Item 13 of 30 (back to results) previous next perphenazine A phenothiazine derivative having a chloro subsitituent at the 2-position and a 3-[4-(2-hydroxyethyl)piperazin-1-yl]propyl group at the N-10 position.

Current search: 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > central nervous system drug [CHEBI:35470] > psychotropic drug [CHEBI:35471] > tranquilizing drug [CHEBI:35473] > antipsychotic agent [CHEBI:35476] > first generation antipsychotic [CHEBI:65190] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  pharmacological uses [CHEBI:52210] (736)   neurotransmitter agent [CHEBI:35942] (471)   dopaminergic agent [CHEBI:48560] (99)   dopaminergic antagonist [CHEBI:48561] (48)   perphenazine [CHEBI:8028] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   central nervous system drug [CHEBI:35470] (217)   psychotropic drug [CHEBI:35471] (130)   tranquilizing drug [CHEBI:35473] (83)   antipsychotic agent [CHEBI:35476] (51)   first generation antipsychotic [CHEBI:65190] (30)   phenothiazine antipsychotic drug [CHEBI:37930] (18)   perphenazine [CHEBI:8028] (1)  antiemetic [CHEBI:50919] (41)   perphenazine [CHEBI:8028] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   amino alcohol [CHEBI:22478] (250)   ethanolamines [CHEBI:23981] (167)   N-(2-hydroxyethyl)piperazine [CHEBI:46851] (6)   perphenazine [CHEBI:8028] (1)  p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperazines [CHEBI:26144] (111)   N-alkylpiperazine [CHEBI:46845] (56)   perphenazine [CHEBI:8028] (1)  N-(2-hydroxyethyl)piperazine [CHEBI:46851] (6)   perphenazine [CHEBI:8028] (1)  organic amino compound [CHEBI:50047] (2472)   amino alcohol [CHEBI:22478] (250)   ethanolamines [CHEBI:23981] (167)   N-(2-hydroxyethyl)piperazine [CHEBI:46851] (6)   perphenazine [CHEBI:8028] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   amino alcohol [CHEBI:22478] (250)   ethanolamines [CHEBI:23981] (167)   N-(2-hydroxyethyl)piperazine [CHEBI:46851] (6)   perphenazine [CHEBI:8028] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperazines [CHEBI:26144] (111)   N-alkylpiperazine [CHEBI:46845] (56)   perphenazine [CHEBI:8028] (1)  N-(2-hydroxyethyl)piperazine [CHEBI:46851] (6)   perphenazine [CHEBI:8028] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperazines [CHEBI:26144] (111)   N-alkylpiperazine [CHEBI:46845] (56)   perphenazine [CHEBI:8028] (1)  N-(2-hydroxyethyl)piperazine [CHEBI:46851] (6)   perphenazine [CHEBI:8028] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   perphenazine [CHEBI:8028] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperazines [CHEBI:26144] (111)   N-alkylpiperazine [CHEBI:46845] (56)   perphenazine [CHEBI:8028] (1)  N-(2-hydroxyethyl)piperazine [CHEBI:46851] (6)   perphenazine [CHEBI:8028] (1)  organic amino compound [CHEBI:50047] (2472)   amino alcohol [CHEBI:22478] (250)   ethanolamines [CHEBI:23981] (167)   N-(2-hydroxyethyl)piperazine [CHEBI:46851] (6)   perphenazine [CHEBI:8028] (1)  organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   amino alcohol [CHEBI:22478] (250)   ethanolamines [CHEBI:23981] (167)   N-(2-hydroxyethyl)piperazine [CHEBI:46851] (6)   perphenazine [CHEBI:8028] (1)  organic amino compound [CHEBI:50047] (2472)   amino alcohol [CHEBI:22478] (250)   ethanolamines [CHEBI:23981] (167)   N-(2-hydroxyethyl)piperazine [CHEBI:46851] (6)   perphenazine [CHEBI:8028] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperazines [CHEBI:26144] (111)   N-alkylpiperazine [CHEBI:46845] (56)   perphenazine [CHEBI:8028] (1)  N-(2-hydroxyethyl)piperazine [CHEBI:46851] (6)   perphenazine [CHEBI:8028] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperazines [CHEBI:26144] (111)   N-alkylpiperazine [CHEBI:46845] (56)   perphenazine [CHEBI:8028] (1)  N-(2-hydroxyethyl)piperazine [CHEBI:46851] (6)   perphenazine [CHEBI:8028] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   perphenazine [CHEBI:8028] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   