New Search

Item 18 of 18 (back to results)
Previous previous

thioproperazine
A phenothiazine derivative having a dimethylaminosulfonyl subsitituent at the 2-position and a 3-(4-methylpiperazin-1-yl)propyl group at the N-10 position.


Current search:

Select any link to see items in a related category.

more general categories    information about this item
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 central nervous system drug [CHEBI:35470] (217) 
 psychotropic drug [CHEBI:35471] (130) 
 tranquilizing drug [CHEBI:35473] (83) 
 antipsychotic agent [CHEBI:35476] (51) 
 first generation antipsychotic [CHEBI:65190] (30) 
 phenothiazine antipsychotic drug [CHEBI:37930] (18) 
 thioproperazine [CHEBI:59120] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 amide [CHEBI:32988] (1863) 
 primary amide [CHEBI:33256] (1586) 
 sulfonamide [CHEBI:35358] (106) 
 thioproperazine [CHEBI:59120] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (56) 
 thioproperazine [CHEBI:59120] (1)
 N-methylpiperazine [CHEBI:46920] (12) 
 thioproperazine [CHEBI:59120] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 sulfur molecular entity [CHEBI:26835] (1541) 
 sulfur oxoacid derivative [CHEBI:33424] (628) 
 sulfonic acid derivative [CHEBI:33552] (393) 
 sulfonamide [CHEBI:35358] (106) 
 thioproperazine [CHEBI:59120] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (56) 
 thioproperazine [CHEBI:59120] (1)
 N-methylpiperazine [CHEBI:46920] (12) 
 thioproperazine [CHEBI:59120] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (56) 
 thioproperazine [CHEBI:59120] (1)
 N-methylpiperazine [CHEBI:46920] (12) 
 thioproperazine [CHEBI:59120] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 thioproperazine [CHEBI:59120] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (56) 
 thioproperazine [CHEBI:59120] (1)
 N-methylpiperazine [CHEBI:46920] (12) 
 thioproperazine [CHEBI:59120] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (56) 
 thioproperazine [CHEBI:59120] (1)
 N-methylpiperazine [CHEBI:46920] (12) 
 thioproperazine [CHEBI:59120] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (56) 
 thioproperazine [CHEBI:59120] (1)
 N-methylpiperazine [CHEBI:46920] (12) 
 thioproperazine [CHEBI:59120] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 thioproperazine [CHEBI:59120] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 thioproperazine [CHEBI:59120] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 heterotricyclic compound [CHEBI:36688] (541) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 thioproperazine [CHEBI:59120] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 thioproperazine [CHEBI:59120] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 thioproperazine [CHEBI:59120] (1)
 monocyclic compound [CHEBI:33661] (2007) 
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (56) 
 thioproperazine [CHEBI:59120] (1)
 N-methylpiperazine [CHEBI:46920] (12) 
 thioproperazine [CHEBI:59120] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (56) 
 thioproperazine [CHEBI:59120] (1)
 N-methylpiperazine [CHEBI:46920] (12) 
 thioproperazine [CHEBI:59120] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (56) 
 thioproperazine [CHEBI:59120] (1)
 N-methylpiperazine [CHEBI:46920] (12) 
 thioproperazine [CHEBI:59120] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 thioproperazine [CHEBI:59120] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 thioproperazine [CHEBI:59120] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (56) 
 thioproperazine [CHEBI:59120] (1)
 N-methylpiperazine [CHEBI:46920] (12) 
 thioproperazine [CHEBI:59120] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (56) 
 thioproperazine [CHEBI:59120] (1)
 N-methylpiperazine [CHEBI:46920] (12) 
 thioproperazine [CHEBI:59120] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 thioproperazine [CHEBI:59120] (1)
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (56) 
 thioproperazine [CHEBI:59120] (1)
 N-methylpiperazine [CHEBI:46920] (12) 
 thioproperazine [CHEBI:59120] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 heterotricyclic compound [CHEBI:36688] (541) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 thioproperazine [CHEBI:59120] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 thioproperazine [CHEBI:59120] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (56) 
 thioproperazine [CHEBI:59120] (1)
 N-methylpiperazine [CHEBI:46920] (12) 
 thioproperazine [CHEBI:59120] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (56) 
 thioproperazine [CHEBI:59120] (1)
 N-methylpiperazine [CHEBI:46920] (12) 
 thioproperazine [CHEBI:59120] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 thioproperazine [CHEBI:59120] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 thioproperazine [CHEBI:59120] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 oxoacid derivative [CHEBI:33241] (3254) 
 sulfur oxoacid derivative [CHEBI:33424] (628) 
 sulfonic acid derivative [CHEBI:33552] (393) 
 sulfonamide [CHEBI:35358] (106) 
 thioproperazine [CHEBI:59120] (1)
ChEBI Compound Accession Identifier  [CHEBI:59120]
ChEBI Compound Description  A phenothiazine derivative having a dimethylaminosulfonyl subsitituent at the 2-position and a 3-(4-methylpiperazin-1-yl)propyl group at the N-10 position.
ChEBI Compound Identification Number  59120
ChEBI InChI Value  InChI=1S/C22H30N4O2S2/c1-23(2)30(27,28)18-9-10-22-20(17-18)26(19-7-4-5-8-21(19)29-22)12-6-11-25-15-13-24(3)14-16-25/h4-5,7-10,17H,6,11-16H2,1-3H3
ChEBI InChIKey Value  VZYCZNZBPPHOFY-UHFFFAOYSA-N
ChEBI Compound Name  thioproperazine
ChEBI SMILES Value  CN1CCN(CCCN2c3ccccc3Sc3ccc(cc23)S(=O)(=O)N(C)C)CC1
ChEBI Substance ID  92741987
ChEBI URL  ChEBI:59120
ChemSpider ID  9058
Ontomatica Chemical Accession Key (OnChAKey)  VZYCZNZBPPHOFY_UHFFFAOYSA_N_000_000000
PubChem Compound ID  9429