Item 19 of 30 (back to results) previous next triflupromazine A phenothiazine derivative having a trifluoromethyl subsitituent at the 2-position and a 3-(dimethylamino)propyl group at the N-10 position.

Current search: 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > central nervous system drug [CHEBI:35470] > psychotropic drug [CHEBI:35471] > tranquilizing drug [CHEBI:35473] > antipsychotic agent [CHEBI:35476] > first generation antipsychotic [CHEBI:65190] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  pharmacological uses [CHEBI:52210] (736)   neurotransmitter agent [CHEBI:35942] (471)   dopaminergic agent [CHEBI:48560] (99)   dopaminergic antagonist [CHEBI:48561] (48)   triflupromazine [CHEBI:9711] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   central nervous system drug [CHEBI:35470] (217)   psychotropic drug [CHEBI:35471] (130)   tranquilizing drug [CHEBI:35473] (83)   antipsychotic agent [CHEBI:35476] (51)   first generation antipsychotic [CHEBI:65190] (30)   phenothiazine antipsychotic drug [CHEBI:37930] (18)   triflupromazine [CHEBI:9711] (1)  antiemetic [CHEBI:50919] (41)   triflupromazine [CHEBI:9711] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organic amino compound [CHEBI:50047] (2472)   amine [CHEBI:32952] (179)   tertiary amine [CHEBI:32876] (84)   triflupromazine [CHEBI:9711] (1)  tertiary amino compound [CHEBI:50996] (199)   tertiary amine [CHEBI:32876] (84)   triflupromazine [CHEBI:9711] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   triflupromazine [CHEBI:9711] (1)  organonitrogen compound [CHEBI:35352] (6705)   organic amino compound [CHEBI:50047] (2472)   amine [CHEBI:32952] (179)   tertiary amine [CHEBI:32876] (84)   triflupromazine [CHEBI:9711] (1)  tertiary amino compound [CHEBI:50996] (199)   tertiary amine [CHEBI:32876] (84)   triflupromazine [CHEBI:9711] (1)  organic amino compound [CHEBI:50047] (2472)   amine [CHEBI:32952] (179)   tertiary amine [CHEBI:32876] (84)   triflupromazine [CHEBI:9711] (1)  tertiary amino compound [CHEBI:50996] (199)   tertiary amine [CHEBI:32876] (84)   triflupromazine [CHEBI:9711] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   triflupromazine [CHEBI:9711] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   triflupromazine [CHEBI:9711] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   heterotricyclic compound [CHEBI:36688] (541)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   triflupromazine [CHEBI:9711] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   triflupromazine [CHEBI:9711] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   triflupromazine [CHEBI:9711] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   triflupromazine [CHEBI:9711] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   triflupromazine [CHEBI:9711] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   triflupromazine [CHEBI:9711] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   heterotricyclic compound [CHEBI:36688] (541)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   triflupromazine [CHEBI:9711] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   triflupromazine [CHEBI:9711] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   triflupromazine [CHEBI:9711] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   triflupromazine [CHEBI:9711] (1) ChEBI Compound Accession Identifier:   [CHEBI:9711] ChEBI Compound Description:   A phenothiazine derivative having a trifluoromethyl subsitituent at the 2-position and a 3-(dimethylamino)propyl group at the N-10 position. ChEBI Compound Identification Number:   9711 ChEBI InChI Value:   InChI=1S/C18H19F3N2S/c1-22(2)10-5-11-23-14-6-3-4-7-16(14)24-17-9-8-13(12-15(17)23)18(19,20)21/h3-4,6-9,12H,5,10-11H2,1-2H3 ChEBI InChIKey Value:   XSCGXQMFQXDFCW-UHFFFAOYSA-N ChEBI Compound Name:   triflupromazine ChEBI SMILES Value:   CN(C)CCCN1c2ccccc2Sc2ccc(cc12)C(F)(F)F ChEBI Substance ID:   56394865 ChEBI URL:   ChEBI:9711 ChemSpider ID:   5367 Ontomatica Chemical Accession Key (OnChAKey):   XSCGXQMFQXDFCW_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   5568