Item 1 of 2 (back to results) next scopolamine A tropane alkaloid that is the (S)-tropic acid ester of 6beta,7beta-epoxy-1alphaH,5alphaH-tropan-3alpha-ol.

Current search: 04. Bioactive Capabilities of Specific Chemicals : Oxidoreductases [EC:1] × 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > neuromuscular agent [CHEBI:51372] > muscle relaxant [CHEBI:51371] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   scopolamine [CHEBI:16794] (1)  pharmacological uses [CHEBI:52210] (736)   neurotransmitter agent [CHEBI:35942] (471)   cholinergic drug [CHEBI:38323] (108)   cholinergic antagonist [CHEBI:48873] (84)   muscarinic antagonist [CHEBI:48876] (61)   scopolamine [CHEBI:16794] (1) 04. Bioactive Capabilities of Specific Chemicals   04. Bioactive Capabilities of Specific Chemicals  Oxidoreductases [EC:1] (1697)   Acting on paired donors, with incorporation or reduction of molecular oxygen [EC:1.14] (587)   With 2-oxoglutarate as one donor, and incorporation of one atom each of oxygen into both donors [EC:1.14.11] (70)   6-beta-hydroxyhyoscyamine epoxidase [EC:1.14.11.14] (8)   scopolamine [CHEBI:16794] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   central nervous system drug [CHEBI:35470] (217)   psychotropic drug [CHEBI:35471] (130)   antidepressant [CHEBI:35469] (44)   scopolamine [CHEBI:16794] (1)  mydriatic agent [CHEBI:50513] (6)   scopolamine [CHEBI:16794] (1)  antiemetic [CHEBI:50919] (41)   scopolamine [CHEBI:16794] (1)  neuromuscular agent [CHEBI:51372] (51)   muscle relaxant [CHEBI:51371] (47)   antispasmodic drug [CHEBI:53784] (18)   scopolamine [CHEBI:16794] (1)  adjuvant [CHEBI:60809] (12)   scopolamine [CHEBI:16794] (1)  anaesthesia adjuvant [CHEBI:60807] (10)   scopolamine [CHEBI:16794] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   alkaloid [CHEBI:22315] (473)   tropane alkaloid [CHEBI:37332] (17)   scopolamine [CHEBI:16794] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azabicycloalkane [CHEBI:38295] (38)   tropane alkaloid [CHEBI:37332] (17)   scopolamine [CHEBI:16794] (1)  organic amino compound [CHEBI:50047] (2472)   tertiary amino compound [CHEBI:50996] (199)   scopolamine [CHEBI:16794] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   cyclic ether [CHEBI:37407] (314)   epoxide [CHEBI:32955] (145)   scopolamine [CHEBI:16794] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   propanoate ester [CHEBI:36243] (13)   scopolamine [CHEBI:16794] (1)  oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   epoxide [CHEBI:32955] (145)   scopolamine [CHEBI:16794] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   cyclic ether [CHEBI:37407] (314)   epoxide [CHEBI:32955] (145)   scopolamine [CHEBI:16794] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   propanoate ester [CHEBI:36243] (13)   scopolamine [CHEBI:16794] (1)  oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   epoxide [CHEBI:32955] (145)   scopolamine [CHEBI:16794] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azabicycloalkane [CHEBI:38295] (38)   tropane alkaloid [CHEBI:37332] (17)   scopolamine [CHEBI:16794] (1)  oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   epoxide [CHEBI:32955] (145)   scopolamine [CHEBI:16794] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   azabicycloalkane [CHEBI:38295] (38)   tropane alkaloid [CHEBI:37332] (17)   scopolamine [CHEBI:16794] (1)  organonitrogen compound [CHEBI:35352] (6705)   alkaloid [CHEBI:22315] (473)   tropane alkaloid [CHEBI:37332] (17)   scopolamine [CHEBI:16794] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azabicycloalkane [CHEBI:38295] (38)   tropane alkaloid [CHEBI:37332] (17)   scopolamine [CHEBI:16794] (1)  organic amino compound [CHEBI:50047] (2472)   tertiary amino compound [CHEBI:50996] (199)   scopolamine [CHEBI:16794] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   cyclic ether [CHEBI:37407] (314)   epoxide [CHEBI:32955] (145)   scopolamine [CHEBI:16794] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   propanoate ester [CHEBI:36243] (13)   scopolamine [CHEBI:16794] (1)  oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   epoxide [CHEBI:32955] (145)   scopolamine [CHEBI:16794] (1)  ester [CHEBI:35701] (3370)   carboxylic ester [CHEBI:33308] (1495)   propanoate ester [CHEBI:36243] (13)   scopolamine [CHEBI:16794] (1)  organic amino compound [CHEBI:50047] (2472)   tertiary amino compound [CHEBI:50996] (199)   scopolamine [CHEBI:16794] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azabicycloalkane [CHEBI:38295] (38)   tropane alkaloid [CHEBI:37332] (17)   scopolamine [CHEBI:16794] (1)  oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   epoxide [CHEBI:32955] (145)   scopolamine [CHEBI:16794] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   azabicycloalkane [CHEBI:38295] (38)   tropane alkaloid [CHEBI:37332] (17)   scopolamine [CHEBI:16794] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   propanoate ester [CHEBI:36243] (13)   scopolamine [CHEBI:16794] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   azabicycloalkane [CHEBI:38295] (38)   tropane alkaloid [CHEBI:37332] (17)   scopolamine [CHEBI:16794] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   azabicycloalkane [CHEBI:38295] (38)   tropane alkaloid [CHEBI:37332] (17)   scopolamine [CHEBI:16794] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azabicycloalkane [CHEBI:38295] (38)   tropane alkaloid [CHEBI:37332] (17)   scopolamine [CHEBI:16794] (1)  oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   epoxide [CHEBI:32955] (145)   scopolamine [CHEBI:16794] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   azabicycloalkane [CHEBI:38295] (38)   tropane alkaloid [CHEBI:37332] (17)   scopolamine [CHEBI:16794] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azabicycloalkane [CHEBI:38295] (38)   tropane alkaloid [CHEBI:37332] (17)   scopolamine [CHEBI:16794] (1)  oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   epoxide [CHEBI:32955] (145)   scopolamine [CHEBI:16794] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   azabicycloalkane [CHEBI:38295] (38)   tropane alkaloid [CHEBI:37332] (17)   scopolamine [CHEBI:16794] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   azabicycloalkane [CHEBI:38295] (38)   tropane alkaloid [CHEBI:37332] (17)   scopolamine [CHEBI:16794] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   azabicycloalkane [CHEBI:38295] (38)   tropane alkaloid [CHEBI:37332] (17)   scopolamine [CHEBI:16794] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azabicycloalkane [CHEBI:38295] (38)   tropane alkaloid [CHEBI:37332] (17)   scopolamine [CHEBI:16794] (1)  oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   epoxide [CHEBI:32955] (145)   scopolamine [CHEBI:16794] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   azabicycloalkane [CHEBI:38295] (38)   tropane alkaloid [CHEBI:37332] (17)   scopolamine [CHEBI:16794] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   propanoate ester [CHEBI:36243] (13)   scopolamine [CHEBI:16794] (1) ChEBI Compound Accession Identifier:   [CHEBI:16794] ChEBI Compound Description:   A tropane alkaloid that is the (S)-tropic acid ester of 6beta,7beta-epoxy-1alphaH,5alphaH-tropan-3alpha-ol. ChEBI Compound Identification Number:   16794 ChEBI InChI Value:   InChI=1S/C17H21NO4/c1-18-13-7-11(8-14(18)16-15(13)22-16)21-17(20)12(9-19)10-5-3-2-4-6-10/h2-6,11-16,19H,7-9H2,1H3/t11-,12-,13-,14+,15-,16+/m1/s1 ChEBI InChIKey Value:   STECJAGHUSJQJN-FWXGHANASA-N ChEBI Compound Name:   scopolamine ChEBI SMILES Value:   CN1[C@H]2C[C@@H](C[C@@H]1[C@H]1O[C@@H]21)OC(=O)[C@H](CO)c1ccccc1 ChEBI Substance ID:   8144656 ChEBI URL:   ChEBI:16794 ChemSpider ID:   10194106 Ontomatica Chemical Accession Key (OnChAKey):   STECJAGHUSJQJN_FWXGHANASA_N_000_000000 PubChem Compound ID:   3000322