New Search

Item 14 of 16 (back to results)
Previous previous next Next

fentanyl
The carboxamide resulting from the formal condensation of the aryl amino group of N-phenyl-1-(2-phenylethyl)piperidin-4-amine with propanoic acid.


Current search:

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 pharmacological uses [CHEBI:52210] (736) 
 analgesic [CHEBI:35480] (114) 
 opioid analgesic [CHEBI:35482] (40) 
 fentanyl [CHEBI:119915] (1)
 neurotransmitter agent [CHEBI:35942] (471) 
 opioid agent [CHEBI:60598] (32) 
 mu-opioid agent [CHEBI:60599] (26) 
 mu-opioid receptor agonist [CHEBI:55322] (22) 
 fentanyl [CHEBI:119915] (1)
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 anaesthetic [CHEBI:38867] (64) 
 fentanyl [CHEBI:119915] (1)
 general anaesthetic [CHEBI:38869] (26) 
 intravenous anaesthetic [CHEBI:38877] (16) 
 fentanyl [CHEBI:119915] (1)
 adjuvant [CHEBI:60809] (12) 
 fentanyl [CHEBI:119915] (1)
 anaesthesia adjuvant [CHEBI:60807] (10) 
 fentanyl [CHEBI:119915] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 amide [CHEBI:32988] (1863) 
 anilide [CHEBI:13248] (11) 
 fentanyl [CHEBI:119915] (1)
 primary amide [CHEBI:33256] (1586) 
 carboxamide [CHEBI:37622] (1381) 
 fentanyl [CHEBI:119915] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 carboxamide [CHEBI:37622] (1381) 
 fentanyl [CHEBI:119915] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperidines [CHEBI:26151] (143) 
 fentanyl [CHEBI:119915] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 organooxygen compound [CHEBI:36963] (11352) 
 carboxamide [CHEBI:37622] (1381) 
 fentanyl [CHEBI:119915] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carboxamide [CHEBI:37622] (1381) 
 fentanyl [CHEBI:119915] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperidines [CHEBI:26151] (143) 
 fentanyl [CHEBI:119915] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperidines [CHEBI:26151] (143) 
 fentanyl [CHEBI:119915] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 carboxamide [CHEBI:37622] (1381) 
 fentanyl [CHEBI:119915] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperidines [CHEBI:26151] (143) 
 fentanyl [CHEBI:119915] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carboxamide [CHEBI:37622] (1381) 
 fentanyl [CHEBI:119915] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperidines [CHEBI:26151] (143) 
 fentanyl [CHEBI:119915] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperidines [CHEBI:26151] (143) 
 fentanyl [CHEBI:119915] (1)
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 anilide [CHEBI:13248] (11) 
 fentanyl [CHEBI:119915] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 anilide [CHEBI:13248] (11) 
 fentanyl [CHEBI:119915] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 homocyclic compound [CHEBI:33597] (1134) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 anilide [CHEBI:13248] (11) 
 fentanyl [CHEBI:119915] (1)
 aromatic compound [CHEBI:33655] (3799) 
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 anilide [CHEBI:13248] (11) 
 fentanyl [CHEBI:119915] (1)
 monocyclic compound [CHEBI:33661] (2007) 
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperidines [CHEBI:26151] (143) 
 fentanyl [CHEBI:119915] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperidines [CHEBI:26151] (143) 
 fentanyl [CHEBI:119915] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperidines [CHEBI:26151] (143) 
 fentanyl [CHEBI:119915] (1)
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 anilide [CHEBI:13248] (11) 
 fentanyl [CHEBI:119915] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 anilide [CHEBI:13248] (11) 
 fentanyl [CHEBI:119915] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperidines [CHEBI:26151] (143) 
 fentanyl [CHEBI:119915] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperidines [CHEBI:26151] (143) 
 fentanyl [CHEBI:119915] (1)
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperidines [CHEBI:26151] (143) 
 fentanyl [CHEBI:119915] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperidines [CHEBI:26151] (143) 
 fentanyl [CHEBI:119915] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperidines [CHEBI:26151] (143) 
 fentanyl [CHEBI:119915] (1)
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 anilide [CHEBI:13248] (11) 
 fentanyl [CHEBI:119915] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 anilide [CHEBI:13248] (11) 
 fentanyl [CHEBI:119915] (1)
ChEBI Compound Accession Identifier  [CHEBI:119915]
ChEBI Compound Description  The carboxamide resulting from the formal condensation of the aryl amino group of N-phenyl-1-(2-phenylethyl)piperidin-4-amine with propanoic acid.
ChEBI Compound Identification Number  119915
ChEBI InChI Value  InChI=1S/C22H28N2O/c1-2-22(25)24(20-11-7-4-8-12-20)21-14-17-23(18-15-21)16-13-19-9-5-3-6-10-19/h3-12,21H,2,13-18H2,1H3
ChEBI InChIKey Value  PJMPHNIQZUBGLI-UHFFFAOYSA-N
ChEBI Compound Name  fentanyl
ChEBI SMILES Value  CCC(=O)N(C1CCN(CC1)CCc1ccccc1)c1ccccc1
ChEBI Substance ID  85325012
ChEBI URL  ChEBI:119915
ChemSpider ID  NS
Ontomatica Chemical Accession Key (OnChAKey)  PJMPHNIQZUBGLI_UHFFFAOYSA_N_000_000000
PubChem Compound ID  3345