perphenazine [CHEBI:8028] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   heterotricyclic compound [CHEBI:36688] (541)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   perphenazine [CHEBI:8028] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   perphenazine [CHEBI:8028] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   perphenazine [CHEBI:8028] (1)  monocyclic compound [CHEBI:33661] (2007)   heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperazines [CHEBI:26144] (111)   N-alkylpiperazine [CHEBI:46845] (56)   perphenazine [CHEBI:8028] (1)  N-(2-hydroxyethyl)piperazine [CHEBI:46851] (6)   perphenazine [CHEBI:8028] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperazines [CHEBI:26144] (111)   N-alkylpiperazine [CHEBI:46845] (56)   perphenazine [CHEBI:8028] (1)  N-(2-hydroxyethyl)piperazine [CHEBI:46851] (6)   perphenazine [CHEBI:8028] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperazines [CHEBI:26144] (111)   N-alkylpiperazine [CHEBI:46845] (56)   perphenazine [CHEBI:8028] (1)  N-(2-hydroxyethyl)piperazine [CHEBI:46851] (6)   perphenazine [CHEBI:8028] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   perphenazine [CHEBI:8028] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   perphenazine [CHEBI:8028] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperazines [CHEBI:26144] (111)   N-alkylpiperazine [CHEBI:46845] (56)   perphenazine [CHEBI:8028] (1)  N-(2-hydroxyethyl)piperazine [CHEBI:46851] (6)   perphenazine [CHEBI:8028] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperazines [CHEBI:26144] (111)   N-alkylpiperazine [CHEBI:46845] (56)   perphenazine [CHEBI:8028] (1)  N-(2-hydroxyethyl)piperazine [CHEBI:46851] (6)   perphenazine [CHEBI:8028] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   perphenazine [CHEBI:8028] (1)  heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperazines [CHEBI:26144] (111)   N-alkylpiperazine [CHEBI:46845] (56)   perphenazine [CHEBI:8028] (1)  N-(2-hydroxyethyl)piperazine [CHEBI:46851] (6)   perphenazine [CHEBI:8028] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   heterotricyclic compound [CHEBI:36688] (541)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   perphenazine [CHEBI:8028] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   perphenazine [CHEBI:8028] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperazines [CHEBI:26144] (111)   N-alkylpiperazine [CHEBI:46845] (56)   perphenazine [CHEBI:8028] (1)  N-(2-hydroxyethyl)piperazine [CHEBI:46851] (6)   perphenazine [CHEBI:8028] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperazines [CHEBI:26144] (111)   N-alkylpiperazine [CHEBI:46845] (56)   perphenazine [CHEBI:8028] (1)  N-(2-hydroxyethyl)piperazine [CHEBI:46851] (6)   perphenazine [CHEBI:8028] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   perphenazine [CHEBI:8028] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   perphenazine [CHEBI:8028] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   amino alcohol [CHEBI:22478] (250)   ethanolamines [CHEBI:23981] (167)   N-(2-hydroxyethyl)piperazine [CHEBI:46851] (6)   perphenazine [CHEBI:8028] (1) ChEBI Compound Accession Identifier:   [CHEBI:8028] ChEBI Compound Description:   A phenothiazine derivative having a chloro subsitituent at the 2-position and a 3-[4-(2-hydroxyethyl)piperazin-1-yl]propyl group at the N-10 position. ChEBI Compound Identification Number:   8028 ChEBI InChI Value:   InChI=1S/C21H26ClN3OS/c22-17-6-7-21-19(16-17)25(18-4-1-2-5-20(18)27-21)9-3-8-23-10-12-24(13-11-23)14-15-26/h1-2,4-7,16,26H,3,8-15H2 ChEBI InChIKey Value:   RGCVKNLCSQQDEP-UHFFFAOYSA-N ChEBI Compound Name:   perphenazine ChEBI SMILES Value:   OCCN1CCN(CCCN2c3ccccc3Sc3ccc(Cl)cc23)CC1 ChEBI Substance ID:   24434791 ChEBI URL:   ChEBI:8028 ChemSpider ID:   4586 Ontomatica Chemical Accession Key (OnChAKey):   RGCVKNLCSQQDEP_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   4748