Item 28 of 32 (back to results) previous next ioflupane I(123) An azabicycloalkane that is ecgonine methyl ester in which the N-methyl group is replaced by 3-fluoropropyl and the 3beta-hydroxy group is replaced by 4-((123)I)iodophenyl. Used for the imaging of dopamine transporters in the brain of adult patients with potential Parkinsonian Syndromes.

Current search: 05. Industrial Uses: pharmaceutical [CHEBI:52217] > diagnostic agent [CHEBI:33295] > diagnostic imaging agent [CHEBI:37334] × Select any link to see items in a related category. more general categories    information about this item 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   diagnostic agent [CHEBI:33295] (53)   diagnostic imaging agent [CHEBI:37334] (32)   radioactive imaging agent [CHEBI:37336] (6)   ioflupane I(123) [CHEBI:68855] (1)  radiopharmaceutical [CHEBI:35232] (1)   ioflupane I(123) [CHEBI:68855] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   halogen molecular entity [CHEBI:24471] (1475)   fluorine molecular entity [CHEBI:24062] (288)   organofluorine compound [CHEBI:37143] (275)   ioflupane I(123) [CHEBI:68855] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organofluorine compound [CHEBI:37143] (275)   ioflupane I(123) [CHEBI:68855] (1)  pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azabicycloalkane [CHEBI:38295] (38)   ioflupane I(123) [CHEBI:68855] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   ioflupane I(123) [CHEBI:68855] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   ioflupane I(123) [CHEBI:68855] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azabicycloalkane [CHEBI:38295] (38)   ioflupane I(123) [CHEBI:68855] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   azabicycloalkane [CHEBI:38295] (38)   ioflupane I(123) [CHEBI:68855] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azabicycloalkane [CHEBI:38295] (38)   ioflupane I(123) [CHEBI:68855] (1)  organohalogen compound [CHEBI:36684] (976)   organofluorine compound [CHEBI:37143] (275)   ioflupane I(123) [CHEBI:68855] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   ioflupane I(123) [CHEBI:68855] (1)  ester [CHEBI:35701] (3370)   carboxylic ester [CHEBI:33308] (1495)   ioflupane I(123) [CHEBI:68855] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azabicycloalkane [CHEBI:38295] (38)   ioflupane I(123) [CHEBI:68855] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   azabicycloalkane [CHEBI:38295] (38)   ioflupane I(123) [CHEBI:68855] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   ioflupane I(123) [CHEBI:68855] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   azabicycloalkane [CHEBI:38295] (38)   ioflupane I(123) [CHEBI:68855] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   azabicycloalkane [CHEBI:38295] (38)   ioflupane I(123) [CHEBI:68855] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azabicycloalkane [CHEBI:38295] (38)   ioflupane I(123) [CHEBI:68855] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   azabicycloalkane [CHEBI:38295] (38)   ioflupane I(123) [CHEBI:68855] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azabicycloalkane [CHEBI:38295] (38)   ioflupane I(123) [CHEBI:68855] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   azabicycloalkane [CHEBI:38295] (38)   ioflupane I(123) [CHEBI:68855] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   azabicycloalkane [CHEBI:38295] (38)   ioflupane I(123) [CHEBI:68855] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   azabicycloalkane [CHEBI:38295] (38)   ioflupane I(123) [CHEBI:68855] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azabicycloalkane [CHEBI:38295] (38)   ioflupane I(123) [CHEBI:68855] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   azabicycloalkane [CHEBI:38295] (38)   ioflupane I(123) [CHEBI:68855] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   ioflupane I(123) [CHEBI:68855] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organofluorine compound [CHEBI:37143] (275)   ioflupane I(123) [CHEBI:68855] (1) ChEBI Compound Accession Identifier:   [CHEBI:68855] ChEBI Compound Description:   An azabicycloalkane that is ecgonine methyl ester in which the N-methyl group is replaced by 3-fluoropropyl and the 3beta-hydroxy group is replaced by 4-((123)I)iodophenyl. Used for the imaging of dopamine transporters in the brain of adult patients with potential Parkinsonian Syndromes. ChEBI Compound Identification Number:   68855 ChEBI InChI Value:   InChI=1S/C18H23FINO2/c1-23-18(22)17-15(12-3-5-13(20)6-4-12)11-14-7-8-16(17)21(14)10-2-9-19/h3-6,14-17H,2,7-11H2,1H3/t14-,15+,16+,17-/m0/s1/i20-4 ChEBI InChIKey Value:   HXWLAJVUJSVENX-HFIFKADTSA-N ChEBI Compound Name:   ioflupane I(123) ChEBI SMILES Value:   [H][C@]12CC[C@]([H])([C@H]([C@H](C1)c1ccc([123I])cc1)C(=O)OC)N2CCCF ChEBI Substance ID:   160645942 ChEBI URL:   ChEBI:68855 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   HXWLAJVUJSVENX_HFIFKADTSA_N_000_000000 PubChem Compound ID:   3086674