Item 1 of 1 (back to results) herbimycin A 19-membered macrocyle incorporating a benzoquinone ring and a lactam functionality. It is an ansamycin antibiotic that induces apoptosis and displays antitumour effects.

Current search: 09. Chemical Capabilities: inhibitor [CHEBI:35222] × 05. Industrial Uses: pesticide [CHEBI:25944] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   apoptosis inducer [CHEBI:68495] (23)   herbimycin [CHEBI:5674] (1)  enzyme inhibitor [CHEBI:23924] (825)   protein kinase inhibitor [CHEBI:37699] (69)   tyrosine kinase inhibitor [CHEBI:38637] (38)   herbimycin [CHEBI:5674] (1)  antimicrobial agent [CHEBI:33281] (927)   antibiotic [CHEBI:22582] (193)   herbimycin [CHEBI:5674] (1) 05. Industrial Uses  05. Industrial Uses  pesticide [CHEBI:25944] (211)   herbicide [CHEBI:24527] (48)   herbimycin [CHEBI:5674] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   amide [CHEBI:32988] (1863)   cyclic amide [CHEBI:3990] (252)   lactam [CHEBI:24995] (252)   herbimycin [CHEBI:5674] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   lactam [CHEBI:24995] (252)   herbimycin [CHEBI:5674] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   benzoquinones [CHEBI:22729] (30)   herbimycin [CHEBI:5674] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   benzoquinones [CHEBI:22729] (30)   herbimycin [CHEBI:5674] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   lactam [CHEBI:24995] (252)   herbimycin [CHEBI:5674] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   lactam [CHEBI:24995] (252)   herbimycin [CHEBI:5674] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   benzoquinones [CHEBI:22729] (30)   herbimycin [CHEBI:5674] (1)  quinone [CHEBI:36141] (209)   benzoquinones [CHEBI:22729] (30)   herbimycin [CHEBI:5674] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   lactam [CHEBI:24995] (252)   herbimycin [CHEBI:5674] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   benzoquinones [CHEBI:22729] (30)   herbimycin [CHEBI:5674] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   lactam [CHEBI:24995] (252)   herbimycin [CHEBI:5674] (1)  macrocycle [CHEBI:51026] (234)   herbimycin [CHEBI:5674] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   lactam [CHEBI:24995] (252)   herbimycin [CHEBI:5674] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   lactam [CHEBI:24995] (252)   herbimycin [CHEBI:5674] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   benzoquinones [CHEBI:22729] (30)   herbimycin [CHEBI:5674] (1) 09. Chemical Capabilities  09. Chemical Capabilities  inhibitor [CHEBI:35222] (39)   Hsp90 inhibitor [CHEBI:63962] (9)   herbimycin [CHEBI:5674] (1) ChEBI Compound Accession Identifier:   [CHEBI:5674] ChEBI Compound Description:   A 19-membered macrocyle incorporating a benzoquinone ring and a lactam functionality. It is an ansamycin antibiotic that induces apoptosis and displays antitumour effects. ChEBI Compound Identification Number:   5674 ChEBI InChI Value:   InChI=1S/C30H42N2O9/c1-16-10-9-11-23(37-5)28(41-30(31)36)18(3)12-17(2)27(40-8)24(38-6)13-19(4)26(39-7)21-14-20(33)15-22(25(21)34)32-29(16)35/h9-12,14-15,17,19,23-24,26-28H,13H2,1-8H3,(H2,31,36)(H,32,35)/b11-9-,16-10+,18-12+/t17-,19-,23-,24-,26+,27+,28-/m0/s1 ChEBI InChIKey Value:   MCAHMSDENAOJFZ-BVXDHVRPSA-N ChEBI Compound Name:   herbimycin ChEBI SMILES Value:   CO[C@H]1C[C@H](C)[C@@H](OC)C2=CC(=O)C=C(NC(=O)\C(C)=C\C=C/[C@H](OC)[C@@H](OC(N)=O)\C(C)=C\[C@H](C)[C@H]1OC)C2=O ChEBI Substance ID:   160644695 ChEBI URL:   ChEBI:5674 ChemSpider ID:   10272738 Ontomatica Chemical Accession Key (OnChAKey):   MCAHMSDENAOJFZ_BVXDHVRPSA_N_000_000000 PubChem Compound ID:   5311102