Item 10 of 30 (back to results) previous next mesoridazine A phenothiazine substituted at position 2 (para to the S atom) by a methylsulfinyl group, and on the nitrogen by a 2-(1-methylpiperidin-2-yl)ethyl group.

Current search: 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > central nervous system drug [CHEBI:35470] > psychotropic drug [CHEBI:35471] > tranquilizing drug [CHEBI:35473] > antipsychotic agent [CHEBI:35476] > first generation antipsychotic [CHEBI:65190] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  pharmacological uses [CHEBI:52210] (736)   neurotransmitter agent [CHEBI:35942] (471)   dopaminergic agent [CHEBI:48560] (99)   dopaminergic antagonist [CHEBI:48561] (48)   mesoridazine [CHEBI:6780] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   central nervous system drug [CHEBI:35470] (217)   psychotropic drug [CHEBI:35471] (130)   tranquilizing drug [CHEBI:35473] (83)   antipsychotic agent [CHEBI:35476] (51)   first generation antipsychotic [CHEBI:65190] (30)   mesoridazine [CHEBI:6780] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organic amino compound [CHEBI:50047] (2472)   tertiary amino compound [CHEBI:50996] (199)   mesoridazine [CHEBI:6780] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   sulfur molecular entity [CHEBI:26835] (1541)   organosulfur compound [CHEBI:33261] (1005)   sulfoxide [CHEBI:35813] (30)   mesoridazine [CHEBI:6780] (1)  organochalcogen compound [CHEBI:36962] (11874)   organosulfur compound [CHEBI:33261] (1005)   sulfoxide [CHEBI:35813] (30)   mesoridazine [CHEBI:6780] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   mesoridazine [CHEBI:6780] (1)  organonitrogen compound [CHEBI:35352] (6705)   organic amino compound [CHEBI:50047] (2472)   tertiary amino compound [CHEBI:50996] (199)   mesoridazine [CHEBI:6780] (1)  organochalcogen compound [CHEBI:36962] (11874)   organosulfur compound [CHEBI:33261] (1005)   sulfoxide [CHEBI:35813] (30)   mesoridazine [CHEBI:6780] (1)  organic amino compound [CHEBI:50047] (2472)   tertiary amino compound [CHEBI:50996] (199)   mesoridazine [CHEBI:6780] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   mesoridazine [CHEBI:6780] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   mesoridazine [CHEBI:6780] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   heterotricyclic compound [CHEBI:36688] (541)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   mesoridazine [CHEBI:6780] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   mesoridazine [CHEBI:6780] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   mesoridazine [CHEBI:6780] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   mesoridazine [CHEBI:6780] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   mesoridazine [CHEBI:6780] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   mesoridazine [CHEBI:6780] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   heterotricyclic compound [CHEBI:36688] (541)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   mesoridazine [CHEBI:6780] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   mesoridazine [CHEBI:6780] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   mesoridazine [CHEBI:6780] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   mesoridazine [CHEBI:6780] (1) ChEBI Compound Accession Identifier:   [CHEBI:6780] ChEBI Compound Description:   A phenothiazine substituted at position 2 (para to the S atom) by a methylsulfinyl group, and on the nitrogen by a 2-(1-methylpiperidin-2-yl)ethyl group. ChEBI Compound Identification Number:   6780 ChEBI InChI Value:   InChI=1S/C21H26N2OS2/c1-22-13-6-5-7-16(22)12-14-23-18-8-3-4-9-20(18)25-21-11-10-17(26(2)24)15-19(21)23/h3-4,8-11,15-16H,5-7,12-14H2,1-2H3 ChEBI InChIKey Value:   SLVMESMUVMCQIY-UHFFFAOYSA-N ChEBI Compound Name:   mesoridazine ChEBI SMILES Value:   CN1CCCCC1CCN1c2ccccc2Sc2ccc(cc12)S(C)=O ChEBI Substance ID:   104222090 ChEBI URL:   ChEBI:6780 ChemSpider ID:   3936 Ontomatica Chemical Accession Key (OnChAKey):   SLVMESMUVMCQIY_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   4078