Item 8 of 15 (back to results) previous next lespeflorin C3 A member of the class of dihydrochalcones that is alpha-hydroxydihydrochalcone substituted by hydroxy groups at positions 4 and 4', a methoxy group at position 2' and a prenyl group at position 5'. Isolated from the roots of Lespedeza floribunda, it acts as a melanin synthesis inhibitor.

Current search: 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > depigmentation drug [CHEBI:59864] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   lespeflorin C3 [CHEBI:66564] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   depigmentation drug [CHEBI:59864] (15)   melanin synthesis inhibitor [CHEBI:64933] (15)   lespeflorin C3 [CHEBI:66564] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   secondary alcohol [CHEBI:35681] (342)   lespeflorin C3 [CHEBI:66564] (1)  phenols [CHEBI:33853] (868)   lespeflorin C3 [CHEBI:66564] (1)  p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   secondary alcohol [CHEBI:35681] (342)   lespeflorin C3 [CHEBI:66564] (1)  phenols [CHEBI:33853] (868)   lespeflorin C3 [CHEBI:66564] (1)  organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   monomethoxybenzene [CHEBI:25235] (32)   lespeflorin C3 [CHEBI:66564] (1)  carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   dihydrochalcones [CHEBI:71230] (13)   lespeflorin C3 [CHEBI:66564] (1)  flavonoids [CHEBI:72544] (433)   dihydrochalcones [CHEBI:71230] (13)   lespeflorin C3 [CHEBI:66564] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   monomethoxybenzene [CHEBI:25235] (32)   lespeflorin C3 [CHEBI:66564] (1)  carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   dihydrochalcones [CHEBI:71230] (13)   lespeflorin C3 [CHEBI:66564] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   monomethoxybenzene [CHEBI:25235] (32)   lespeflorin C3 [CHEBI:66564] (1)  carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   dihydrochalcones [CHEBI:71230] (13)   lespeflorin C3 [CHEBI:66564] (1)  organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   secondary alcohol [CHEBI:35681] (342)   lespeflorin C3 [CHEBI:66564] (1)  phenols [CHEBI:33853] (868)   lespeflorin C3 [CHEBI:66564] (1)  flavonoids [CHEBI:72544] (433)   dihydrochalcones [CHEBI:71230] (13)   lespeflorin C3 [CHEBI:66564] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   monomethoxybenzene [CHEBI:25235] (32)   lespeflorin C3 [CHEBI:66564] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   monomethoxybenzene [CHEBI:25235] (32)   lespeflorin C3 [CHEBI:66564] (1)  phenols [CHEBI:33853] (868)   lespeflorin C3 [CHEBI:66564] (1)  aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   monomethoxybenzene [CHEBI:25235] (32)   lespeflorin C3 [CHEBI:66564] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   dihydrochalcones [CHEBI:71230] (13)   lespeflorin C3 [CHEBI:66564] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   homocyclic compound [CHEBI:33597] (1134)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   monomethoxybenzene [CHEBI:25235] (32)   lespeflorin C3 [CHEBI:66564] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   monomethoxybenzene [CHEBI:25235] (32)   lespeflorin C3 [CHEBI:66564] (1)  phenols [CHEBI:33853] (868)   lespeflorin C3 [CHEBI:66564] (1)  aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   monomethoxybenzene [CHEBI:25235] (32)   lespeflorin C3 [CHEBI:66564] (1)  organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   monomethoxybenzene [CHEBI:25235] (32)   lespeflorin C3 [CHEBI:66564] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   monomethoxybenzene [CHEBI:25235] (32)   lespeflorin C3 [CHEBI:66564] (1)  phenols [CHEBI:33853] (868)   lespeflorin C3 [CHEBI:66564] (1)  aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   monomethoxybenzene [CHEBI:25235] (32)   lespeflorin C3 [CHEBI:66564] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   monomethoxybenzene [CHEBI:25235] (32)   lespeflorin C3 [CHEBI:66564] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   monomethoxybenzene [CHEBI:25235] (32)   lespeflorin C3 [CHEBI:66564] (1)  phenols [CHEBI:33853] (868)   lespeflorin C3 [CHEBI:66564] (1)  aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   monomethoxybenzene [CHEBI:25235] (32)   lespeflorin C3 [CHEBI:66564] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   dihydrochalcones [CHEBI:71230] (13)   lespeflorin C3 [CHEBI:66564] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   secondary alcohol [CHEBI:35681] (342)   lespeflorin C3 [CHEBI:66564] (1)  phenols [CHEBI:33853] (868)   lespeflorin C3 [CHEBI:66564] (1) ChEBI Compound Accession Identifier:   [CHEBI:66564] ChEBI Compound Description:   A member of the class of dihydrochalcones that is alpha-hydroxydihydrochalcone substituted by hydroxy groups at positions 4 and 4', a methoxy group at position 2' and a prenyl group at position 5'. Isolated from the roots of Lespedeza floribunda, it acts as a melanin synthesis inhibitor. ChEBI Compound Identification Number:   66564 ChEBI InChI Value:   InChI=1S/C21H24O5/c1-13(2)4-7-15-11-17(20(26-3)12-18(15)23)21(25)19(24)10-14-5-8-16(22)9-6-14/h4-6,8-9,11-12,19,22-24H,7,10H2,1-3H3/t19-/m0/s1 ChEBI InChIKey Value:   XTDORSAGLFPXGX-IBGZPJMESA-N ChEBI Compound Name:   lespeflorin C3 ChEBI SMILES Value:   COc1cc(O)c(CC=C(C)C)cc1C(=O)[C@@H](O)Cc1ccc(O)cc1 ChEBI Substance ID:   160710084 ChEBI URL:   ChEBI:66564 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   XTDORSAGLFPXGX_IBGZPJMESA_N_000_000000 PubChem Compound ID:   25243322