Item 30 of 30 (back to results) previous thioproperazine A phenothiazine derivative having a dimethylaminosulfonyl subsitituent at the 2-position and a 3-(4-methylpiperazin-1-yl)propyl group at the N-10 position.

Current search: 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > central nervous system drug [CHEBI:35470] > psychotropic drug [CHEBI:35471] > tranquilizing drug [CHEBI:35473] > antipsychotic agent [CHEBI:35476] > first generation antipsychotic [CHEBI:65190] × Select any link to see items in a related category. more general categories    information about this item 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   central nervous system drug [CHEBI:35470] (217)   psychotropic drug [CHEBI:35471] (130)   tranquilizing drug [CHEBI:35473] (83)   antipsychotic agent [CHEBI:35476] (51)   first generation antipsychotic [CHEBI:65190] (30)   phenothiazine antipsychotic drug [CHEBI:37930] (18)   thioproperazine [CHEBI:59120] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   amide [CHEBI:32988] (1863)   primary amide [CHEBI:33256] (1586)   sulfonamide [CHEBI:35358] (106)   thioproperazine [CHEBI:59120] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperazines [CHEBI:26144] (111)   N-alkylpiperazine [CHEBI:46845] (56)   thioproperazine [CHEBI:59120] (1)  N-methylpiperazine [CHEBI:46920] (12)   thioproperazine [CHEBI:59120] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   sulfur molecular entity [CHEBI:26835] (1541)   sulfur oxoacid derivative [CHEBI:33424] (628)   sulfonic acid derivative [CHEBI:33552] (393)   sulfonamide [CHEBI:35358] (106)   thioproperazine [CHEBI:59120] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperazines [CHEBI:26144] (111)   N-alkylpiperazine [CHEBI:46845] (56)   thioproperazine [CHEBI:59120] (1)  N-methylpiperazine [CHEBI:46920] (12)   thioproperazine [CHEBI:59120] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperazines [CHEBI:26144] (111)   N-alkylpiperazine [CHEBI:46845] (56)   thioproperazine [CHEBI:59120] (1)  N-methylpiperazine [CHEBI:46920] (12)   thioproperazine [CHEBI:59120] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   thioproperazine [CHEBI:59120] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperazines [CHEBI:26144] (111)   N-alkylpiperazine [CHEBI:46845] (56)   thioproperazine [CHEBI:59120] (1)  N-methylpiperazine [CHEBI:46920] (12)   thioproperazine [CHEBI:59120] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperazines [CHEBI:26144] (111)   N-alkylpiperazine [CHEBI:46845] (56)   thioproperazine [CHEBI:59120] (1)  N-methylpiperazine [CHEBI:46920] (12)   thioproperazine [CHEBI:59120] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperazines [CHEBI:26144] (111)   N-alkylpiperazine [CHEBI:46845] (56)   thioproperazine [CHEBI:59120] (1)  N-methylpiperazine [CHEBI:46920] (12)   thioproperazine [CHEBI:59120] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   thioproperazine [CHEBI:59120] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   thioproperazine [CHEBI:59120] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   heterotricyclic compound [CHEBI:36688] (541)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   thioproperazine [CHEBI:59120] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   thioproperazine [CHEBI:59120] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   thioproperazine [CHEBI:59120] (1)  monocyclic compound [CHEBI:33661] (2007)   heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperazines [CHEBI:26144] (111)   N-alkylpiperazine [CHEBI:46845] (56)   thioproperazine [CHEBI:59120] (1)  N-methylpiperazine [CHEBI:46920] (12)   thioproperazine [CHEBI:59120] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperazines [CHEBI:26144] (111)   N-alkylpiperazine [CHEBI:46845] (56)   thioproperazine [CHEBI:59120] (1)  N-methylpiperazine [CHEBI:46920] (12)   thioproperazine [CHEBI:59120] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperazines [CHEBI:26144] (111)   N-alkylpiperazine [CHEBI:46845] (56)   thioproperazine [CHEBI:59120] (1)  N-methylpiperazine [CHEBI:46920] (12)   thioproperazine [CHEBI:59120] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   thioproperazine [CHEBI:59120] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   thioproperazine [CHEBI:59120] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperazines [CHEBI:26144] (111)   N-alkylpiperazine [CHEBI:46845] (56)   thioproperazine [CHEBI:59120] (1)  N-methylpiperazine [CHEBI:46920] (12)   thioproperazine [CHEBI:59120] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperazines [CHEBI:26144] (111)   N-alkylpiperazine [CHEBI:46845] (56)   thioproperazine [CHEBI:59120] (1)  N-methylpiperazine [CHEBI:46920] (12)   thioproperazine [CHEBI:59120] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   thioproperazine [CHEBI:59120] (1)  heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperazines [CHEBI:26144] (111)   N-alkylpiperazine [CHEBI:46845] (56)   thioproperazine [CHEBI:59120] (1)  N-methylpiperazine [CHEBI:46920] (12)   thioproperazine [CHEBI:59120] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   heterotricyclic compound [CHEBI:36688] (541)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   thioproperazine [CHEBI:59120] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   thioproperazine [CHEBI:59120] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperazines [CHEBI:26144] (111)   N-alkylpiperazine [CHEBI:46845] (56)   thioproperazine [CHEBI:59120] (1)  N-methylpiperazine [CHEBI:46920] (12)   thioproperazine [CHEBI:59120] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperazines [CHEBI:26144] (111)   N-alkylpiperazine [CHEBI:46845] (56)   thioproperazine [CHEBI:59120] (1)  N-methylpiperazine [CHEBI:46920] (12)   thioproperazine [CHEBI:59120] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   thioproperazine [CHEBI:59120] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   thioproperazine [CHEBI:59120] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   oxoacid derivative [CHEBI:33241] (3254)   sulfur oxoacid derivative [CHEBI:33424] (628)   sulfonic acid derivative [CHEBI:33552] (393)   sulfonamide [CHEBI:35358] (106)   thioproperazine [CHEBI:59120] (1) ChEBI Compound Accession Identifier:   [CHEBI:59120] ChEBI Compound Description:   A phenothiazine derivative having a dimethylaminosulfonyl subsitituent at the 2-position and a 3-(4-methylpiperazin-1-yl)propyl group at the N-10 position. ChEBI Compound Identification Number:   59120 ChEBI InChI Value:   InChI=1S/C22H30N4O2S2/c1-23(2)30(27,28)18-9-10-22-20(17-18)26(19-7-4-5-8-21(19)29-22)12-6-11-25-15-13-24(3)14-16-25/h4-5,7-10,17H,6,11-16H2,1-3H3 ChEBI InChIKey Value:   VZYCZNZBPPHOFY-UHFFFAOYSA-N ChEBI Compound Name:   thioproperazine ChEBI SMILES Value:   CN1CCN(CCCN2c3ccccc3Sc3ccc(cc23)S(=O)(=O)N(C)C)CC1 ChEBI Substance ID:   92741987 ChEBI URL:   ChEBI:59120 ChemSpider ID:   9058 Ontomatica Chemical Accession Key (OnChAKey):   VZYCZNZBPPHOFY_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   9429