dermatologic drug [CHEBI:50177] (49)   antipsoriatic [CHEBI:50748] (2)   anthralin [CHEBI:37510] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   anthralin [CHEBI:37510] (1)  carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthralin [CHEBI:37510] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   anthralin [CHEBI:37510] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthralin [CHEBI:37510] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   homocyclic compound [CHEBI:33597] (1134)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   anthralin [CHEBI:37510] (1)  carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthralin [CHEBI:37510] (1)  homopolycyclic compound [CHEBI:35295] (493)   carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthralin [CHEBI:37510] (1)  polycyclic compound [CHEBI:33635] (4078)   homopolycyclic compound [CHEBI:35295] (493)   carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthralin [CHEBI:37510] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthralin [CHEBI:37510] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   anthralin [CHEBI:37510] (1)  organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   anthralin [CHEBI:37510] (1)  carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthralin [CHEBI:37510] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   anthralin [CHEBI:37510] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthralin [CHEBI:37510] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   anthralin [CHEBI:37510] (1)  carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthralin [CHEBI:37510] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   anthralin [CHEBI:37510] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthralin [CHEBI:37510] (1) ChEBI Compound Accession Identifier:   [CHEBI:37510] ChEBI Compound Description:   An anthracene compound derived by the substitution of -OH groups for hydrogen at C-1 and C-8, and with an oxo group at C-9. ChEBI Compound Identification Number:   37510 ChEBI InChI Value:   InChI=1S/C14H10O3/c15-10-5-1-3-8-7-9-4-2-6-11(16)13(9)14(17)12(8)10/h1-6,15-16H,7H2 ChEBI InChIKey Value:   NUZWLKWWNNJHPT-UHFFFAOYSA-N ChEBI Compound Name:   anthralin ChEBI SMILES Value:   Oc1cccc2Cc3cccc(O)c3C(=O)c12 ChEBI Substance ID:   17487271 ChEBI URL:   ChEBI:37510 ChemSpider ID:   2117 Ontomatica Chemical Accession Key (OnChAKey):   NUZWLKWWNNJHPT_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   2202