New Search

Item 7 of 7 (back to results)
Previous previous

hycanthone
A thioxanthen-9-one compound having a hydroxymethyl substituent at the 1-position and a 2-[(diethylamino)ethyl]amino substituent at the 4-position. It was formerly used (particularly as the monomethanesulfonic acid salt) as a schistosomicide for individual or mass treatement of infection with Schistosoma haematobium and S. mansoni, but due to its toxicity and concern about possible carcinogenicity, it has been replaced by other drugs such as praziquantel.


Current search:

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 aetiopathogenetic uses [CHEBI:52209] (178) 
 genotoxin [CHEBI:50902] (78) 
 mutagen [CHEBI:25435] (74) 
 hycanthone [CHEBI:52768] (1)
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 antiinfective agent [CHEBI:35441] (82) 
 antiparasitic agent [CHEBI:35442] (30) 
 anthelminthic drug [CHEBI:35443] (20) 
 antiplatyhelmintic drug [CHEBI:35684] (8) 
 schistosomicide drug [CHEBI:38941] (7) 
 hycanthone [CHEBI:52768] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 thioxanthenes [CHEBI:50930] (8) 
 hycanthone [CHEBI:52768] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 thioxanthenes [CHEBI:50930] (8) 
 hycanthone [CHEBI:52768] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 thioxanthenes [CHEBI:50930] (8) 
 hycanthone [CHEBI:52768] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 heterotricyclic compound [CHEBI:36688] (541) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 thioxanthenes [CHEBI:50930] (8) 
 hycanthone [CHEBI:52768] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 thioxanthenes [CHEBI:50930] (8) 
 hycanthone [CHEBI:52768] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 thioxanthenes [CHEBI:50930] (8) 
 hycanthone [CHEBI:52768] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 thioxanthenes [CHEBI:50930] (8) 
 hycanthone [CHEBI:52768] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 thioxanthenes [CHEBI:50930] (8) 
 hycanthone [CHEBI:52768] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 thioxanthenes [CHEBI:50930] (8) 
 hycanthone [CHEBI:52768] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 heterotricyclic compound [CHEBI:36688] (541) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 thioxanthenes [CHEBI:50930] (8) 
 hycanthone [CHEBI:52768] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 thioxanthenes [CHEBI:50930] (8) 
 hycanthone [CHEBI:52768] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 thioxanthenes [CHEBI:50930] (8) 
 hycanthone [CHEBI:52768] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 thioxanthenes [CHEBI:50930] (8) 
 hycanthone [CHEBI:52768] (1)
ChEBI Compound Accession Identifier  [CHEBI:52768]
ChEBI Compound Description  A thioxanthen-9-one compound having a hydroxymethyl substituent at the 1-position and a 2-[(diethylamino)ethyl]amino substituent at the 4-position. It was formerly used (particularly as the monomethanesulfonic acid salt) as a schistosomicide for individual or mass treatement of infection with Schistosoma haematobium and S. mansoni, but due to its toxicity and concern about possible carcinogenicity, it has been replaced by other drugs such as praziquantel.
ChEBI Compound Identification Number  52768
ChEBI InChI Value  InChI=1S/C20H24N2O2S/c1-3-22(4-2)12-11-21-16-10-9-14(13-23)20-18(16)19(24)15-7-5-6-8-17(15)25-20/h5-10,21,23H,3-4,11-13H2,1-2H3
ChEBI InChIKey Value  MFZWMTSUNYWVBU-UHFFFAOYSA-N
ChEBI Compound Name  hycanthone
ChEBI SMILES Value  CCN(CC)CCNc1ccc(CO)c2sc3ccccc3c(=O)c12
ChEBI Substance ID  85096689
ChEBI URL  ChEBI:52768
ChemSpider ID  3508
Ontomatica Chemical Accession Key (OnChAKey)  MFZWMTSUNYWVBU_UHFFFAOYSA_N_000_000000
PubChem Compound ID  3634