| more general categories |
information about this item |
|
| 05. Industrial Uses |
 |
 |
|
05. Industrial Uses |
|
|
|
|
|
|
|
pentosidine [CHEBI:59951] (1) |
|
|
|
|
|
|
|
pentosidine [CHEBI:59951] (1) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pentosidine [CHEBI:59951] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pentosidine [CHEBI:59951] (1) |
|
|
|
|
|
|
|
|
|
|
|
pentosidine [CHEBI:59951] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pentosidine [CHEBI:59951] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pentosidine [CHEBI:59951] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pentosidine [CHEBI:59951] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pentosidine [CHEBI:59951] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pentosidine [CHEBI:59951] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pentosidine [CHEBI:59951] (1) |
|
|
|
|
|
|
|
|
|
|
|
pentosidine [CHEBI:59951] (1) |
|
|
|
|
|
|
|
|
|
|
|
pentosidine [CHEBI:59951] (1) |
|
|
|
|
|
|
|
|
|
|
|
pentosidine [CHEBI:59951] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pentosidine [CHEBI:59951] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pentosidine [CHEBI:59951] (1) |
|
|
|
|
|
|
|
|
|
|
|
pentosidine [CHEBI:59951] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pentosidine [CHEBI:59951] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pentosidine [CHEBI:59951] (1) |
|
|
|
|
|
|
|
|
|
|
|
pentosidine [CHEBI:59951] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pentosidine [CHEBI:59951] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pentosidine [CHEBI:59951] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pentosidine [CHEBI:59951] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pentosidine [CHEBI:59951] (1) |
|
|
|
|
|
|
|
|
|
|
|
pentosidine [CHEBI:59951] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pentosidine [CHEBI:59951] (1) |
|
|
|
|
|
|
|
|
|
|
|
pentosidine [CHEBI:59951] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pentosidine [CHEBI:59951] (1) |
|
|
|
|
|
|
|
|
|
|
|
pentosidine [CHEBI:59951] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pentosidine [CHEBI:59951] (1) |
|
|
|
|
|
|
|
|
|
|
|
pentosidine [CHEBI:59951] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pentosidine [CHEBI:59951] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
pentosidine [CHEBI:59951] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:59951] |
| ChEBI Compound Description: |
An imidazopyridine having norleucine and ornithine residues attached via their side-chains at the 4- and 2-positions respectively. |
| ChEBI Compound Identification Number: |
59951 |
| ChEBI InChI Value: |
InChI=1S/C17H26N6O4/c18-11(15(24)25)5-1-2-9-23-10-4-7-13-14(23)22-17(21-13)20-8-3-6-12(19)16(26)27/h4,7,10-12H,1-3,5-6,8-9,18-19H2,(H,20,21)(H,24,25)(H,26,27)/t11-,12-/m0/s1 |
| ChEBI InChIKey Value: |
AYEKKSTZQYEZPU-RYUDHWBXSA-N |
| ChEBI Compound Name: |
pentosidine |
| ChEBI SMILES Value: |
N[C@@H](CCCCn1cccc2nc(NCCC[C@H](N)C(O)=O)nc12)C(O)=O |
| ChEBI Substance ID: |
99319510 |
| ChEBI URL: |
ChEBI:59951 |
| ChemSpider ID: |
106787 |
| Ontomatica Chemical Accession Key (OnChAKey): |
AYEKKSTZQYEZPU_RYUDHWBXSA_N_000_000000 |
| PubChem Compound ID: |
119593 |