New Search

Item 10 of 15 (back to results)
Previous previous next Next

monacolin L
null

Current search:

05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > antilipemic drug [CHEBI:35679] > anticholesteremic drug [CHEBI:35821]
×

Select any link to see items in a related category.

more general categories    information about this item
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 antilipemic drug [CHEBI:35679] (30) 
 anticholesteremic drug [CHEBI:35821] (15) 
 monacolin L [CHEBI:50130] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 cyclic ketone [CHEBI:3992] (644) 
 pyranone [CHEBI:37963] (29) 
 monacolin L [CHEBI:50130] (1)
 oxacycle [CHEBI:38104] (2002) 
 pyrans [CHEBI:26407] (39) 
 pyranone [CHEBI:37963] (29) 
 monacolin L [CHEBI:50130] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 cyclic ketone [CHEBI:3992] (644) 
 pyranone [CHEBI:37963] (29) 
 monacolin L [CHEBI:50130] (1)
 oxacycle [CHEBI:38104] (2002) 
 pyrans [CHEBI:26407] (39) 
 pyranone [CHEBI:37963] (29) 
 monacolin L [CHEBI:50130] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyrans [CHEBI:26407] (39) 
 pyranone [CHEBI:37963] (29) 
 monacolin L [CHEBI:50130] (1)
 oxacycle [CHEBI:38104] (2002) 
 pyrans [CHEBI:26407] (39) 
 pyranone [CHEBI:37963] (29) 
 monacolin L [CHEBI:50130] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 cyclic ketone [CHEBI:3992] (644) 
 pyranone [CHEBI:37963] (29) 
 monacolin L [CHEBI:50130] (1)
 oxacycle [CHEBI:38104] (2002) 
 pyrans [CHEBI:26407] (39) 
 pyranone [CHEBI:37963] (29) 
 monacolin L [CHEBI:50130] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyrans [CHEBI:26407] (39) 
 pyranone [CHEBI:37963] (29) 
 monacolin L [CHEBI:50130] (1)
 oxacycle [CHEBI:38104] (2002) 
 pyrans [CHEBI:26407] (39) 
 pyranone [CHEBI:37963] (29) 
 monacolin L [CHEBI:50130] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 cyclic ketone [CHEBI:3992] (644) 
 pyranone [CHEBI:37963] (29) 
 monacolin L [CHEBI:50130] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 monocyclic compound [CHEBI:33661] (2007) 
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyrans [CHEBI:26407] (39) 
 pyranone [CHEBI:37963] (29) 
 monacolin L [CHEBI:50130] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyrans [CHEBI:26407] (39) 
 pyranone [CHEBI:37963] (29) 
 monacolin L [CHEBI:50130] (1)
 oxacycle [CHEBI:38104] (2002) 
 pyrans [CHEBI:26407] (39) 
 pyranone [CHEBI:37963] (29) 
 monacolin L [CHEBI:50130] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyrans [CHEBI:26407] (39) 
 pyranone [CHEBI:37963] (29) 
 monacolin L [CHEBI:50130] (1)
 oxacycle [CHEBI:38104] (2002) 
 pyrans [CHEBI:26407] (39) 
 pyranone [CHEBI:37963] (29) 
 monacolin L [CHEBI:50130] (1)
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyrans [CHEBI:26407] (39) 
 pyranone [CHEBI:37963] (29) 
 monacolin L [CHEBI:50130] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyrans [CHEBI:26407] (39) 
 pyranone [CHEBI:37963] (29) 
 monacolin L [CHEBI:50130] (1)
 oxacycle [CHEBI:38104] (2002) 
 pyrans [CHEBI:26407] (39) 
 pyranone [CHEBI:37963] (29) 
 monacolin L [CHEBI:50130] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 cyclic ketone [CHEBI:3992] (644) 
 pyranone [CHEBI:37963] (29) 
 monacolin L [CHEBI:50130] (1)
ChEBI Compound Accession Identifier:   [CHEBI:50130]
ChEBI Compound Description:   null
ChEBI Compound Identification Number:   50130
ChEBI InChI Value:   InChI=1S/C19H28O3/c1-12-3-7-18-14(9-12)5-4-13(2)17(18)8-6-16-10-15(20)11-19(21)22-16/h4-5,9,12-13,15-18,20H,3,6-8,10-11H2,1-2H3/t12-,13+,15-,16-,17+,18+/m1/s1
ChEBI InChIKey Value:   BKZPCUPKVCPRQW-MHMDBQTNSA-N
ChEBI Compound Name:   monacolin L
ChEBI SMILES Value:   [H][C@]12CC[C@@H](C)C=C1C=C[C@H](C)[C@@H]2CC[C@@H]1C[C@@H](O)CC(=O)O1
ChEBI Substance ID:   49836663
ChEBI URL:   ChEBI:50130
ChemSpider ID:   NS
Ontomatica Chemical Accession Key (OnChAKey):   BKZPCUPKVCPRQW_MHMDBQTNSA_N_000_000000
PubChem Compound ID:   15294098