Item 26 of 32 (back to results) previous next florbetapir F-18 An aromatic ether consisting of a pyridine ring substituted at position 2 by a 2-{2-[2-((18)F)fluoroethoxy]ethoxy}ethoxy group and at position 5 and a 2-(4-methylaminophenyl)vinyl group. A positron emission tomography imaging ligand for the detection of amyloid aggregation associated with Alzheimer disease.

Current search: 05. Industrial Uses: pharmaceutical [CHEBI:52217] > diagnostic agent [CHEBI:33295] > diagnostic imaging agent [CHEBI:37334] × Select any link to see items in a related category. more general categories    information about this item 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   diagnostic agent [CHEBI:33295] (53)   diagnostic imaging agent [CHEBI:37334] (32)   radioactive imaging agent [CHEBI:37336] (6)   florbetapir F-18 [CHEBI:66880] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   halogen molecular entity [CHEBI:24471] (1475)   fluorine molecular entity [CHEBI:24062] (288)   organofluorine compound [CHEBI:37143] (275)   florbetapir F-18 [CHEBI:66880] (1)  fluorine-18 molecular entity [CHEBI:49133] (6)   fluorine-18 radiopharmaceutical [CHEBI:49127] (6)   florbetapir F-18 [CHEBI:66880] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organofluorine compound [CHEBI:37143] (275)   florbetapir F-18 [CHEBI:66880] (1)  pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   florbetapir F-18 [CHEBI:66880] (1)  organic amino compound [CHEBI:50047] (2472)   aromatic amine [CHEBI:33860] (91)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   florbetapir F-18 [CHEBI:66880] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   florbetapir F-18 [CHEBI:66880] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   florbetapir F-18 [CHEBI:66880] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   florbetapir F-18 [CHEBI:66880] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   florbetapir F-18 [CHEBI:66880] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   florbetapir F-18 [CHEBI:66880] (1)  organic amino compound [CHEBI:50047] (2472)   aromatic amine [CHEBI:33860] (91)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   florbetapir F-18 [CHEBI:66880] (1)  organohalogen compound [CHEBI:36684] (976)   organofluorine compound [CHEBI:37143] (275)   florbetapir F-18 [CHEBI:66880] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   florbetapir F-18 [CHEBI:66880] (1)  organic amino compound [CHEBI:50047] (2472)   aromatic amine [CHEBI:33860] (91)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   florbetapir F-18 [CHEBI:66880] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   florbetapir F-18 [CHEBI:66880] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   florbetapir F-18 [CHEBI:66880] (1)  carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   florbetapir F-18 [CHEBI:66880] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   florbetapir F-18 [CHEBI:66880] (1)  aromatic amine [CHEBI:33860] (91)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   florbetapir F-18 [CHEBI:66880] (1)  aromatic ether [CHEBI:35618] (353)   florbetapir F-18 [CHEBI:66880] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   homocyclic compound [CHEBI:33597] (1134)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   florbetapir F-18 [CHEBI:66880] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   florbetapir F-18 [CHEBI:66880] (1)  aromatic amine [CHEBI:33860] (91)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   florbetapir F-18 [CHEBI:66880] (1)  aromatic ether [CHEBI:35618] (353)   florbetapir F-18 [CHEBI:66880] (1)  monocyclic compound [CHEBI:33661] (2007)   heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   florbetapir F-18 [CHEBI:66880] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   florbetapir F-18 [CHEBI:66880] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   florbetapir F-18 [CHEBI:66880] (1)  carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   florbetapir F-18 [CHEBI:66880] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   florbetapir F-18 [CHEBI:66880] (1)  aromatic amine [CHEBI:33860] (91)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   florbetapir F-18 [CHEBI:66880] (1)  aromatic ether [CHEBI:35618] (353)   florbetapir F-18 [CHEBI:66880] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   florbetapir F-18 [CHEBI:66880] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   florbetapir F-18 [CHEBI:66880] (1)  heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   florbetapir F-18 [CHEBI:66880] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   florbetapir F-18 [CHEBI:66880] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   florbetapir F-18 [CHEBI:66880] (1)  carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   florbetapir F-18 [CHEBI:66880] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   florbetapir F-18 [CHEBI:66880] (1)  aromatic amine [CHEBI:33860] (91)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   florbetapir F-18 [CHEBI:66880] (1)  aromatic ether [CHEBI:35618] (353)   florbetapir F-18 [CHEBI:66880] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organofluorine compound [CHEBI:37143] (275)   florbetapir F-18 [CHEBI:66880] (1) ChEBI Compound Accession Identifier:   [CHEBI:66880] ChEBI Compound Description:   An aromatic ether consisting of a pyridine ring substituted at position 2 by a 2-{2-[2-((18)F)fluoroethoxy]ethoxy}ethoxy group and at position 5 and a 2-(4-methylaminophenyl)vinyl group. A positron emission tomography imaging ligand for the detection of amyloid aggregation associated with Alzheimer disease. ChEBI Compound Identification Number:   66880 ChEBI InChI Value:   InChI=1S/C20H25FN2O3/c1-22-19-7-4-17(5-8-19)2-3-18-6-9-20(23-16-18)26-15-14-25-13-12-24-11-10-21/h2-9,16,22H,10-15H2,1H3/b3-2+/i21-1 ChEBI InChIKey Value:   YNDIAUKFXKEXSV-CRYLGTRXSA-N ChEBI Compound Name:   florbetapir F-18 ChEBI SMILES Value:   CNc1ccc(\C=C\c2ccc(OCCOCCOCC[18F])nc2)cc1 ChEBI Substance ID:   160645540 ChEBI URL:   ChEBI:66880 ChemSpider ID:   26348452 Ontomatica Chemical Accession Key (OnChAKey):   YNDIAUKFXKEXSV_CRYLGTRXSA_N_000_000000 PubChem Compound ID:   24822371