Item 3 of 6 (back to results) previous next piroctone A cyclic hydroxamic acid that consists of 1-hydroxypyridin-2-one bearing methyl and 2,4,4-trimethylpentyl substtituents at positions 4 and 6 respectively.

Current search: 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > dermatologic drug [CHEBI:50177] > antiseborrheic [CHEBI:59010] × Select any link to see items in a related category. more general categories    information about this item 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   dermatologic drug [CHEBI:50177] (49)   antiseborrheic [CHEBI:59010] (6)   piroctone [CHEBI:59009] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   amide [CHEBI:32988] (1863)   primary amide [CHEBI:33256] (1586)   carboxamide [CHEBI:37622] (1381)   hydroxamic acid [CHEBI:24650] (25)   cyclic hydroxamic acid [CHEBI:23445] (6)   piroctone [CHEBI:59009] (1)  organonitrogen compound [CHEBI:35352] (6705)   carboxamide [CHEBI:37622] (1381)   hydroxamic acid [CHEBI:24650] (25)   cyclic hydroxamic acid [CHEBI:23445] (6)   piroctone [CHEBI:59009] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   pyridone [CHEBI:38183] (16)   piroctone [CHEBI:59009] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   carboxamide [CHEBI:37622] (1381)   hydroxamic acid [CHEBI:24650] (25)   cyclic hydroxamic acid [CHEBI:23445] (6)   piroctone [CHEBI:59009] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carboxamide [CHEBI:37622] (1381)   hydroxamic acid [CHEBI:24650] (25)   cyclic hydroxamic acid [CHEBI:23445] (6)   piroctone [CHEBI:59009] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   pyridone [CHEBI:38183] (16)   piroctone [CHEBI:59009] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   pyridone [CHEBI:38183] (16)   piroctone [CHEBI:59009] (1)  organonitrogen compound [CHEBI:35352] (6705)   carboxamide [CHEBI:37622] (1381)   hydroxamic acid [CHEBI:24650] (25)   cyclic hydroxamic acid [CHEBI:23445] (6)   piroctone [CHEBI:59009] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   pyridone [CHEBI:38183] (16)   piroctone [CHEBI:59009] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carboxamide [CHEBI:37622] (1381)   hydroxamic acid [CHEBI:24650] (25)   cyclic hydroxamic acid [CHEBI:23445] (6)   piroctone [CHEBI:59009] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   pyridone [CHEBI:38183] (16)   piroctone [CHEBI:59009] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   pyridone [CHEBI:38183] (16)   piroctone [CHEBI:59009] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   monocyclic compound [CHEBI:33661] (2007)   heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   pyridone [CHEBI:38183] (16)   piroctone [CHEBI:59009] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   pyridone [CHEBI:38183] (16)   piroctone [CHEBI:59009] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   pyridone [CHEBI:38183] (16)   piroctone [CHEBI:59009] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   pyridone [CHEBI:38183] (16)   piroctone [CHEBI:59009] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   pyridone [CHEBI:38183] (16)   piroctone [CHEBI:59009] (1)  heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   pyridone [CHEBI:38183] (16)   piroctone [CHEBI:59009] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   pyridone [CHEBI:38183] (16)   piroctone [CHEBI:59009] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   pyridone [CHEBI:38183] (16)   piroctone [CHEBI:59009] (1) ChEBI Compound Accession Identifier:   [CHEBI:59009] ChEBI Compound Description:   A cyclic hydroxamic acid that consists of 1-hydroxypyridin-2-one bearing methyl and 2,4,4-trimethylpentyl substtituents at positions 4 and 6 respectively. ChEBI Compound Identification Number:   59009 ChEBI InChI Value:   InChI=1S/C14H23NO2/c1-10-6-12(15(17)13(16)8-10)7-11(2)9-14(3,4)5/h6,8,11,17H,7,9H2,1-5H3 ChEBI InChIKey Value:   OIQJEQLSYJSNDS-UHFFFAOYSA-N ChEBI Compound Name:   piroctone ChEBI SMILES Value:   CC(Cc1cc(C)cc(=O)n1O)CC(C)(C)C ChEBI Substance ID:   135610335 ChEBI URL:   ChEBI:59009 ChemSpider ID:   45575 Ontomatica Chemical Accession Key (OnChAKey):   OIQJEQLSYJSNDS_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   50259