Item 4 of 18 (back to results) previous next bumetanide 4-Phenoxybenzoic acid in which the hydrogens ortho to the phenoxy group are substituted by butylamino and sulfamoyl groups. Bumetanide is a diuretic, and is used for treatment of oedema associated with congestive heart failure, hepatic and renal disease.

Current search: 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > diuretic [CHEBI:35498] × Select any link to see items in a related category. more general categories    information about this item 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   diuretic [CHEBI:35498] (18)   bumetanide [CHEBI:3213] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   benzoic acids [CHEBI:22723] (150)   bumetanide [CHEBI:3213] (1)  amino acid [CHEBI:33709] (959)   bumetanide [CHEBI:3213] (1)  p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   amide [CHEBI:32988] (1863)   primary amide [CHEBI:33256] (1586)   sulfonamide [CHEBI:35358] (106)   bumetanide [CHEBI:3213] (1)  organonitrogen compound [CHEBI:35352] (6705)   organic amino compound [CHEBI:50047] (2472)   amino acid [CHEBI:33709] (959)   bumetanide [CHEBI:3213] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   benzoic acids [CHEBI:22723] (150)   bumetanide [CHEBI:3213] (1)  amino acid [CHEBI:33709] (959)   bumetanide [CHEBI:3213] (1)  organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   benzoic acids [CHEBI:22723] (150)   bumetanide [CHEBI:3213] (1)  amino acid [CHEBI:33709] (959)   bumetanide [CHEBI:3213] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   benzoic acids [CHEBI:22723] (150)   bumetanide [CHEBI:3213] (1)  amino acid [CHEBI:33709] (959)   bumetanide [CHEBI:3213] (1)  sulfur molecular entity [CHEBI:26835] (1541)   sulfur oxoacid derivative [CHEBI:33424] (628)   sulfonic acid derivative [CHEBI:33552] (393)   sulfonamide [CHEBI:35358] (106)   bumetanide [CHEBI:3213] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   benzoic acids [CHEBI:22723] (150)   bumetanide [CHEBI:3213] (1)  amino acid [CHEBI:33709] (959)   bumetanide [CHEBI:3213] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   benzoic acids [CHEBI:22723] (150)   bumetanide [CHEBI:3213] (1)  amino acid [CHEBI:33709] (959)   bumetanide [CHEBI:3213] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organonitrogen compound [CHEBI:35352] (6705)   organic amino compound [CHEBI:50047] (2472)   amino acid [CHEBI:33709] (959)   bumetanide [CHEBI:3213] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   benzoic acids [CHEBI:22723] (150)   bumetanide [CHEBI:3213] (1)  amino acid [CHEBI:33709] (959)   bumetanide [CHEBI:3213] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   benzoic acids [CHEBI:22723] (150)   bumetanide [CHEBI:3213] (1)  amino acid [CHEBI:33709] (959)   bumetanide [CHEBI:3213] (1)  organic amino compound [CHEBI:50047] (2472)   amino acid [CHEBI:33709] (959)   bumetanide [CHEBI:3213] (1)  organic acid [CHEBI:64709] (3008)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   benzoic acids [CHEBI:22723] (150)   bumetanide [CHEBI:3213] (1)  amino acid [CHEBI:33709] (959)   bumetanide [CHEBI:3213] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   benzoic acids [CHEBI:22723] (150)   bumetanide [CHEBI:3213] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   benzoic acids [CHEBI:22723] (150)   bumetanide [CHEBI:3213] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   benzoic acids [CHEBI:22723] (150)   bumetanide [CHEBI:3213] (1)  amino acid [CHEBI:33709] (959)   bumetanide [CHEBI:3213] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   homocyclic compound [CHEBI:33597] (1134)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   benzoic acids [CHEBI:22723] (150)   bumetanide [CHEBI:3213] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   benzoic acids [CHEBI:22723] (150)   bumetanide [CHEBI:3213] (1)  organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   benzoic acids [CHEBI:22723] (150)   bumetanide [CHEBI:3213] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   benzoic acids [CHEBI:22723] (150)   bumetanide [CHEBI:3213] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   benzoic acids [CHEBI:22723] (150)   bumetanide [CHEBI:3213] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   benzoic acids [CHEBI:22723] (150)   bumetanide [CHEBI:3213] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   benzoic acids [CHEBI:22723] (150)   bumetanide [CHEBI:3213] (1)  amino acid [CHEBI:33709] (959)   bumetanide [CHEBI:3213] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   benzoic acids [CHEBI:22723] (150)   bumetanide [CHEBI:3213] (1)  amino acid [CHEBI:33709] (959)   bumetanide [CHEBI:3213] (1)  oxoacid derivative [CHEBI:33241] (3254)   sulfur oxoacid derivative [CHEBI:33424] (628)   sulfonic acid derivative [CHEBI:33552] (393)   sulfonamide [CHEBI:35358] (106)   bumetanide [CHEBI:3213] (1) ChEBI Compound Accession Identifier:   [CHEBI:3213] ChEBI Compound Description:   4-Phenoxybenzoic acid in which the hydrogens ortho to the phenoxy group are substituted by butylamino and sulfamoyl groups. Bumetanide is a diuretic, and is used for treatment of oedema associated with congestive heart failure, hepatic and renal disease. ChEBI Compound Identification Number:   3213 ChEBI InChI Value:   InChI=1S/C17H20N2O5S/c1-2-3-9-19-14-10-12(17(20)21)11-15(25(18,22)23)16(14)24-13-7-5-4-6-8-13/h4-8,10-11,19H,2-3,9H2,1H3,(H,20,21)(H2,18,22,23) ChEBI InChIKey Value:   MAEIEVLCKWDQJH-UHFFFAOYSA-N ChEBI Compound Name:   bumetanide ChEBI SMILES Value:   CCCCNc1cc(cc(c1Oc1ccccc1)S(N)(=O)=O)C(O)=O ChEBI Substance ID:   92729936 ChEBI URL:   ChEBI:3213 ChemSpider ID:   2377 Ontomatica Chemical Accession Key (OnChAKey):   MAEIEVLCKWDQJH_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   2471